| Revision as of 14:25, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,141 edits Saving copy of the {{drugbox}} taken from revid 457293128 of page Sivelestat for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 14:25, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,141 edits Saving copy of the {{chembox}} taken from revid 460513935 of page Sizofiran for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 457292162 |
|
| verifiedrevid = 424657948 |
|
|
|ImageFile=sizofiran.png |
|
| IUPAC_name = ''N''-{2-phenyl}sulfonyl)amino]benzoyl}glycine |
|
|
|
|ImageSize=200px |
|
| image = Sivelestat.png |
|
|
|
|IUPACName= |
| ⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
|OtherNames=Schizophyllan |
|
| ChEMBL = 76688 |
|
|
|
|Section1={{Chembox Identifiers |
|
|
|
|
⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
<!--Clinical data--> |
|
|
⚫ |
| CASNo = <!-- blanked - oldvalue: 9050-67-3 --> |
|
| tradename = |
|
|
⚫ |
| PubChem=7848598 |
|
| Drugs.com = {{drugs.com|international|sivelestat}} |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = Rx-only |
|
|
| routes_of_administration = ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| ⚫ |
| CAS_number = <!-- blanked - oldvalue: 127373-66-4 --> |
|
|
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
|
| ATC_supplemental = |
|
| ⚫ |
| PubChem = 107706 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = DWI62G0P59 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D03788 |
|
| KEGG = D01535 |
|
|
| SMILES= |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| ChemSpiderID = 96875 |
|
| ChemSpiderID = NA |
|
|
|
|
|
}} |
|
<!--Chemical data--> |
|
|
|
|Section2={{Chembox Properties |
|
| chemical_formula = |
|
|
|
| Formula=(C<sub>6</sub>H<sub>10</sub>O<sub>5</sub>)<small>n</small> |
|
| C=20 | H=22 | N=2 | O=7 | S=1 |
|
|
|
| MolarMass=variable |
|
| molecular_weight = 434.46 g/mol |
|
|
|
| Appearance= |
|
| smiles = CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)NCC(=O)O |
|
|
|
| Density= |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| MeltingPt= |
|
| StdInChI = 1S/C20H22N2O7S/c1-20(2,3)19(26)29-13-8-10-14(11-9-13)30(27,28)22-16-7-5-4-6-15(16)18(25)21-12-17(23)24/h4-11,22H,12H2,1-3H3,(H,21,25)(H,23,24) |
|
|
|
| BoilingPt= |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| Solubility= |
|
| StdInChIKey = BTGNGJJLZOIYID-UHFFFAOYSA-N |
|
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
N verify (what is ?)
Infobox references