| Revision as of 11:48, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464361361 of page Propane for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 11:49, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 464219441 of page Proscillaridin for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Drugbox |
|
| Watchedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 417653778 |
|
| verifiedrevid = 447609232 |
|
|
| IUPAC_name = 5-phenanthren- 17-yl]- 2''H''-pyran- 2-one<br />OR<br />3β-Rhamnosido- 14β-hydroxybufa- 4,20,22-trienolide |
|
| ImageFileL1 = Propane-2D-Skeletal.svg |
|
|
|
| image = Proscillaridin.png |
|
| ImageSizeL1 = 125px |
|
|
|
|
|
| ImageNameL1 = skeletal structure of the propane molecule |
|
|
|
<!--Clinical data--> |
|
| ImageFileR1 = Propane-2D-flat.png |
|
|
| ImageSizeR1 = 115px |
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|proscillaridin}} |
|
| ImageNameR1 = displayed structure of the propane molecule |
|
|
|
| pregnancy_category = |
|
| ImageFileL2 = Propane-3D-balls-B.png |
|
|
| ImageSizeL2 = 125px |
|
| legal_status = |
|
|
| routes_of_administration = |
|
| ImageNameR2 = space-filling model of the propane molecule |
|
|
|
|
|
| ImageFileR2 = Propane-3D-vdW-B.png |
|
|
|
<!--Pharmacokinetic data--> |
|
| ImageSizeR2 = 115px |
|
|
|
| bioavailability = |
|
| ImageNameL2 = ball-and-stick model of the propane molecule |
|
|
| PIN = Propane |
|
| metabolism = |
|
|
| excretion = |
|
| OtherNames = ''n''-propane<br />normal propane |
|
|
|
|
|
| Section1 = {{Chembox Identifiers |
|
|
|
<!--Identifiers--> |
|
| Abbreviations = |
|
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = <!-- blanked - oldvalue: 466-06-8 --> |
|
|
| ATC_prefix = C01 |
|
|
| ATC_suffix = AB01 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
⚫ |
| ChEMBL = 600325 |
|
⚫ |
| PubChem = 5284613 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 4447658 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = T75W9911L6 |
|
| UNII = KC6BL281EN |
|
|
|
| ⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
<!--Chemical data--> |
| ⚫ |
| ChEMBL = 135416 |
|
|
⚫ |
| C=30 | H=42 | O=8 |
|
|
| molecular_weight = 530.650 |
|
|
| smiles = O=C\1O\C=C(/C=C/1)2CC6(O)2(C)CC56CC/C4=C/(O3O((O)(O)3O)C)CC45C |
|
|
| InChI = 1/C30H42O8/c1-16-24(32)25(33)26(34)27(37-16)38-19-8-11-28(2)18(14-19)5-6-22-21(28)9-12-29(3)20(10-13-30(22,29)35)17-4-7-23(31)36-15-17/h4,7,14-16,19-22,24-27,32-35H,5-6,8-13H2,1-3H3/t16-,19-,20+,21-,22+,24-,25+,26+,27-,28-,29+,30-/m0/s1 |
|
|
| InChIKey = MYEJFUXQJGHEQK-ALRJYLEOBX |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C30H42O8/c1-16-24(32)25(33)26(34)27(37-16)38-19-8-11-28(2)18(14-19)5-6-22-21(28)9-12-29(3)20(10-13-30(22,29)35)17-4-7-23(31)36-15-17/h4,7,14-16,19-22,24-27,32-35H,5-6,8-13H2,1-3H3/t16-,19-,20+,21-,22+,24-,25+,26+,27-,28-,29+,30-/m0/s1 |
|
| StdInChI = 1S/C3H8/c1-3-2/h3H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ATUOYWHBWRKTHZ-UHFFFAOYSA-N |
|
| StdInChIKey = MYEJFUXQJGHEQK-ALRJYLEOSA-N |
|
| CASNo = 74-98-6 |
|
| ⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID = 6094 |
|
|
| UNNumber = ] |
|
|
| EINECS = |
|
| ⚫ |
| PubChem = 6334 |
|
|
| SMILES = CCC |
|
|
| InChI = 1/C3H8/c1-3-2/h3H2,1-2H3 |
|
|
| RTECS = TX2275000 |
|
|
| MeSHName = |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 32879 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D05625 |
|
|
| ATCCode_prefix = |
|
|
| ATCCode_suffix = |
|
|
| ATC_Supplemental =}} |
|
|
| Section2 = {{Chembox Properties |
|
| ⚫ |
| C = 3|H = 8 |
|
|
| Appearance = Colorless gas |
|
|
| Density = 2.0098 kg/m<sup>3</sup>, gas (0 °C, 1013 mbar)<br />581.2 kg/m<sup>3</sup>, liquid at boiling point<ref name="GESTIS">{{GESTIS|ZVG=10020|Name=Propane}}</ref> |
|
|
| MeltingPt = -187.7 |
|
|
| Melting_notes = <ref name="GESTIS" /><ref name="NIST Phase">, Chemistry WebBook, National Institute of Standards and Technology</ref> |
|
|
| BoilingPt = -42.1 |
|
|
| Boiling_notes = <ref name="GESTIS" /><ref name="NIST Phase" /> |
|
|
| Solubility = 0.04 g/L (0 °C)<ref name="lpg">, European LPG association {{dead link|date=November 2010}}</ref> |
|
|
| SolubleOther = |
|
|
| Solvent = |
|
|
| pKa = |
|
|
| pKb =}} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| EUClass = Extremely flammable ('''F+''') |
|
|
| EUIndex = |
|
|
| MainHazards = |
|
|
| NFPA-H = 1 |
|
|
| NFPA-F = 4 |
|
|
| NFPA-R = 0 |
|
|
| NFPA-O = |
|
|
| RPhrases = {{R12}} |
|
|
| SPhrases = {{S2}}, {{S9}}, {{S16}} |
|
|
| RSPhrases = |
|
|
| FlashPt = -104 °C, 169 K |
|
|
| Autoignition = 540 °C, 813 K |
|
|
| ExploLimits = 2.37–9.5% |
|
|
| PEL =}} |
|
|
| Section8 = {{Chembox Related |
|
|
| Function = ] |
|
|
| OtherFunctn = ]<br />]}} |
|
|
}} |
|
}} |
