Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 13:08, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457076302 of page Pimozide for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 13:08, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456597371 of page Pinazepam for the Chem/Drugbox validation project (updated: 'DrugBank', 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{drugbox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 419225254 | verifiedrevid = 408575751
| IUPAC_name = 1--<BR>4-piperidinyl]-1,3-dihydro-<BR>2''H''-benzimidazole-2-one | IUPAC_name = 7-chloro-5-phenyl-1-prop-2-yn-1-yl-1,3-dihydro-2''H''-1,4-benzodiazepin-2-one
| image = Pimozide skeletal.svg | image = Pinazepam.svg
| width = 300 | width = 150
| image2 = Pinazepam3d.png


<!--Clinical data--> <!--Clinical data-->
| tradename = Orap | tradename =
| Drugs.com = {{drugs.com|monograph|pimozide}} | Drugs.com = {{drugs.com|international|pinazepam}}
| pregnancy_category = ?
| MedlinePlus = a686018
| legal_status = ](US)
| pregnancy_category = Teratogenic data in rats exist : drug should only be used when the benefit clearly exceeds the potential harm to the unborn
⚫ | routes_of_administration = Oral
| legal_status = Rx-only, not a controlled narcotic
⚫ | routes_of_administration = oral only


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = at least 40 to 50% | bioavailability = ?
| metabolism = ]
| metabolism = hepatic, by cytochrome P450, isoenzymes 3A, and 1A2; metabolites are inactive
| elimination_half-life = 2 to 3 days (average in one study 55 hours) | elimination_half-life = ?
| excretion = urine, and to a lesser extent in feces | excretion = ]


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 2062-78-4 | CAS_number = <!-- blanked - oldvalue: 52463-83-9 -->
| ATC_prefix = N05 | ATC_prefix = N05
| ATC_suffix = AG02 | ATC_suffix = BA14
| PubChem = 16362 | PubChem = 40391
⚫ | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| IUPHAR_ligand = 90
| DrugBank = <!-- blanked - oldvalue: ? -->
⚫ | DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB01100
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 15520 | ChemSpiderID = 36899
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 1HIZ4DL86F | UNII = 5286RBZ882
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00560 | KEGG = D07314
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 8212
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1423 | ChEMBL = 1213352


<!--Chemical data--> <!--Chemical data-->
| C=28 | H=29 | F=2 | N=3 | O=1 | C=18 | H=13 | Cl=1 | N=2 | O=1
| molecular_weight = 461.56 | molecular_weight = 308.8
| smiles = Clc3cc\1c(N(C(=O)C/N=C/1c2ccccc2)CC#C)cc3
| smiles = Fc1ccc(cc1)C(c2ccc(F)cc2)CCCN5CCC(N4c3ccccc3NC4=O)CC5
| InChI = 1/C28H29F2N3O/c29-22-11-7-20(8-12-22)25(21-9-13-23(30)14-10-21)4-3-17-32-18-15-24(16-19-32)33-27-6-2-1-5-26(27)31-28(33)34/h1-2,5-14,24-25H,3-4,15-19H2,(H,31,34) | InChI = 1/C18H13ClN2O/c1-2-10-21-16-9-8-14(19)11-15(16)18(20-12-17(21)22)13-6-4-3-5-7-13/h1,3-9,11H,10,12H2
| InChIKey = MFZOSKPPVCIFMT-UHFFFAOYAQ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C28H29F2N3O/c29-22-11-7-20(8-12-22)25(21-9-13-23(30)14-10-21)4-3-17-32-18-15-24(16-19-32)33-27-6-2-1-5-26(27)31-28(33)34/h1-2,5-14,24-25H,3-4,15-19H2,(H,31,34) | StdInChI = 1S/C18H13ClN2O/c1-2-10-21-16-9-8-14(19)11-15(16)18(20-12-17(21)22)13-6-4-3-5-7-13/h1,3-9,11H,10,12H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YVUQSNJEYSNKRX-UHFFFAOYSA-N | StdInChIKey = MFZOSKPPVCIFMT-UHFFFAOYSA-N
| synonyms = <small>9-chloro-6-phenyl-2-prop-2-ynyl-2,5-diazabicycloundeca-5,8,10,12-tetraen-3-one</small>
}} }}

Revision as of 13:08, 5 December 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456597371 of page Pinazepam with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Other names9-chloro-6-phenyl-2-prop-2-ynyl-2,5-diazabicycloundeca-5,8,10,12-tetraen-3-one
AHFS/Drugs.comInternational Drug Names
Pregnancy
category
  • ?
Routes of
administration		Oral
ATC code
Legal status
Legal status
Pharmacokinetic data
Bioavailability?
MetabolismHepatic
Elimination half-life?
ExcretionRenal
Identifiers
IUPAC name
  • 7-chloro-5-phenyl-1-prop-2-yn-1-yl-1,3-dihydro-2H-1,4-benzodiazepin-2-one
PubChem CID
ChemSpider
UNII
KEGG
ChEMBL
Chemical and physical data
FormulaC18H13ClN2O
Molar mass308.8 g·mol
3D model (JSmol)
SMILES
  • Clc3cc\1c(N(C(=O)C/N=C/1c2ccccc2)CC#C)cc3
InChI
  • InChI=1S/C18H13ClN2O/c1-2-10-21-16-9-8-14(19)11-15(16)18(20-12-17(21)22)13-6-4-3-5-7-13/h1,3-9,11H,10,12H2
  • Key:MFZOSKPPVCIFMT-UHFFFAOYSA-N
  (what is this?)  (verify)