Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:58, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{drugbox}} taken from revid 454185518 of page Rimantadine for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit Revision as of 12:59, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{drugbox}} taken from revid 456889676 of page Rimexolone for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed
| verifiedrevid = 415609029 | verifiedrevid = 402589492
| IUPAC_name = (''RS'')-1-(1-adamantyl)ethanamine
| IUPAC_name = (8''S'',9''S'',10''R'',11''S'',13''S'',14''S'',16''R'',17''S'')-11-Hydroxy-10,13,16,17-tetramethyl-17-propanoyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopentaphenanthren-3-one
| image = Rimantadine.svg
| image = Rimexolone structure.png
| width = 150
| image2 = Rimantadine-3D-balls.png
| width2 = 150
| imagename = 1 : 1 mixture (racemate)
| drug_name = Rimantadine


<!--Clinical data--> <!--Clinical data-->
| tradename = Flumadine | tradename =
| Drugs.com = {{drugs.com|monograph|rimantadine-hydrochloride}} | Drugs.com = {{drugs.com|monograph|rimexolone}}
| MedlinePlus = a698029 | MedlinePlus = a606003
| pregnancy_US = C <!-- A / B / C / D / X -->
| pregnancy_category = C <small>(United States)</small> | pregnancy_category =
| legal_status = ℞-only <small>(U.S.)</small>
| legal_status =
| routes_of_administration = Oral | routes_of_administration = occular


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = well absorbed | bioavailability =
| protein_bound = 40% | protein_bound =
| metabolism = ] ] and ] | metabolism =
| elimination_half-life = 25.4 ± 6.3 hours | elimination_half-life =
| excretion = ]


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 13392-28-4 | CAS_number = 49697-38-3
| ATC_prefix = J05
| ATC_suffix = AC02 | ATC_prefix = H02
| PubChem = 5071 | ATC_suffix = AB12
| ATC_supplemental = {{ATC|S01|BA13}}
| PubChem = 16051942
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00478 | DrugBank = DB00896
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4893 | ChemSpiderID = 10482044
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0T2EF4JQTU | UNII = O7M2E4264D
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D08483 | KEGG = D05729
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 959 | ChEMBL = <!-- blanked - oldvalue: 1200617 -->
⚫ | C=24 | H=34 | O=3

⚫ | molecular_weight = 370.525 g/mol
<!--Chemical data-->
| smiles = COC(=O)2(C)(C)C34CC\C1=C\C(=O)\C=C/1(C)4(O)C23C
⚫ | C=12 | H=21 | N=1
| InChI = 1/C23H32O4/c1-13-10-17-16-7-6-14-11-15(24)8-9-21(14,2)19(16)18(25)12-22(17,3)23(13,4)20(26)27-5/h8-9,11,13,16-19,25H,6-7,10,12H2,1-5H3/t13-,16+,17+,18+,19-,21+,22+,23-/m1/s1
⚫ | molecular_weight = 179.302 ]/]
| InChIKey = HJPMTDNGLRNDJA-ZVXCBTRXBW
| smiles = NC(C)C13CC2CC(CC(C1)C2)C3
| InChI = 1/C12H21N/c1-8(13)12-5-9-2-10(6-12)4-11(3-9)7-12/h8-11H,2-7,13H2,1H3
| InChIKey = UBCHPRBFMUDMNC-UHFFFAOYAV
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H21N/c1-8(13)12-5-9-2-10(6-12)4-11(3-9)7-12/h8-11H,2-7,13H2,1H3 | StdInChI = 1S/C23H32O4/c1-13-10-17-16-7-6-14-11-15(24)8-9-21(14,2)19(16)18(25)12-22(17,3)23(13,4)20(26)27-5/h8-9,11,13,16-19,25H,6-7,10,12H2,1-5H3/t13-,16+,17+,18+,19-,21+,22+,23-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UBCHPRBFMUDMNC-UHFFFAOYSA-N | StdInChIKey = HJPMTDNGLRNDJA-ZVXCBTRXSA-N
}} }}

Revision as of 12:59, 6 December 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456889676 of page Rimexolone with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
AHFS/Drugs.comMonograph
MedlinePlusa606003
Routes of
administration		occular
ATC code
Identifiers
IUPAC name
  • (8S,9S,10R,11S,13S,14S,16R,17S)-11-Hydroxy-10,13,16,17-tetramethyl-17-propanoyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopentaphenanthren-3-one
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
Chemical and physical data
FormulaC24H34O3
Molar mass370.525 g/mol g·mol
3D model (JSmol)
SMILES
  • COC(=O)2(C)(C)C34CC\C1=C\C(=O)\C=C/1(C)4(O)C23C
InChI
  • InChI=1S/C23H32O4/c1-13-10-17-16-7-6-14-11-15(24)8-9-21(14,2)19(16)18(25)12-22(17,3)23(13,4)20(26)27-5/h8-9,11,13,16-19,25H,6-7,10,12H2,1-5H3/t13-,16+,17+,18+,19-,21+,22+,23-/m1/s1
  • Key:HJPMTDNGLRNDJA-ZVXCBTRXSA-N
  (what is this?)  (verify)