Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 11:52, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 456822624 of page Perillaldehyde for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit Revision as of 11:52, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{drugbox}} taken from revid 456536506 of page Perindopril for the Chem/Drugbox validation project (updated: 'DrugBank', 'UNII', 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 408800851 | verifiedrevid = 418739936
| IUPAC_name = (2''S'',3''aS'',7''aS'')-1-amino}propanoyl]-octahydro-1''H''-indole-2-carboxylic acid
| Reference=<ref>'']'', 12th Edition, '''7308'''.</ref>
| image = Perindopril.svg
| ImageFileL1 = Perillaldehyde chemical structure.png
| ImageSizeL1 = 80px | width = 180

| ImageNameL1 = Skeletal formula of perillaldehyde
<!--Clinical data-->
| ImageFileR1 = S-Perillaldehyde-3D-balls.png
| ImageSizeR1 = 160px | tradename = Aceon
| Drugs.com = {{drugs.com|monograph|aceon}}
| ImageNameR1 = Ball-and-stick model of perillaldehyde
| MedlinePlus = a602017
| IUPACName = (''S'')-4-(1-Methylethenyl)-1-cyclohexene-1-carboxaldehyde
| pregnancy_category = D
| OtherNames = Perilla aldehyde; 4-Mentha-1,8-dien-7-al
| legal_status =
| Section1 = {{Chembox Identifiers
| routes_of_administration = oral
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

⚫ | ChemSpiderID = 15589
<!--Pharmacokinetic data-->
| bioavailability = 24%
| protein_bound = 20%
| metabolism = Renal
| elimination_half-life = 1 hour - 17 hours for perindoprilat (active metabolite)

<!--Identifiers-->
⚫ | CASNo_Ref = {{cascite|changed|??}}
| CAS_number_Ref = {{cascite|correct|??}}
⚫ | CAS_number = <!-- blanked - oldvalue: 82834-16-0 -->
| ATC_prefix = C09
| ATC_suffix = AA04
| ATC_supplemental = <br>{{ATC|C09|BA04}} (with ]s)<br>{{ATC|C09|BB04}} (with ])
⚫ | PubChem = 107807
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00790
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 96956
⚫ | UNII_Ref = {{fdacite|correct|FDA}}
⚫ | UNII = Y5GMK36KGY
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C02576 | KEGG = D03753
⚫ | ChEBI_Ref = {{ebicite|changed|EBI}}
| InChI = 1/C10H14O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,7,10H,1,4-6H2,2H3
⚫ | ChEBI = 8024
| InChIKey = RUMOYJJNUMEFDD-UHFFFAOYAO
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 469537 | ChEMBL = 1581

<!--Chemical data-->
| C=19 | H=32 | N=2 | O=5
| molecular_weight = 368.468 g/mol
| smiles = O=C(OCC)(N(C(=O)N1(C(=O)O)C2CCCC12)C)CCC
| InChI = 1/C19H32N2O5/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24/h12-16,20H,4-11H2,1-3H3,(H,23,24)/t12-,13-,14-,15-,16-/m0/s1
| InChIKey = IPVQLZZIHOAWMC-QXKUPLGCBD
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C10H14O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,7,10H,1,4-6H2,2H3 | StdInChI = 1S/C19H32N2O5/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24/h12-16,20H,4-11H2,1-3H3,(H,23,24)/t12-,13-,14-,15-,16-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RUMOYJJNUMEFDD-UHFFFAOYSA-N | StdInChIKey = IPVQLZZIHOAWMC-QXKUPLGCSA-N
⚫ | CASNo_Ref = {{cascite|correct|??}}
⚫ | CASNo = <!-- blanked - oldvalue: 2111-75-3 -->
⚫ | PubChem = 16441
⚫ | UNII_Ref = {{fdacite|changed|FDA}}
⚫ | UNII = 6EQL0XA86G
⚫ | ChEBI_Ref = {{ebicite|changed|EBI}}
⚫ | ChEBI = 15421
| SMILES = O=C\C1=C\CC(\C(=C)C)CC1
}}
| Section2 = {{Chembox Properties
| C=10|H=14|O=1
| Appearance = Colorless liquid
| Density = 0.953 g/mL (20 °C)
| MeltingPt =
| BoilingPt = 237 °C (745 mmHg)
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| Autoignition =
}}
}} }}

Revision as of 11:52, 5 December 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456536506 of page Perindopril with values updated to verified values.

{{Drugbox | Verifiedfields = changed | verifiedrevid = 418739936 | IUPAC_name = (2S,3aS,7aS)-1-amino}propanoyl]-octahydro-1H-indole-2-carboxylic acid | image = Perindopril.svg | width = 180

| tradename = Aceon | Drugs.com = Monograph | MedlinePlus = a602017 | pregnancy_category = D | legal_status = | routes_of_administration = oral

| bioavailability = 24% | protein_bound = 20% | metabolism = Renal | elimination_half-life = 1 hour - 17 hours for perindoprilat (active metabolite)

| CASNo_Ref = | CAS_number_Ref = | CAS_number = | ATC_prefix = C09 | ATC_suffix = AA04 | ATC_supplemental =
C09BA04 (WHO) (with diuretics)
C09BB04 (WHO) (with amlodipine) | PubChem = 107807 | DrugBank_Ref = | DrugBank = DB00790 | ChemSpiderID_Ref = | ChemSpiderID = 96956 | UNII_Ref = | UNII = Y5GMK36KGY | KEGG_Ref = | KEGG = D03753 | ChEBI_Ref = | ChEBI = 8024 | ChEMBL_Ref = | ChEMBL = 1581

| C=19 | H=32 | N=2 | O=5 | molecular_weight = 368.468 g/mol | smiles = O=C(OCC)(N(C(=O)N1(C(=O)O)C2CCCC12)C)CCC | InChI = 1/C19H32N2O5/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24/h12-16,20H,4-11H2,1-3H3,(H,23,24)/t12-,13-,14-,15-,16-/m0/s1 | InChIKey = IPVQLZZIHOAWMC-QXKUPLGCBD | StdInChI_Ref = | StdInChI = 1S/C19H32N2O5/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24/h12-16,20H,4-11H2,1-3H3,(H,23,24)/t12-,13-,14-,15-,16-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = IPVQLZZIHOAWMC-QXKUPLGCSA-N }}

Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic