Revision as of 17:55, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464461804 of page Staphyloxanthin for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 17:55, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 470396994 of page Staurosporine for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 449645463 |
|
| verifiedrevid = 402675446 |
|
| Name = Staphyloxanthin |
|
|
|
| IUPAC_name = (''9S,10R,11R,13R'')-2,3,10,11,12,13-Hexahydro-<br>10-methoxy-9-methyl-11-(methylamino)-9,13-epoxy-<br>1''H'',9''H''-diindolopyrrolo<br>benzodiazonin-1-one |
|
| ImageFile = Staphyloxanthin.svg |
|
|
|
| image = Staurosporine.svg |
|
| ImageSize = 350px |
|
|
|
| width = 150px |
|
| ImageName = Chemical structure of staphyloxanthin |
|
|
|
|
|
| ImageAlt = Chemical structure of staphyloxanthin |
|
|
|
<!--Clinical data--> |
|
| IUPACName = <nowiki> [(2S,3R,4S,5S,6R)-3,4, |
|
|
|
| tradename = |
|
5-trihydroxy-6-oxymethyl]oxan-2-yl](2E,4E,6E,8E,10E,12E,14E,16E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaenoate</nowiki> |
|
|
| OtherNames = <!-- <br> --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|Section1= {{Chembox Identifiers |
|
|
|
| pregnancy_category = |
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 62996-74-1 |
|
|
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
⚫ |
| PubChem = 44259 |
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = DB02010 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4947803 |
|
| ChemSpiderID = 40272 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| InChI1 = 1/C51H78O8/c1-10-39(4)25-16-14-12-11-13-15-17-33-44(36-52)51(9,35-23-32-43(8)49(57)59-50-48(56)47(55)46(54)45(37-53)58-50)34-19-18-26-40(5)28-21-30-42(7)31-22-29-41(6)27-20-24-38(2)3/h17-19,21-24,26,28-33,35-36,39,44-48,50,53-56H,10-16,20,25,27,34,37H2,1-9H3/b19-18+,28-21+,31-22+,33-17-,35-23+,40-26+,41-29+,42-30+,43-32+/t39?,44?,45-,46-,47+,48-,50-,51?/m1/s1 |
|
|
|
| ChEBI = 15738 |
|
| InChIKey1 = ZGBLADNGFNFPBV-OQMOJWPEBF |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
⚫ |
| ChEMBL = <!-- blanked - oldvalue: 162 --> |
|
|
| C=28 | H=26 | N=4 | O=3 |
|
|
| molecular_weight = 466.53 g/mol |
|
|
| smiles = C12((C(O1)n3c4ccccc4c5c3c6n2c7ccccc7c6c8c5C(=O)NC8)NC)OC |
|
|
| InChI = 1/C28H26N4O3/c1-28-26(34-3)17(29-2)12-20(35-28)31-18-10-6-4-8-14(18)22-23-16(13-30-27(23)33)21-15-9-5-7-11-19(15)32(28)25(21)24(22)31/h4-11,17,20,26,29H,12-13H2,1-3H3,(H,30,33)/t17-,20-,26-,28+/m1/s1 |
|
|
| InChIKey = HKSZLNNOFSGOKW-FYTWVXJKBZ |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C51H78O8/c1-10-39(4)25-16-14-12-11-13-15-17-33-44(36-52)51(9,35-23-32-43(8)49(57)59-50-48(56)47(55)46(54)45(37-53)58-50)34-19-18-26-40(5)28-21-30-42(7)31-22-29-41(6)27-20-24-38(2)3/h17-19,21-24,26,28-33,35-36,39,44-48,50,53-56H,10-16,20,25,27,34,37H2,1-9H3/b19-18+,28-21+,31-22+,33-17-,35-23+,40-26+,41-29+,42-30+,43-32+/t39?,44?,45-,46-,47+,48-,50-,51?/m1/s1 |
|
| StdInChI = 1S/C28H26N4O3/c1-28-26(34-3)17(29-2)12-20(35-28)31-18-10-6-4-8-14(18)22-23-16(13-30-27(23)33)21-15-9-5-7-11-19(15)32(28)25(21)24(22)31/h4-11,17,20,26,29H,12-13H2,1-3H3,(H,30,33)/t17-,20-,26-,28+/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ZGBLADNGFNFPBV-OQMOJWPESA-N |
|
| StdInChIKey = HKSZLNNOFSGOKW-FYTWVXJKSA-N |
⚫ |
| CASNo = <!-- blanked - oldvalue: 71869-01-7 --> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|??}}= |
|
|
| CASOther = |
|
⚫ |
| PubChem = 24892781 |
|
|
| SMILES = O=C(O1O((O)(O)1O)CO)\C(=C\C=C\C(C)(C\C=C\C=C(\C=C\C=C(\C=C\C=C(/C)CC\C=C(/C)C)C)C)C(\C=C/CCCCCCCC(C)CC)C=O)C |
|
|
| InChI = |
|
|
| MeSHName = |
|
|
}} |
|
|
|Section2= {{Chembox Properties |
|
|
| Formula = C<sub>51</sub>H<sub>78</sub>O<sub>8</sub> |
|
|
| MolarMass = 819.16 g/mol |
|
|
| ExactMass = 818.569669 u |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = <!-- °C --> |
|
|
| BoilingPt = <!-- °C --> |
|
|
| Solubility = |
|
|
}} |
|
|
}} |
|
}} |