Revision as of 12:58, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{drugbox}} taken from revid 456766573 of page Riluzole for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 12:58, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{drugbox}} taken from revid 454185518 of page Rimantadine for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 415609029 |
|
| Verifiedfields = changed |
|
|
|
| IUPAC_name = (''RS'')-1-(1-adamantyl)ethanamine |
⚫ |
| verifiedrevid = 416973589 |
|
|
|
| image = Rimantadine.svg |
|
| IUPAC_name = 6-(trifluoromethoxy)benzothiazol-2-amine |
|
|
| image = Riluzole.svg |
|
| width = 150 |
|
|
| image2 = Rimantadine-3D-balls.png |
|
|
| width2 = 150 |
|
|
| imagename = 1 : 1 mixture (racemate) |
|
|
| drug_name = Rimantadine |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Rilutek |
|
| tradename = Flumadine |
|
| Drugs.com = {{drugs.com|monograph|riluzole}} |
|
| Drugs.com = {{drugs.com|monograph|rimantadine-hydrochloride}} |
|
| MedlinePlus = a696013 |
|
| MedlinePlus = a698029 |
|
| pregnancy_category = |
|
| pregnancy_category = C <small>(United States)</small> |
|
| legal_status = |
|
| legal_status = ℞-only <small>(U.S.)</small> |
|
| routes_of_administration = |
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = well absorbed |
|
| protein_bound = |
|
| protein_bound = 40% |
|
| metabolism = |
|
| metabolism = ] ] and ] |
|
| elimination_half-life = |
|
| elimination_half-life = 25.4 ± 6.3 hours |
|
|
| excretion = ] |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number = 13392-28-4 |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 1744-22-5 |
|
| ATC_prefix = J05 |
|
| ATC_prefix = N07 |
|
| ATC_suffix = AC02 |
|
| ATC_suffix = XX02 |
|
| PubChem = 5071 |
|
| ATC_supplemental = |
|
|
| PubChem = 5070 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB00740 |
|
| DrugBank = DB00478 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4892 |
|
| ChemSpiderID = 4893 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 7LJ087RS6F |
|
| UNII = 0T2EF4JQTU |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D00775 |
|
| KEGG = D08483 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 744 |
|
| ChEMBL = 959 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=8 | H=5 | F=3 | N=2 | O=1 | S=1 |
|
| C=12 | H=21 | N=1 |
|
| molecular_weight = 234.199 g/mol |
|
| molecular_weight = 179.302 ]/] |
|
| smiles = FC(F)(F)Oc1ccc2nc(sc2c1)N |
|
| smiles = NC(C)C13CC2CC(CC(C1)C2)C3 |
|
| InChI = 1/C8H5F3N2OS/c9-8(10,11)14-4-1-2-5-6(3-4)15-7(12)13-5/h1-3H,(H2,12,13) |
|
| InChI = 1/C12H21N/c1-8(13)12-5-9-2-10(6-12)4-11(3-9)7-12/h8-11H,2-7,13H2,1H3 |
|
| InChIKey = FTALBRSUTCGOEG-UHFFFAOYAB |
|
| InChIKey = UBCHPRBFMUDMNC-UHFFFAOYAV |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C8H5F3N2OS/c9-8(10,11)14-4-1-2-5-6(3-4)15-7(12)13-5/h1-3H,(H2,12,13) |
|
| StdInChI = 1S/C12H21N/c1-8(13)12-5-9-2-10(6-12)4-11(3-9)7-12/h8-11H,2-7,13H2,1H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = FTALBRSUTCGOEG-UHFFFAOYSA-N |
|
| StdInChIKey = UBCHPRBFMUDMNC-UHFFFAOYSA-N |
|
}} |
|
}} |