Revision as of 13:45, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455862119 of page Porphin for the Chem/Drugbox validation project (updated: '').← Previous edit | Revision as of 13:45, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456603564 of page Posaconazole for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit → | ||
Line 1: | Line 1: | ||
{{ambox | text = This page contains a copy of the infobox ({{tl| |
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} | ||
{{ |
{{Drugbox | ||
| Verifiedfields = changed | |||
| verifiedrevid = |
| verifiedrevid = 402557205 | ||
|ImageFile1 = Porphyrin.svg | |||
| IUPAC_name = 4-(4-(4-(4-(((3r,5r)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl)methoxy)phenyl)piperazin-1-yl)phenyl)-2-((2s,3s)-2-hydroxypentan-3-yl)-1,2,4-triazol-3-one | |||
|ImageSize= | |||
| image = Posaconazole.svg | |||
|ImageFile2 = Porphyrin3D.png | |||
| width = 280 | |||
|ImageSize= | |||
| image2 = Posaconazole3d.png | |||
|IUPACName= | |||
|OtherNames= Porphine | |||
<!--Clinical data--> | |||
|Section1={{Chembox Identifiers | |||
| tradename = Noxafil | |||
⚫ | | |
||
| Drugs.com = {{drugs.com|monograph|posaconazole}} | |||
⚫ | | ChemSpiderID = |
||
| MedlinePlus = a607036 | |||
| InChI = 1/C20H14N4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-12,21,24H/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12- | |||
| licence_EU = Noxafil | |||
| InChIKey = RKCAIXNGYQCCAL-CEVVSZFKBA | |||
| licence_US = Posaconazole | |||
| pregnancy_AU = B3 | |||
| pregnancy_US = C | |||
| legal_US = Rx-only | |||
| routes_of_administration = Oral | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = High | |||
| protein_bound = 98 to 99% | |||
| metabolism = ] ] | |||
| elimination_half-life = 16 to 31 hours | |||
| excretion = Fecal (77%) and ] (14%) | |||
<!--Identifiers--> | |||
⚫ | | CASNo_Ref = {{cascite|correct|CAS}} | ||
⚫ | | CAS_number_Ref = {{cascite|correct|??}} | ||
| CAS_number = 171228-49-2 | |||
| ATC_prefix = J02 | |||
| ATC_suffix = AC04 | |||
⚫ | | PubChem = 147912 | ||
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} | |||
| DrugBank = DB01263 | |||
⚫ | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
⚫ | | ChemSpiderID = 130409 | ||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 6TK1G07BHZ | |||
| KEGG_Ref = {{keggcite|changed|kegg}} | |||
| KEGG = D02555 | |||
| ChEMBL_Ref = {{ebicite|changed|EBI}} | |||
| ChEMBL = <!-- blanked - oldvalue: 1397 --> | |||
| C=37 | H=42 | F=2 | N=8 | O=4 | |||
| molecular_weight = 700.778 g/mol | |||
| smiles = O=C1N(/N=C\N1c2ccc(cc2)N7CCN(c6ccc(OCC3C(OC3)(c4ccc(F)cc4F)Cn5ncnc5)cc6)CC7)(CC)(O)C | |||
| InChI = 1/C37H42F2N8O4/c1-3-35(26(2)48)47-36(49)46(25-42-47)31-7-5-29(6-8-31)43-14-16-44(17-15-43)30-9-11-32(12-10-30)50-20-27-19-37(51-21-27,22-45-24-40-23-41-45)33-13-4-28(38)18-34(33)39/h4-13,18,23-27,35,48H,3,14-17,19-22H2,1-2H3/t26-,27?,35-,37-/m0/s1 | |||
| InChIKey = RAGOYPUPXAKGKH-AGDNISCABP | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChI = 1S/ |
| StdInChI = 1S/C37H42F2N8O4/c1-3-35(26(2)48)47-36(49)46(25-42-47)31-7-5-29(6-8-31)43-14-16-44(17-15-43)30-9-11-32(12-10-30)50-20-27-19-37(51-21-27,22-45-24-40-23-41-45)33-13-4-28(38)18-34(33)39/h4-13,18,23-27,35,48H,3,14-17,19-22H2,1-2H3/t26-,27?,35-,37-/m0/s1 | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChIKey = |
| StdInChIKey = RAGOYPUPXAKGKH-AGDNISCASA-N | ||
| synonyms = <small>4-{4-methoxy}phenyl)piperazin-1-yl]phenyl}-1--4,5-dihydro-1''H''-1,2,4-triazol-5-one</small> | |||
⚫ | | CASNo_Ref = {{cascite|correct|CAS}} | ||
| CASNo=101-60-0 | |||
⚫ | | |
||
⚫ | | |
||
| ChEBI = 8337 | |||
| SMILES = c1c/2c(c1)/cc/3\nc(/cc/4\/c(c\c5n/c(c2)/C=C5)/cc4)C=C3 | |||
}} | |||
|Section2={{Chembox Properties | |||
| Formula=C<sub>20</sub>H<sub>14</sub>N<sub>4</sub> | |||
| MolarMass=310.35196 g/mol | |||
| Appearance= | |||
| Density= | |||
| MeltingPt= | |||
| BoilingPt= | |||
| Solubility= | |||
}} | |||
|Section3={{Chembox Hazards | |||
| MainHazards= | |||
| FlashPt= | |||
| Autoignition= | |||
}} | |||
}} | }} |
Revision as of 13:45, 5 December 2011
![]() | This page contains a copy of the infobox ({{drugbox}}) taken from revid 456603564 of page Posaconazole with values updated to verified values. |
{{Drugbox | Verifiedfields = changed | verifiedrevid = 402557205 | IUPAC_name = 4-(4-(4-(4-(((3r,5r)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl)methoxy)phenyl)piperazin-1-yl)phenyl)-2-((2s,3s)-2-hydroxypentan-3-yl)-1,2,4-triazol-3-one | image = Posaconazole.svg | width = 280 | image2 = Posaconazole3d.png
| tradename = Noxafil | Drugs.com = Monograph | MedlinePlus = a607036 | licence_EU = Noxafil | licence_US = Posaconazole | pregnancy_AU = B3 | pregnancy_US = C | legal_US = Rx-only | routes_of_administration = Oral
| bioavailability = High | protein_bound = 98 to 99% | metabolism = Hepatic glucuronidation | elimination_half-life = 16 to 31 hours | excretion = Fecal (77%) and renal (14%)
| CASNo_Ref = | CAS_number_Ref = | CAS_number = 171228-49-2 | ATC_prefix = J02 | ATC_suffix = AC04 | PubChem = 147912 | DrugBank_Ref = | DrugBank = DB01263 | ChemSpiderID_Ref = | ChemSpiderID = 130409 | UNII_Ref = | UNII = 6TK1G07BHZ | KEGG_Ref = | KEGG = D02555 | ChEMBL_Ref = | ChEMBL = | C=37 | H=42 | F=2 | N=8 | O=4 | molecular_weight = 700.778 g/mol | smiles = O=C1N(/N=C\N1c2ccc(cc2)N7CCN(c6ccc(OCC3C(OC3)(c4ccc(F)cc4F)Cn5ncnc5)cc6)CC7)(CC)(O)C | InChI = 1/C37H42F2N8O4/c1-3-35(26(2)48)47-36(49)46(25-42-47)31-7-5-29(6-8-31)43-14-16-44(17-15-43)30-9-11-32(12-10-30)50-20-27-19-37(51-21-27,22-45-24-40-23-41-45)33-13-4-28(38)18-34(33)39/h4-13,18,23-27,35,48H,3,14-17,19-22H2,1-2H3/t26-,27?,35-,37-/m0/s1 | InChIKey = RAGOYPUPXAKGKH-AGDNISCABP | StdInChI_Ref = | StdInChI = 1S/C37H42F2N8O4/c1-3-35(26(2)48)47-36(49)46(25-42-47)31-7-5-29(6-8-31)43-14-16-44(17-15-43)30-9-11-32(12-10-30)50-20-27-19-37(51-21-27,22-45-24-40-23-41-45)33-13-4-28(38)18-34(33)39/h4-13,18,23-27,35,48H,3,14-17,19-22H2,1-2H3/t26-,27?,35-,37-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = RAGOYPUPXAKGKH-AGDNISCASA-N | synonyms = 4-{4-methoxy}phenyl)piperazin-1-yl]phenyl}-1--4,5-dihydro-1H-1,2,4-triazol-5-one }}