Revision as of 12:22, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444217414 of page Terbuthylazine for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 12:22, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 468713004 of page Terconazole for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 444216267 |
|
| verifiedrevid = 411404554 |
|
|ImageFile=Terbuthylazine.png |
|
|
|
| IUPAC_name = 1-methoxy]phenyl]- 4-propan-2-yl-piperazine |
|
|ImageSize= |
|
|
|
| image = Terconazole.png |
|
|IUPACName=N-tert-butyl-6-chloro-N'-ethyl-1,3,5-triazine-2,4-diamine |
|
|
|
|
|
|OtherNames= |
|
|
|
<!--Clinical data--> |
|
|Section1={{Chembox Identifiers |
|
|
|
| tradename = Terazol |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| Drugs.com = {{drugs.com|monograph|terconazole}} |
⚫ |
| ChemSpiderID = 20848 |
|
|
|
| MedlinePlus = a688022 |
|
| InChI = 1/C9H16ClN5/c1-5-11-7-12-6(10)13-8(14-7)15-9(2,3)4/h5H2,1-4H3,(H2,11,12,13,14,15) |
|
|
|
| pregnancy_category = |
|
| InChIKey = FZXISNSWEXTPMF-UHFFFAOYAN |
|
|
|
| legal_status = |
|
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = 94.9% |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 67915-31-5 |
|
|
| ATC_prefix = G01 |
|
|
| ATC_suffix = AG02 |
|
|
| ATC_supplemental = |
|
⚫ |
| PubChem = 441383 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00251 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 390122 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 0KJ2VE664U |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
⚫ |
| KEGG = D00888 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 1306 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=26 | H=31 | Cl=2 | N=5 | O=3 |
|
|
| molecular_weight = 532.462 g/mol |
|
|
| smiles = Clc1ccc(c(Cl)c1)4(O(COc3ccc(N2CCN(C(C)C)CC2)cc3)CO4)Cn5ncnc5 |
|
|
| InChI = 1/C26H31Cl2N5O3/c1-19(2)31-9-11-32(12-10-31)21-4-6-22(7-5-21)34-14-23-15-35-26(36-23,16-33-18-29-17-30-33)24-8-3-20(27)13-25(24)28/h3-8,13,17-19,23H,9-12,14-16H2,1-2H3/t23-,26-/m0/s1 |
|
|
| InChIKey = BLSQLHNBWJLIBQ-OZXSUGGEBD |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C9H16ClN5/c1-5-11-7-12-6(10)13-8(14-7)15-9(2,3)4/h5H2,1-4H3,(H2,11,12,13,14,15) |
|
| StdInChI = 1S/C26H31Cl2N5O3/c1-19(2)31-9-11-32(12-10-31)21-4-6-22(7-5-21)34-14-23-15-35-26(36-23,16-33-18-29-17-30-33)24-8-3-20(27)13-25(24)28/h3-8,13,17-19,23H,9-12,14-16H2,1-2H3/t23-,26-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = FZXISNSWEXTPMF-UHFFFAOYSA-N |
|
| StdInChIKey = BLSQLHNBWJLIBQ-OZXSUGGESA-N |
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo=5915-41-3 |
|
⚫ |
| PubChem=22206 |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = C18810 |
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 30263 |
|
|
| SMILES = Clc1nc(nc(n1)NC(C)(C)C)NCC |
|
|
}} |
|
|
|Section2={{Chembox Properties |
|
|
| Formula=C<sub>9</sub>H<sub>16</sub>ClN<sub>5</sub> |
|
|
| MolarMass=229.710 g/mol |
|
|
| Appearance= |
|
|
| Density= |
|
|
| MeltingPt= |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
|
}} |
|
}} |