Revision as of 11:59, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 461289690 of page Purine for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 11:59, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444073148 of page Puromycin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 4A6ZS6Q2CL |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 417833941 |
|
| verifiedrevid = 401036208 |
|
|
|ImageFile=puromycin skeletal.svg |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
⚫ |
|ImageSize= |
|
| ImageFile=Purine chemical structure.png |
|
|
|
|IUPACName=3'-deoxy-''N,N''-dimethyl-3'-adenosine |
⚫ |
|ImageSize= 345px |
|
|
|IUPACName=7''H''-purine |
|
|
|OtherNames= |
|
|OtherNames= |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| KEGG = C15587 |
|
| ChemSpiderID = 388623 |
|
|
| InChI = 1/C22H29N7O5/c1-28(2)19-17-20(25-10-24-19)29(11-26-17)22-18(31)16(15(9-30)34-22)27-21(32)14(23)8-12-4-6-13(33-3)7-5-12/h4-7,10-11,14-16,18,22,30-31H,8-9,23H2,1-3H3,(H,27,32)/t14-,15+,16+,18+,22+/m0/s1 |
|
| InChI = 1/C5H4N4/c1-4-5(8-2-6-1)9-3-7-4/h1-3H,(H,6,7,8,9) |
|
|
| InChIKey = KDCGOANMDULRCW-UHFFFAOYAO |
|
| InChIKey = RXWNCPJZOCPEPQ-NVWDDTSBBO |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 302239 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C22H29N7O5/c1-28(2)19-17-20(25-10-24-19)29(11-26-17)22-18(31)16(15(9-30)34-22)27-21(32)14(23)8-12-4-6-13(33-3)7-5-12/h4-7,10-11,14-16,18,22,30-31H,8-9,23H2,1-3H3,(H,27,32)/t14-,15+,16+,18+,22+/m0/s1 |
|
| StdInChI = 1S/C5H4N4/c1-4-5(8-2-6-1)9-3-7-4/h1-3H,(H,6,7,8,9) |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KDCGOANMDULRCW-UHFFFAOYSA-N |
|
| StdInChIKey = RXWNCPJZOCPEPQ-NVWDDTSBSA-N |
|
|
| CASNo = <!-- blanked - oldvalue: 53-79-2 --> |
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
⚫ |
| PubChem = 439530 |
|
| CASNo=120-73-0 |
|
|
|
| ChEMBL = <!-- blanked - oldvalue: 13840 --> |
⚫ |
| PubChem=1044 |
|
|
⚫ |
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 1015 |
|
| KEGG = D05653 |
|
|
| DrugBank = DB08437 |
⚫ |
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 17258 |
|
| ChEBI = 17939 |
|
|
| SMILES = O=C(N3(O(n2cnc1c2ncnc1N(C)C)3O)CO)(N)Cc4ccc(OC)cc4 |
|
| SMILES = c1c2c(nc2)ncn1 |
|
|
| MeSHName=Purine |
|
| MeSHName=Puromycin |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=5|H=4|N=4 |
|
|C=22|H=29|N=7|O=5 |
|
|
| MolarMass=471.50956 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPtC=214 |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |