Revision as of 18:12, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456759095 of page Sulfamerazine for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 18:12, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456857102 of page Sulfamethizole for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 409963679 |
|
| Watchedfields = changed |
|
|
⚫ |
| IUPAC_name = 4-amino-''N''-(5-methyl-1,3,4-thiadiazol-2-yl)- benzenesulfonamide |
⚫ |
| verifiedrevid = 409963594 |
|
|
|
| image = Sulfamethizole.svg |
⚫ |
| IUPAC_name = 4-amino-''N''-(4-methylpyrimidin-2-yl)<br>benzenesulfonamide |
|
|
|
| width = 250 |
|
| image = Sulfamerazine_Structural_Formulae_V.1.svg |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|sulfamerazine}} |
|
| Drugs.com = {{drugs.com|CONS|sulfamethizole}} |
|
|
| MedlinePlus = a682231 |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
Line 22: |
Line 22: |
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = 98–99% |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = 3–8 hours |
|
| excretion = |
|
| excretion = |
|
|
|
|
Line 30: |
Line 30: |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 127-79-7 |
|
| CAS_number = 144-82-1 |
|
| ATC_prefix = J01 |
|
| ATC_prefix = B05 |
|
| ATC_suffix = ED07 |
|
| ATC_suffix = CA04 |
|
|
| ATC_supplemental = {{ATC|D06|BA04}} {{ATC|J01|EB02}} {{ATC|S01|AB01}} {{ATCvet|J01|EQ02}} |
|
| PubChem = 5325 |
|
| PubChem = 5328 |
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01581 |
|
| DrugBank = DB00576 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 5134 |
|
| ChemSpiderID = 5137 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = UR1SAB295F |
|
| UNII = 25W8454H16 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D02435 |
|
| KEGG = D00870 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI = 102130 |
|
| ChEBI = 9331 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 438 |
|
| ChEMBL = 1191 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=11 | H=12 | N=4 | O=2 | S=1 |
|
| C=9 | H=10 | N=4 | O=2 | S=2 |
|
| molecular_weight = 264.305 g/mol |
|
| molecular_weight = 270.333 g/mol |
|
| smiles = O=S(=O)(Nc1nc(ccn1)C)c2ccc(N)cc2 |
|
| smiles = O=S(=O)(Nc1nnc(s1)C)c2ccc(N)cc2 |
|
| InChI = 1/C11H12N4O2S/c1-8-6-7-13-11(14-8)15-18(16,17)10-4-2-9(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15) |
|
| InChI = 1/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13) |
|
| InChIKey = QPPBRPIAZZHUNT-UHFFFAOYAN |
|
| InChIKey = VACCAVUAMIDAGB-UHFFFAOYAZ |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C11H12N4O2S/c1-8-6-7-13-11(14-8)15-18(16,17)10-4-2-9(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15) |
|
| StdInChI = 1S/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = QPPBRPIAZZHUNT-UHFFFAOYSA-N |
|
| StdInChIKey = VACCAVUAMIDAGB-UHFFFAOYSA-N |
|
}} |
|
}} |