Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 12:55, 5 December 2011 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 454142852 of page Phosphorous_acid for the Chem/Drugbox validation project (updated: '').← Previous edit		Revision as of 12:55, 5 December 2011 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 463037547 of page Phosphorus_pentoxide for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~Chembox~~		{{chembox
	\| verifiedrevid = ~~451036575~~		\| verifiedrevid = 444052010
			\| Name = Phosphorus pentoxide
	\| ImageFileL1 = ~~Phosphonic~~-~~acid~~-2D-dimensions.png		\| ImageFileL1 = Phosphorus-pentoxide-2D-dimensions.png
	\| ImageSizeL1 = ~~120px~~		\| ImageSizeL1 = 150px
	\| ImageNameL1 = Wireframe model of phosphorous acid
			\| ImageNameL1 = Phosphorus pentoxide
	\| ImageFileR1 = ~~Phosphonic~~-~~acid~~-3D-balls-A.png		\| ImageFileR1 = Phosphorus-pentoxide-3D-balls.png
	\| ImageSizeR1 = ~~120px~~		\| ImageSizeR1 = 125px
	\| ImageNameR1 = Ball and stick model of phosphorous acid
			\| ImageNameR1 = Phosphorus pentoxide
	\| IUPACName = phosphonic acid
	\| OtherNames = ~~Dihydroxyphosphine~~ oxide<br />		\| OtherNames = Diphosphorus pentoxide <br/>Phosphorus(V) oxide<br />Phosphoric anhydride
	Dihydroxy(oxo)-λ<sup>5</sup>-phosphane<br />
	Dihydroxy-λ<sup>5</sup>-phosphanone<br />
	Orthophosphorous acid<br />
	Oxo-λ<sup>5</sup>-phosphanediol<br />
	Oxo-λ<sup>5</sup>-phosphonous acid
	\| Section1 = {{Chembox Identifiers		\| Section1 = {{Chembox Identifiers
	\| ~~KEGG_Ref~~ = {{~~keggcite~~\|correct\|~~kegg~~}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
			\| StdInChI = 1S/O10P4/c1-11-5-12(2)8-13(3,6-11)10-14(4,7-11)9-12
	\| KEGG = C06701
		⚫	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| InChI = 1/H3O3P/c1-4(2)3/h4H,(H2,1,2,3)
		⚫	\| StdInChIKey = DLYUQMMRRRQYAE-UHFFFAOYSA-N
	\| InChIKey = ABLZXFCXXLZCGV-UHFFFAOYAF
		⚫	\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
⚫	\| CASNo = ~~13598~~-36-2
			\| ChEBI = 37376
	\| CASNo_Ref = {{cascite\|correct\|CAS}}
			\| SMILES = O=P13OP2(=O)OP(=O)(O1)OP(=O)(O2)O3
⚫	\| ChemSpiderID = ~~10449259~~
	\| ~~ChemSpiderID_Ref~~ = {{~~chemspidercite~~\|correct\|~~chemspider~~}}		\| CASNo_Ref = {{cascite\|correct\|CAS}}
		⚫	\| CASNo = 1314-56-3
	\| ChemSpiderID1 = 10459438
	\| ~~ChemSpiderID1_Comment~~ = (<~~sup~~>17</~~sup~~>''O''<~~sup~~>3</~~sup~~>)		\| CASOther = <br /> (P<sub>4</sub>O<sub>10</sub>)
			\| PubChem = 14812
	\| ChemSpiderID1_Ref = {{Chemspidercite}}
		⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| RTECS = SZ6400000
		⚫	\| ChemSpiderID = 14128
⚫	\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
	\| ~~ChEBI~~ = ~~44976~~		\| RTECS = TH3945000
		⚫	}}
	\| SMILES = OP(=O)O
⚫	\| ~~StdInChI_Ref~~ = {{~~stdinchicite~~\|correct\|chemspider}}
	\| StdInChI = 1S/H3O3P/c1-4(2)3/h4H,(H2,1,2,3)
⚫	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
⚫	\| StdInChIKey = ~~ABLZXFCXXLZCGV~~-UHFFFAOYSA-N}}
	\| Section2 = {{Chembox Properties		\| Section2 = {{Chembox Properties
			\| P=4\|O=10
	\| Formula = H<sub>3</sub>PO<sub>3</sub>
	\| ~~MolarMass~~ = 82.00 g/mol		\| ExactMass = 283.889048 g/mol
	\| Appearance = white ~~solid~~ <br> ]		\| Appearance = white powder<br />very ]<br />pungent odour
	\| Density = 1.~~651~~ g/cm<sup>3</sup> ~~(21 °C)~~		\| Density = 2.39 g/cm<sup>3</sup>
	\| Solubility = ~~310 g/100~~ mL		\| Solubility = ] hydrolysis
		⚫	\| MeltingPtC = 340
	\| SolubleOther = soluble in ]
		⚫	\| BoilingPt = 360 °C (sublimes)
⚫	\| MeltingPtC = ~~73.6~~
			\| VaporPressure = 1 mmHg @ 384 °C
⚫	\| BoilingPt = ~~200~~ °C (~~decomp~~)
	}}~~<!--~~		}}
	\| ] (p''K''<sub>a1</sub>)
	\| 2.0
	\|-
	\| ] (p''K''<sub>a2</sub>)
	\| 6.7
	\|-

	-->
	\| Section3 = {{Chembox Structure
	\| MolShape = tetrahedral
	\| CrystalStruct =
	\| Dipole =
⚫	}}
	\| Section7 = {{Chembox Hazards		\| Section7 = {{Chembox Hazards
	\| ExternalMSDS =		\| ExternalMSDS =
			\| EUClass = not listed
	\| MainHazards = skin irritant
	\| NFPA-H = 2		\| NFPA-H = 3
	\| NFPA-R = 1		\| NFPA-R = 3
	\| NFPA-F = 0		\| NFPA-F = 1
	\| ~~RPhrases~~ = ~~22-35~~		\| NFPA-O = W
		⚫	}}
	\| SPhrases = 26-36/37/39-45
⚫	}}
	\| Section8 = {{Chembox Related
	\| Function = ]
	\| OtherFunctn =
	\| OtherCpds = ] (i.e., PO(OH)<sub>3</sub>)<br />] (i.e., H<sub>2</sub>PO(OH))
	}}
	}}		}}

Revision as of 12:55, 5 December 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 463037547 of page Phosphorus_pentoxide with values updated to verified values.

Phosphorus pentoxide