Revision as of 18:32, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 407889498 of page TAN-1057_C for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 18:32, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 401617134 of page TASF_reagent for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{chembox |
|
| verifiedrevid = 401615853 |
|
| verifiedrevid = 401615926 |
|
|
| ImageFile = TASF.png |
|
| Name=TAN-1057 C <small>(top)</small> and TAN-1057 D <small>(bottom)</small> |
|
|
⚫ |
| ImageSize = 200px |
|
| ImageFile1 = TAN-1057C.png |
|
|
|
| IUPACName = Tris(dimethylamino)sulfonium difluorotrimethylsilicate |
⚫ |
| ImageSize1 = 200px |
|
|
| ImageFile2 = TAN-1057D.png |
|
|
| ImageSize2 = 200px |
|
|
| IUPACName = |
|
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 7851330 |
|
| ChemSpiderID = 7971333 |
|
|
| InChI = 1/C6H18N3S.C3H9F2Si/c1-7(2)10(8(3)4)9(5)6;1-6(2,3,4)5/h1-6H3;1-3H3/q+1;-1 |
|
| InChI = 1/C13H25N9O3/c1-22-9(6-19-20-7-18-13(16)25)11(24)21-8(5-10(22)23)3-2-4-17-12(14)15/h7-9,19H,2-6H2,1H3,(H,21,24)(H4,14,15,17)(H3,16,18,20,25)/t8-,9+/m0/s1 |
|
|
| InChIKey = PNFFUPQADHHLMN-DTWKUNHWBI |
|
| InChIKey = JMGVTLYEFSBAGJ-UHFFFAOYAE |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C13H25N9O3/c1-22-9(6-19-20-7-18-13(16)25)11(24)21-8(5-10(22)23)3-2-4-17-12(14)15/h7-9,19H,2-6H2,1H3,(H,21,24)(H4,14,15,17)(H3,16,18,20,25)/t8-,9+/m0/s1 |
|
| StdInChI = 1S/C6H18N3S.C3H9F2Si/c1-7(2)10(8(3)4)9(5)6;1-6(2,3,4)5/h1-6H3;1-3H3/q+1;-1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PNFFUPQADHHLMN-DTWKUNHWSA-N |
|
| StdInChIKey = JMGVTLYEFSBAGJ-UHFFFAOYSA-N |
|
| CASNo = <!-- blanked - oldvalue: 128126-46-5 --> |
|
| CASNo = <!-- blanked - oldvalue: 59218-87-0 --> |
|
⚫ |
| PubChem = 9795567 |
|
| CASOther = (TAN-1057 C)<br>128126-47-6 (TAN-1057 D) |
|
|
|
| SMILES = F(F)(C)(C)C.N((N(C)C)N(C)C)(C)C |
⚫ |
| PubChem = 9576889 |
|
|
| SMILES = O=C1N(C)(C(=O)N(C1)CCC/N=C(\N)N)CNN\C=N\C(=O)N |
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| C=13| H=25| N=9| O=3 |
|
| C=9|H=27|F=2|Si=1|S=1|N=3 |
|
| Appearance = |
|
| MolarMass = 275.48 |
|
|
| Appearance = Colorless solid |
|
| Density = |
|
|
| MeltingPt = |
|
| Density = |
|
|
| MeltingPt = 98-101 °C |
|
| BoilingPt = |
|
|
| Solubility = }} |
|
| BoilingPt = |
|
|
| Solubility = |
|
|
}} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |