Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:37, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 450232352 of page Tetraethyltin for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit Revision as of 12:37, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 447622155 of page Tetrafluorohydrazine for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{chembox
| Watchedfields = changed
| verifiedrevid = 449803205
| verifiedrevid = 401623939
| IUPACName = Tetraethyltin
| ImageFile = Tetrafluorohydrazine-2D.png
| SystematicName = <!-- Tetraethylstannane (substitutive) OR tetraethyltin (additive)-->
| ImageFile1 = Tetrafluorohydrazine-3D-balls.png
| OtherNames = Tetraethyl tin
| IUPACName = 1,1,2,2-tetrafluorohydrazine
| ImageFile1 = Tetraethyltin.svg
| OtherNames = dinitrogen tetrafluoride, perfluorohydrazine, UN 1955
| ImageSize1 = 180px
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| Abbreviations = TET | Abbreviations =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| CASNo = <!-- blanked - oldvalue: 597-64-8 -->
| ChemSpiderID = 23228
| CASNo_Ref = {{cascite|correct|??}}
| InChI1 = 1/F4N2/c1-5(2)6(3)4
| PubChem = 11704
| InChIKey1 = GFADZIUESKAXAK-UHFFFAOYAX
| PubChem_Ref = {{Pubchemcite|correct|PubChem}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| ChemSpiderID = 11212
| StdInChI = 1S/F4N2/c1-5(2)6(3)4
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| EINECS = 209-906-2
| StdInChIKey = GFADZIUESKAXAK-UHFFFAOYSA-N
| UNNumber = 3384
| CASNo = <!-- blanked - oldvalue: 10036-47-2 -->
| MeSHName = Tetraethyltin
| EINECS =
| SMILES = CC(CC)(CC)CC
| PubChem = 24845
| StdInChI = 1S/4C2H5.Sn/c4*1-2;/h4*1H2,2H3;
| SMILES = FN(F)N(F)F
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| InChI = 1/F4N2/c1
| StdInChIKey = RWWNQEOPUOCKGR-UHFFFAOYSA-N
| RTECS =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| MeSHName =
}}
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI =
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG =
| ATCCode = }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = N<sub>2</sub>F<sub>4</sub>
| C = 8
| MolarMass = 104.01 g mol<sup>−1</sup>
| H = 20
| Sn = 1 | Appearance =
| Density =
| ExactMass = 236.058697211 g mol<sup>-1</sup>
| MeltingPt = −164.5 °C, 108.7 K<ref name="Greenwood&Earnshaw">{{Greenwood&Earnshaw}}</ref>
| Appearance = Colourless liquid
| Melting_notes =
| Density = 1.187 g cm<sup>-3</sup>
| BoilingPt = −73 °C, 200 K<ref name="Greenwood&Earnshaw" />
| MeltingPtC = -112
| Boiling_notes =
| BoilingPtC = 181}}
| Solubility =
| Section3 = {{Chembox Hazards
| SolubleOther =
| EUClass = {{Hazchem T+}}{{Hazchem N}}
| Solvent =
| RPhrases = {{R26/27/28}} {{R50/53}}
| pKa =
| SPhrases = {{S26}}, {{S27}}, {{S28}}, {{S45}}, {{S60}}, {{S61}}
| NFPA-H = 3 | pKb =
| NFPA-F = 2 | IsoelectricPt =
| NFPA-R = 3 | SpecRotation =
| RefractIndex =
| FlashPt = 53 °C}}
| Viscosity =
| Section4 = {{Chembox Related
| Dipole = }}
| Function = Tetraalkylstannanes
| Section3 = {{Chembox Structure
| OtherFunctn = ]<br />
| CrystalStruct =
]
| Coordination =
| OtherCpds = ]<br />
| MolShape =
]}}
| Dipole = }}
| Section4 = {{Chembox Thermochemistry
| DeltaHf =
| DeltaHc =
| Entropy =
| HeatCapacity = }}
| Section5 = {{Chembox Pharmacology
| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| PregCat =
| PregCat_AU =
| PregCat_US = }}
| Section6 = {{Chembox Explosive
| ShockSens =
| FrictionSens =
| ExplosiveV =
| REFactor = }}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUClass =
| EUIndex =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-O =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt =
| Autoignition =
| ExploLimits =
| PEL = }}
| Section8 = {{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunctn =
| Function =
| OtherCpds = }}
}} }}

Revision as of 12:37, 10 January 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 447622155 of page Tetrafluorohydrazine with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
IUPAC name 1,1,2,2-tetrafluorohydrazine
Other names dinitrogen tetrafluoride, perfluorohydrazine, UN 1955
Identifiers
3D model (JSmol)
ChemSpider
PubChem CID
InChI
  • InChI=1S/F4N2/c1-5(2)6(3)4Key: GFADZIUESKAXAK-UHFFFAOYSA-N
  • InChI=1/F4N2/c1
  • InChI=1/F4N2/c1-5(2)6(3)4Key: GFADZIUESKAXAK-UHFFFAOYAX
SMILES
  • FN(F)N(F)F
Properties
Chemical formula N2F4
Molar mass 104.01 g mol
Melting point −164.5 °C, 108.7 K
Boiling point −73 °C, 200 K
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkverify (what is  ?) Infobox references
Chemical compound
  1. ^ Greenwood, Norman N.; Earnshaw, Alan (1997). Chemistry of the Elements (2nd ed.). Butterworth-Heinemann. ISBN 978-0-08-037941-8.