Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 18:32, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 401617134 of page TASF_reagent for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit Revision as of 18:32, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 444253987 of page TATB for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| Watchedfields = changed
| verifiedrevid = 401615926 | verifiedrevid = 414618644
| ImageFile = TASF.png | ImageFile = Triaminotrinitrobenzene.png
| ImageSize = 200px
| ImageFile1 = TATB-3D-vdW.png
| IUPACName = Tris(dimethylamino)sulfonium difluorotrimethylsilicate
| ImageSize = 150px
| IUPACName = 1,3,5-triamino-2,4,6-trinitrobenzene
| OtherNames = | OtherNames =
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 7971333 | ChemSpiderID = 17272
| InChI = 1/C6H18N3S.C3H9F2Si/c1-7(2)10(8(3)4)9(5)6;1-6(2,3,4)5/h1-6H3;1-3H3/q+1;-1 | InChI = 1/C6H6N6O6/c7-1-4(10(13)14)2(8)6(12(17)18)3(9)5(1)11(15)16/h7-9H2
| InChIKey = JMGVTLYEFSBAGJ-UHFFFAOYAE | InChIKey = JDFUJAMTCCQARF-UHFFFAOYAO
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C6H18N3S.C3H9F2Si/c1-7(2)10(8(3)4)9(5)6;1-6(2,3,4)5/h1-6H3;1-3H3/q+1;-1 | StdInChI = 1S/C6H6N6O6/c7-1-4(10(13)14)2(8)6(12(17)18)3(9)5(1)11(15)16/h7-9H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JMGVTLYEFSBAGJ-UHFFFAOYSA-N | StdInChIKey = JDFUJAMTCCQARF-UHFFFAOYSA-N
| CASNo = <!-- blanked - oldvalue: 59218-87-0 --> | CASNo = <!-- blanked - oldvalue: 3058-38-6 -->
| PubChem = 9795567 | PubChem = 18286
| SMILES = F(F)(C)(C)C.N((N(C)C)N(C)C)(C)C | SMILES = c1(c(c(c(c(c1(=O))N)(=O))N)(=O))N
}} }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| C=9|H=27|F=2|Si=1|S=1|N=3 | C = 6 | H = 6 | N = 6 | O = 6
| MolarMass = 275.48 | MolarMass = 258.15 g/mol
| Appearance = Colorless solid | Appearance = Yellow or brown powdered crystals (])
| Density = | Density = 1.93 ]/cm<sup>3</sup>
| MeltingPtC = 350
| MeltingPt = 98-101 °C
| BoilingPt = | BoilingPt =
| Solubility = | Solubility = }}
}}
| Section3 = {{Chembox Hazards | Section3 = {{Chembox Hazards
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| Autoignition = | Autoignition = }}
| Section6 = {{Chembox Explosive
}}
| ShockSens = Insensitive
| FrictionSens = Insensitive
| ExplosiveV = 7350 ]
| REFactor = }}
}} }}

Revision as of 18:32, 9 January 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 444253987 of page TATB with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
IUPAC name 1,3,5-triamino-2,4,6-trinitrobenzene
Identifiers
3D model (JSmol)
ChemSpider
PubChem CID
InChI
  • InChI=1S/C6H6N6O6/c7-1-4(10(13)14)2(8)6(12(17)18)3(9)5(1)11(15)16/h7-9H2Key: JDFUJAMTCCQARF-UHFFFAOYSA-N
  • InChI=1/C6H6N6O6/c7-1-4(10(13)14)2(8)6(12(17)18)3(9)5(1)11(15)16/h7-9H2Key: JDFUJAMTCCQARF-UHFFFAOYAO
SMILES
  • c1(c(c(c(c(c1(=O))N)(=O))N)(=O))N
Properties
Chemical formula C6H6N6O6
Molar mass 258.15 g/mol
Appearance Yellow or brown powdered crystals (rhombohedral)
Density 1.93 g/cm
Melting point 350 °C (662 °F; 623 K)
Explosive data
Shock sensitivity Insensitive
Friction sensitivity Insensitive
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkverify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic