Revision as of 12:22, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 441009579 of page Terephthaloyl_chloride for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 12:23, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456991219 of page Terfenadine for the Chem/Drugbox validation project (updated: 'DrugBank', 'StdInChI').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 402682007 |
|
| verifiedrevid = 420247890 |
⚫ |
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
|
| IUPAC_name = (''RS'')-1-(4-''tert''-butylphenyl)-4-{4-piperidin-1-yl}-butan-1-ol |
|
| ImageFile = Terephthaloylchloride.png |
|
|
|
| image = Terfenadine.svg |
|
| ImageName = Skeletal formula |
|
|
|
| width = 200 |
|
| ImageFile1 = Terephthaloyl-chloride-3D-balls.png |
|
|
|
| imagename = 1 : 1 mixture (racemate) |
|
| ImageName1 = Ball-and-stick model |
|
|
|
| drug_name = Terfenadine |
|
| IUPACName = Terephthaloyl dichloride |
|
|
|
|
|
| OtherNames = 1,4-Benzenedicarbonyl chloride, Benzene-1,4-dicarbonyl chloride, Terephthalic acid dichloride, Terephthaloyl dichloride, p-Phthalyl chloride, TCL |
|
|
|
<!--Clinical data--> |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| tradename = |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| Drugs.com = {{drugs.com|MTM|terfenadine}} |
⚫ |
| ChemSpiderID = 7207 |
|
|
|
| MedlinePlus = a600034 |
|
| InChI = 1/C8H4Cl2O2/c9-7(11)5-1-2-6(4-3-5)8(10)12/h1-4H |
|
|
|
| pregnancy_category = |
|
| InChIKey = LXEJRKJRKIFVNY-UHFFFAOYAY |
|
|
|
| legal_status = Withdrawn |
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| routes_of_administration = |
|
| StdInChI = 1S/C8H4Cl2O2/c9-7(11)5-1-2-6(4-3-5)8(10)12/h1-4H |
|
|
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
<!--Pharmacokinetic data--> |
⚫ |
| StdInChIKey = LXEJRKJRKIFVNY-UHFFFAOYSA-N |
|
|
|
| bioavailability = |
|
|
| protein_bound = 70% |
|
|
| metabolism = |
|
|
| elimination_half-life = 3.5 hours |
|
|
|
|
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CASNo = 100-20-9 |
|
|
|
| CAS_number = 50679-08-8 |
⚫ |
| PubChem = 7488 |
|
|
|
| ATC_prefix = R06 |
|
| SMILES = O=C(Cl)c1ccc(C(Cl)=O)cc1 |
|
|
|
| ATC_suffix = AX12 |
|
}} |
|
|
⚫ |
| PubChem = 5405 |
|
| Section2 = {{Chembox Properties |
|
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| Formula = C<sub>8</sub>H<sub>4</sub>Cl<sub>2</sub>O<sub>2</sub> |
|
|
|
| DrugBank = DB00342 |
|
| MolarMass = 203.02 g/mol |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| Appearance = |
|
|
⚫ |
| ChemSpiderID = 5212 |
|
| Density = 1.34 g/cm<sup>3</sup> |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| MeltingPt = 81.5-83 °C |
|
|
|
| UNII = 7BA5G9Y06Q |
|
| BoilingPt = 265 °C |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| Solubility = |
|
|
|
| KEGG = D00521 |
|
}} |
|
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
| ChEMBL = 17157 |
|
|
|
|
| FlashPt = |
|
|
|
<!--Chemical data--> |
|
| Autoignition = |
|
|
|
| C=32 | H=41 | N=1 | O=2 |
|
}} |
|
|
|
| molecular_weight = 471.673 ]/] |
|
|
| smiles = OC(c1ccccc1)(c2ccccc2)C4CCN(CCCC(O)c3ccc(cc3)C(C)(C)C)CC4 |
|
|
| InChI = 1/C32H41NO2/c1-31(2,3) 26-18-16-25(17-19-26)30(34)15-10-22-33-23-20-29(21-24-33) 32(35,27-11-6-4-7-12-27) 28-13-8-5-9-14-28/ h4-9,11-14,16-19,29-30,34-35H,10,15,20-24H2,1-3H3 |
|
|
| InChIKey = GUGOEEXESWIERI-UHFFFAOYAL |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C32H41NO2/c1-31(2,3)26-18-16-25(17-19-26)30(34)15-10-22-33-23-20-29(21-24-33)32(35,27-11-6-4-7-12-27)28-13-8-5-9-14-28/h4-9,11-14,16-19,29-30,34-35H,10,15,20-24H2,1-3H3 |
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = GUGOEEXESWIERI-UHFFFAOYSA-N |
|
}} |
|
}} |