Revision as of 12:09, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 401037787 of page Pyrinuron for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 12:09, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 452823880 of page Pyriproxyfen for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 401036801 |
|
| verifiedrevid = 444077286 |
|
|
| Name = Pyriproxyfen |
|
|ImageFile=Pyrinuron.png |
|
|
|
| ImageFile = Pyriproxyfen.svg |
|
|ImageSize= |
|
|
|
<!-- | ImageSize = 360px --> |
|
|IUPACName= 3-(4-nitrophenyl)- 1-(pyridin- 3-ylmethyl) urea |
|
|
|
| ImageName = Chemical structure of pyriproxyfen |
|
|OtherNames=Pyriminil<BR>Vacor |
|
|
|
| IUPACName = 4-phenoxyphenyl (RS)-2-(2-pyridyloxy)propyl ether<br /> 2-pyridine |
|
|Section1={{Chembox Identifiers |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| Section1 = {{Chembox Identifiers |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 37276 |
|
| ChemSpiderID = 82851 |
|
⚫ |
| PubChem = 91753 |
|
| InChI = 1/C13H12N4O3/c18-13(15-9-10-2-1-7-14-8-10)16-11-3-5-12(6-4-11)17(19)20/h1-8H,9H2,(H2,15,16,18) |
|
|
|
| InChI = 1/C20H19NO3/c1-16(23-20-9-5-6-14-21-20)15-22-17-10-12-19(13-11-17)24-18-7-3-2-4-8-18/h2-14,16H,15H2,1H3 |
|
| InChIKey = CLKZWXHKFXZIMA-UHFFFAOYAA |
|
|
|
| InChIKey = NHDHVHZZCFYRSB-UHFFFAOYAG |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 39260 |
|
|
| SMILES = O(c1ncccc1)C(COc3ccc(Oc2ccccc2)cc3)C |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C13H12N4O3/c18-13(15-9-10-2-1-7-14-8-10)16-11-3-5-12(6-4-11)17(19)20/h1-8H,9H2,(H2,15,16,18) |
|
| StdInChI = 1S/C20H19NO3/c1-16(23-20-9-5-6-14-21-20)15-22-17-10-12-19(13-11-17)24-18-7-3-2-4-8-18/h2-14,16H,15H2,1H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = CLKZWXHKFXZIMA-UHFFFAOYSA-N |
|
| StdInChIKey = NHDHVHZZCFYRSB-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 53558-25-1 --> |
|
|
|
| CASNo = 95737-68-1 |
⚫ |
| PubChem=40813 |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| SMILES = (=O)c1ccc(cc1)NC(=O)NCc2cccnc2 |
|
|
|
| KEGG = C18605 |
|
}} |
|
|
|Section2={{Chembox Properties |
|
⚫ |
| Formula=C<sub>13</sub>H<sub>12</sub>N<sub>4</sub>O<sub>3</sub> |
|
⚫ |
| MolarMass=272.259 |
|
|
| Appearance= |
|
⚫ |
| Density= |
|
⚫ |
| MeltingPt= |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
| Section2 = {{Chembox Properties |
|
⚫ |
| Formula = C<sub>20</sub>H<sub>19</sub>NO<sub>3</sub> |
|
| MainHazards=Toxic |
|
|
⚫ |
| MolarMass = 321.369 g/mol |
|
| FlashPt= |
|
|
⚫ |
| MeltingPt = 46 °C |
|
| Autoignition= |
|
|
⚫ |
| Density = 1.2 g/cm³ |
|
}} |
|
}} |
|
}} |
|
}} |