Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 11:07, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 464369893 of page Aspartic_acid for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 11:08, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 464369875 of page Ethylene-vinyl_acetate for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| verifiedrevid = 443401656 | verifiedrevid = 441172086
| Name = Aspartic acid | Name = Ethylene-vinyl acetate
| ImageFile = Asparaginsäure - Aspartic acid.svg | ImageFile = ethylenvinylacetat.svg
| ImageSize = 150
| ImageName = Skeletal formula
| ImageFile1 = L-aspartic-acid-3D-balls.png | IUPACName = but-3-enoic acid; ethene
| ImageSize1 = 180 | SystematicName =
| OtherNames =
| ImageName1 = Ball-and-stick model of the L-isomer
| IUPACName = ''Trivial:'' Aspartic acid <br> ''Systematic:'' 2-Aminobutanedioic acid
| OtherNames = Aminosuccinic acid, asparagic acid, asparaginic acid<ref name=merck>{{cite book |title= The Merck Index |chapter= 862. Aspartic acid |edition= 11th |page= 132 |year= 1989 |isbn= 091191028X}}</ref>
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| Abbreviations =
| UNII_Ref = {{fdacite|correct|FDA}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| UNII = 28XF4669EP
| ChemSpiderID = 153318
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| UNII_Ref = {{fdacite|correct|FDA}}
| ChEMBL = 139661
| UNII = 4OKC630HS6
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C16433
| InChI = 1/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)
| InChIKey = CKLJMWTZIZZHCS-UHFFFAOYAE
| SMILES1 = C(C(C(=O)O)N)C(=O)O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CKLJMWTZIZZHCS-UHFFFAOYSA-N | StdInChIKey = HDERJYVLTPVNRI-UHFFFAOYSA-N
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| CASNo = 617-45-8
| StdInChI = 1S/C4H6O2.C2H4/c1-3-6-4(2)5;1-2/h3H,1H2,2H3;1-2H2
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo_Ref = {{cascite|correct|CAS}}
| CASOther = <br/>56-84-8 (<small>L</small>-isomer)<br/>1783-96-6 (<small>D</small>-isomer) <!-- also verified at CAS Common Chemistry -->
| EC-number = 200-291-6 | CASNo = 24937-78-8
| PubChem = 424 | EINCS =
| EINECSCASNO =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 411 | PubChem = 32742
| SMILES = O=C(O\C=C)C.C=C
| ChEBI_Ref = {{ebicite|correct|EBI}}
| InChI = 1/C4H6O2.C2H4/c1-3-6-4(2)5;1-2/h3H,1H2,2H3;1-2H2
| ChEBI = 22660
| RTECS =
| SMILES = O=C(O)CC(N)C(=O)O
| MeSHName =
}}
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI =
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG =
| ATCCode_prefix =
| ATCCode_suffix =
| ATC_Supplemental =}}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula =
| C=4 | H=7 | N=1 | O=4
| MolarMass =
| Appearance =
| Appearance =
| Density =
| Density =
| MeltingPt =
| MeltingPt =
| BoilingPt =
| Melting_notes =
| Solubility =
| BoilingPt =
}}
| Boiling_notes =
| Solubility =
| SolubleOther =
| Solvent =
| LogP =
| VaporPressure =
| HenryConstant =
| AtmosphericOHRateConstant =
| pKa =
| pKb = }}
| Section3 = {{Chembox Structure
| CrystalStruct =
| Coordination =
| MolShape = }}
| Section4 = {{Chembox Thermochemistry
| DeltaHf =
| DeltaHc =
| Entropy =
| HeatCapacity = }}
| Section5 = {{Chembox Pharmacology
| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| PregCat =
| PregCat_AU =
| PregCat_US = }}
| Section6 = {{Chembox Explosive
| ShockSens =
| FrictionSens =
| ExplosiveV =
| REFactor = }}
| Section7 = {{Chembox Hazards | Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUIndex = not listed
| EUClass =
| FlashPt =
| EUIndex =
| Autoignition =
| MainHazards =
}}
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-O =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt =
| Autoignition =
| ExploLimits =
| LD50 =
| PEL = }}
| Section8 = {{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunctn =
| Function =
| OtherCpds = }}
}} }}

Revision as of 11:08, 6 December 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 464369875 of page Ethylene-vinyl_acetate with values updated to verified values.
Ethylene-vinyl acetate
Names
IUPAC name but-3-enoic acid; ethene
Identifiers
CAS Number
3D model (JSmol)
ChemSpider
PubChem CID
UNII
InChI
  • InChI=1S/C4H6O2.C2H4/c1-3-6-4(2)5;1-2/h3H,1H2,2H3;1-2H2Key: HDERJYVLTPVNRI-UHFFFAOYSA-N
  • InChI=1/C4H6O2.C2H4/c1-3-6-4(2)5;1-2/h3H,1H2,2H3;1-2H2
SMILES
  • O=C(O\C=C)C.C=C
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkverify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic