| Revision as of 14:22, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 447513684 of page Sinapinic_acid for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 14:23, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 460514169 of page Siplizumab for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
| Watchedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 444105125 |
|
| verifiedrevid = 447733790 |
|
|
|
|
| Name = Sinapinic acid |
|
|
|
<!--Monoclonal antibody data--> |
|
| ImageFile = sinapic acid.png |
|
|
|
| type = mab |
|
<!-- | ImageSize = 200px --> |
|
|
|
| mab_type = mab |
|
| ImageName = Sinapinic acid |
|
|
|
| source = zu/a |
|
| IUPACName = 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid |
|
|
|
| target = ] |
|
| OtherNames = Sinapinic acid<br />Sinapic acid<br />3,5-Dimethoxy-4-hydroxycinnamic acid<br />4-Hydroxy-3,5-dimethoxycinnamic acid |
|
|
|
|
|
| Section1 = {{Chembox Identifiers |
|
|
|
<!--Clinical data--> |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 553361 |
|
| tradename = |
|
|
| pregnancy_AU = |
|
| InChI = 1/C11H12O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h3-6,14H,1-2H3,(H,12,13)/b4-3+ |
|
|
|
| pregnancy_US = |
|
| InChIKey = PCMORTLOPMLEFB-ONEGZZNKBS |
|
|
|
| pregnancy_category = |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| legal_AU = |
|
| StdInChI = 1S/C11H12O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h3-6,14H,1-2H3,(H,12,13)/b4-3+ |
|
|
|
| legal_CA = |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| legal_UK = |
|
| StdInChIKey = PCMORTLOPMLEFB-ONEGZZNKSA-N |
|
|
|
| legal_US = |
| ⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
| legal_status = |
|
| CASNo = 530-59-6 |
|
|
|
| routes_of_administration = |
| ⚫ |
| PubChem = 637775 |
|
|
|
|
| ⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
<!--Pharmacokinetic data--> |
|
| ChEMBL = 109341 |
|
|
|
| bioavailability = |
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
|
| protein_bound = |
| ⚫ |
| DrugBank = DB08587 |
|
|
|
| metabolism = |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
|
| elimination_half-life = |
|
| ChEBI = 15714 |
|
|
|
| excretion = |
|
| SMILES = COc1cc(cc(c1O)OC)/C=C/C(=O)O |
|
|
|
|
|
}} |
|
|
|
<!--Identifiers--> |
|
| Section2 = {{Chembox Properties |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| Formula = C<sub>11</sub>H<sub>12</sub>O<sub>5</sub> |
|
|
|
| ChemSpiderID = NA |
|
| MolarMass = 224.21 g/mol |
|
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
| ExactMass = 224.068473 u |
|
|
|
| CAS_number = <!-- blanked - oldvalue: 288392-69-8 --> |
|
| MeltingPt = 203-205 °C (decomposes) |
|
|
|
| ATC_prefix = none |
|
}} |
|
|
|
| ATC_suffix = |
|
⚫ |
| PubChem = |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D05847 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| chemical_formula = |
|
|
| molecular_weight = |
|
}} |
|
}} |
