Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 15:57, 6 December 2011 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 460190558 of page Sodium_silicate for the Chem/Drugbox validation project (updated: '').← Previous edit		Revision as of 15:57, 6 December 2011 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 458851724 of page Sodium_sorbate for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~Chembox~~		{{chembox
	\| verifiedrevid = ~~447571464~~		\| verifiedrevid = 426369164
			\| Name = Sodium sorbate
	\| ImageFileL1 = Sodium-metasilicate-repeating-unit-2D.png
			\| ImageFile = Na-sorbat.svg
	\| ImageFileL1_Ref = {{chemboximage\|correct\|??}}
			\| ImageFileL1 = Sorbate-3D-balls.png
	\| ImageSizeL1 = ~~121~~		\| ImageSizeL1 = 180px
	\| ImageNameL1 = Structural formula of polymeric sodium silicate
			\| ImageNameL1 = Ball-and-stick model of the sorbate anion
	\| ImageFileR1 = Sodium~~-metasilicate-chain-from-xtal~~-3D~~-balls~~.png		\| ImageFileR1 = Sodium-3D.png
	\| ImageFileR1_Ref = {{chemboximage\|correct\|??}}
	\| ImageSizeR1 = ~~121~~		\| ImageSizeR1 = 60px
	\| ImageNameR1 = ~~Ball and stick model of polymeric~~ sodium ~~silicate~~		\| ImageNameR1 = The sodium cation
			\| IUPACName = sodium (2''E'',4''E'')-hexa-2,4-dienoate
	\| ImageFile2 = Křemičitan sodný.PNG
	\| ImageFile2_Ref = {{chemboximage\|correct\|??}}
	\| ImageSize2 = 244
	\| ImageName2 = Sample of sodium silicate in a vial
	\| IUPACName = Sodium metasilicate
	\| OtherNames = Liquid glass<br />
	Waterglass
	\| Section1 = {{Chembox Identifiers		\| Section1 = {{Chembox Identifiers
	\| Abbreviations = E550
	\| CASNo = 6834-92-0
	\| CASNo_Ref = {{cascite\|correct\|CAS}}
	\| PubChem = 23266
	\| PubChem_Ref = {{Pubchemcite\|correct\|pubchem}}
⚫	\| ChemSpiderID = ~~21758~~
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}		\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
		⚫	\| ChemSpiderID = 4938659
	\| EINECS = 229-912-9
	\| ~~UNNumber~~ = ~~3253~~		\| PubChem = 6433514
			\| InChI = 1/C6H8O2.Na/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H,7,8);/q;+1/p-1/b3-2+,5-4+;
	\| MeSHName = Sodium+metasilicate
			\| InChIKey = LROWVYNUWKVTCU-ZCSOUONQBK
	\| RTECS = VV9275000
	\| ~~ChEBI_Ref~~ = {{~~ebicite~~\|correct\|~~EBI~~}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
			\| StdInChI = 1S/C6H8O2.Na/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H,7,8);/q;+1/p-1/b3-2+,5-4+;
	\| ChEBI = 60720
		⚫	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
⚫	\| SMILES = ..()=O
		⚫	\| StdInChIKey = LROWVYNUWKVTCU-STWYSWDKSA-M
	\| StdInChI=1S/2Na.O3Si/c;;1-4(2)3/q2*+1;-2
	\| ~~StdInChI_Ref~~ = {{~~stdinchicite~~\|correct\|~~chemspider~~}}		\| CASNo_Ref = {{cascite\|correct\|??}}
			\| CASNo = <!-- blanked - oldvalue: 7757-81-5 -->
	\| InChI = 1/2Na.O3Si/c;;1-4(2)3/q2*+1;-2
		⚫	\| SMILES = .C(=O)\C=C\C=C\C
⚫	\| StdInChIKey = ~~NTHWMYGWWRZVTN~~-~~UHFFFAOYSA~~-N
⚫	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| InChIKey = NTHWMYGWWRZVTN-UHFFFAOYAB
	}}		}}
	\| Section2 = {{Chembox Properties		\| Section2 = {{Chembox Properties
			\| Formula = C<sub>6</sub>H<sub>7</sub>NaO<sub>2</sub>
	\| Na = 2
		⚫	\| MolarMass = 134.10835 g·mol<sup>−1</sup>
	\| O = 3
	\| Si = 1		\| MeltingPt =
			\| BoilingPt = 233 °C<ref name="chemspider"></ref>
⚫	\| ~~ExactMass~~ = ~~121~~.~~941209749~~ g mol<sup>-1</sup>
		⚫	}}
	\| Appearance = White, opaque crystals
	\| Density = 2.4 g cm<sup>-3</sup>
	\| MeltingPtC = 1088
	\| RefractIndex = 1.52
⚫	}}
	\| Section3 = {{Chembox Thermochemistry
	\| DeltaHf = −1561.43 kJ mol<sup>-1</sup>
	\| Entropy = 113.71 J K<sup>−1</sup> mol<sup>−1</sup>
	}}
	\| Section4 = {{Chembox Hazards
	\| ExternalMSDS =
	\| EUIndex = 014-010-00-8
	\| EUClass = {{Hazchem C}}
	\| NFPA-H = 2
	\| NFPA-F = 0
	\| NFPA-R = 0
	\| RPhrases = {{R34}}, {{R37}}
	\| SPhrases = {{S1/2}}, {{S13}}, {{S24/25}}, {{S36/37/39}}, {{S45}}
	}}
	\| Section8 = {{Chembox Related
	\| OtherAnions = ]
	\| OtherCations = ]
	}}
	}}		}}

Revision as of 15:57, 6 December 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 458851724 of page Sodium_sorbate with values updated to verified values.

Sodium sorbate

Ball-and-stick model of the sorbate anion

The sodium cation

Names

IUPAC name sodium (2E,4E)-hexa-2,4-dienoate

Identifiers

3D model (JSmol)

Interactive image

ChemSpider

4938659

PubChem CID

6433514

InChI

InChI=1S/C6H8O2.Na/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H,7,8);/q;+1/p-1/b3-2+,5-4+;Key: LROWVYNUWKVTCU-STWYSWDKSA-M
InChI=1/C6H8O2.Na/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H,7,8);/q;+1/p-1/b3-2+,5-4+;Key: LROWVYNUWKVTCU-ZCSOUONQBK

SMILES

.C(=O)\C=C\C=C\C

Properties

Chemical formula

C₆H₇NaO₂

Molar mass

134.10835 g·mol

Boiling point

233 °C

Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa).

Y verify (what is ?) Infobox references

Tracking categories (test):

PairSizeSet

Chemical compound

Datenbankeintrag bei Chemspider