Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 12:28, 10 January 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 468212255 of page Tert-Butyllithium for the Chem/Drugbox validation project (updated: '').← Previous edit		Revision as of 12:28, 10 January 2012 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 470590748 of page Terthiophene for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~Chembox~~		{{chembox
	\| ~~Watchedfields~~ = changed		\| Verifiedfields = changed
	\| verifiedrevid = ~~451593004~~		\| verifiedrevid = 459430074
	\| Name = ~~''tert''-Butyllithium~~		\| Name = Terthiophene
	\| ImageFile = ~~Tert~~-~~Butyllithium~~.~~png~~		\| ImageFile = Alpha-Terthiophene numbering.svg
			\| ImageSize = 200px
	\| ImageFile_Ref = {{chemboximage\|correct\|??}}
			\| ImageName = Terthiophene
	\| ImageName = Skeletal formula of ''tert''-butyllithium with all implicit hydrogens shown, and partial charges added
			\| IUPACName = 2,2':5',2"-terthiophene
	\| PIN = ''tert''-Butyllithium{{Citation needed\|date = October 2011}}
			\| OtherNames = α-Terthienyl<br />2,5-Di(2-thienyl)thiophene
	\| Section1 = {{Chembox Identifiers		\| Section1 = {{Chembox Identifiers
		⚫	\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
	\| CASNo = 594-19-4
			\| ChEBI = 10335
⚫	\| ~~CASNo_Ref~~ = {{~~cascite~~\|correct\|~~CAS~~}}
			\| SMILES = s1cccc1c2sc(cc2)c3sccc3
⚫	\| PubChem = ~~638178~~
	\| ~~PubChem_Ref~~ = {{~~Pubchemcite~~\|correct\|~~Pubchem~~}}		\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ChemSpiderID = ~~10254347~~		\| ChemSpiderID = 58578
		⚫	\| PubChem = 65067
⚫	\| ~~ChemSpiderID_Ref~~ = {{~~chemspidercite~~\|correct\|chemspider}}
			\| InChI = 1/C12H8S3/c1-3-9(13-7-1)11-5-6-12(15-11)10-4-2-8-14-10/h1-8H
	\| EINECS = 209-831-5
			\| InChIKey = KXSFECAJUBPPFE-UHFFFAOYAI
	\| UNNumber = 3394
			\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
	\| MeSHName = n-butyllithium
	\| ~~Beilstein~~ = ~~3587204~~		\| ChEMBL = 90017
		⚫	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| SMILES = C(C)(C)C
	\| StdInChI = 1S/~~C4H9.Li~~/c1-4(2)3;/h1-~~3H3;~~		\| StdInChI = 1S/C12H8S3/c1-3-9(13-7-1)11-5-6-12(15-11)10-4-2-8-14-10/h1-8H
	\| ~~StdInChI_Ref~~ = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~BKDLGMUIXWPYGD~~-UHFFFAOYSA-N		\| StdInChIKey = KXSFECAJUBPPFE-UHFFFAOYSA-N
			\| CASNo_Ref = {{cascite\|changed\|??}}
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
			\| CASNo = <!-- blanked - oldvalue: 1081-34-1 -->
⚫	}}
			\| RTECS = WZ9717750
		⚫	}}
	\| Section2 = {{Chembox Properties		\| Section2 = {{Chembox Properties
	\| Formula = ~~{{Chem\|LiC\|4\|~~H~~\|9}}~~		\| Formula = C<sub>12</sub>H<sub>8</sub>S<sub>3</sub>
	\| MolarMass = 64.~~055~~ g ~~mol<sup>-1<~~/~~sup>~~		\| MolarMass = 248.39 g/mol
		⚫	\| Appearance = pale yellow solid
	\| ExactMass = 64.086429337 g mol<sup>-1</sup>
			\| Density =
⚫	\| Appearance = ~~Colorless~~ solid
		⚫	\| Solubility = insoluble
	\| Density = 660 mg cm<sup>-3</sup>
	\| ~~BoilingPtCL~~ = 36		\| MeltingPt = 93-95 °C
		⚫	}}
	\| BoilingPtCH = 40
		⚫	\| Section3 = {{Chembox Structure
⚫	\| Solubility = ~~Reacts~~
			\| CrystalStruct =
⚫	}}
			\| Dipole =
⚫	\| Section3 = {{Chembox ~~Hazards~~
		⚫	}}
	\| GHSPictograms = {{GHS flame}} {{GHS corrosion}} {{GHS exclamation mark}} {{GHS health hazard}} {{GHS environment}}
		⚫	\| Section7 = {{Chembox Hazards
	\| GHSSignalWord = '''DANGER'''
			\| ExternalMSDS =
	\| HPhrases = {{H-phrases\|225\|250\|260\|304\|314\|336\|411}}
			\| MainHazards = flammable
	\| PPhrases = {{P-phrases\|210\|222\|223\|231+232\|370+378\|422}}
			\| RPhrases =
	\| EUClass = {{Hazchem F}} {{Hazchem C}} {{Hazchem N}}
			\| SPhrases = {{S22}} {{S24/25}}
	\| RPhrases = {{R11}}, {{R15}}, {{R17}}, {{R34}}, {{R51/53}}, {{R65}}, {{R66}}, {{R67}}, {{R50/53}}, {{R38}}
		⚫	}}
	\| SPhrases = {{S26}}, {{S36/37/39}}, {{S43}}, {{S45}}, {{S62}}, {{S61}}, {{S16}}, {{S33}}
			\| Section8 = {{Chembox Related
	\| NFPA-H = 3
			\| OtherCpds = ]<br />]
	\| NFPA-F = 3
			}}
	\| NFPA-R = 4
	\| NFPA-O = W
	\| FlashPt = -6.6 °C
⚫	}}
⚫	\| ~~Section4~~ = {{Chembox ~~Related~~
	\| OtherCpds = ]<br />
	]
⚫	}}
	}}		}}

Revision as of 12:28, 10 January 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 470590748 of page Terthiophene with values updated to verified values.

Terthiophene
Names
Terthiophene
IUPAC name 2,2':5',2"-terthiophene
Other names α-Terthienyl 2,5-Di(2-thienyl)thiophene
Identifiers
3D model (JSmol)	Interactive image
ChEBI	CHEBI:10335
ChEMBL	ChEMBL90017
ChemSpider	58578
PubChem CID	65067
RTECS number	WZ9717750
InChI InChI=1S/C12H8S3/c1-3-9(13-7-1)11-5-6-12(15-11)10-4-2-8-14-10/h1-8HKey: KXSFECAJUBPPFE-UHFFFAOYSA-N InChI=1/C12H8S3/c1-3-9(13-7-1)11-5-6-12(15-11)10-4-2-8-14-10/h1-8HKey: KXSFECAJUBPPFE-UHFFFAOYAI
SMILES s1cccc1c2sc(cc2)c3sccc3
Properties
Chemical formula	C₁₂H₈S₃
Molar mass	248.39 g/mol
Appearance	pale yellow solid
Melting point	93-95 °C
Solubility in water	insoluble
Hazards
Occupational safety and health (OHS/OSH):
Main hazards	flammable
Related compounds
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references

Tracking categories (test):

SizeSet

Chemical compound