Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 16:10, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 423264570 of page Wedelolactone for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit Revision as of 16:13, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456793387 of page Xamoterol for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{Drugbox
| Verifiedfields = changed
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 410175363 | verifiedrevid = 410175973
| IUPAC_name = ''N''-(2-{amino}ethyl)morpholine-4-carboxamide
|ImageFile=Wedelolactone.png
| image = xamoterol.png
|ImageSize=200px

|IUPACName= 1,8,9-trihydroxy-3-methoxy-6H-benzofurochromen-6-one
<!--Clinical data-->
|OtherNames=
| tradename =
|Section1= {{Chembox Identifiers
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| pregnancy_US = <!-- A / B / C / D / X -->
⚫ | ChemSpiderID = 4445124
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
⚫ | CAS_number = <!-- blanked - oldvalue: 81801-12-9 -->
| ATC_prefix = C01
| ATC_suffix = CX07
⚫ | PubChem = 155774
| IUPHAR_ligand = 538
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 137213
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 7HE0JQL703
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C10541 | KEGG = D06328
| InChI = 1/C16H10O7/c1-21-6-2-10(19)14-12(3-6)23-16(20)13-7-4-8(17)9(18)5-11(7)22-15(13)14/h2-5,17-19H,1H3
| InChIKey = XQDCKJKKMFWXGB-UHFFFAOYAT
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 97453 | ChEMBL = 75753

<!--Chemical data-->
| C=16 | H=25 | N=3 | O=5
| molecular_weight = 339.387 g/mol
| smiles = O=C(NCCNCC(O)COc1ccc(O)cc1)N2CCOCC2
| InChI = 1/C16H25N3O5/c20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19/h1-4,14,17,20-21H,5-12H2,(H,18,22)
| InChIKey = DXPOSRCHIDYWHW-UHFFFAOYAQ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H10O7/c1-21-6-2-10(19)14-12(3-6)23-16(20)13-7-4-8(17)9(18)5-11(7)22-15(13)14/h2-5,17-19H,1H3 | StdInChI = 1S/C16H25N3O5/c20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19/h1-4,14,17,20-21H,5-12H2,(H,18,22)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XQDCKJKKMFWXGB-UHFFFAOYSA-N | StdInChIKey = DXPOSRCHIDYWHW-UHFFFAOYSA-N
⚫ | CASNo = <!-- blanked - oldvalue: 524-12-9 -->
⚫ | PubChem = 5281813
| SMILES = O=C3Oc4cc(OC)cc(O)c4c2oc1c(cc(O)c(O)c1)c23
}}
|Section2= {{Chembox Properties
| Formula = C<sub>16</sub>H<sub>10</sub>O<sub>7</sub>
| MolarMass= 314.24 g/mol
| ExactMass = 314.042653 u
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3= {{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
}}
}} }}

Revision as of 16:13, 10 January 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456793387 of page Xamoterol with values updated to verified values.

{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 410175973 | IUPAC_name = N-(2-{amino}ethyl)morpholine-4-carboxamide | image = xamoterol.png

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref = | CAS_number = | ATC_prefix = C01 | ATC_suffix = CX07 | PubChem = 155774 | IUPHAR_ligand = 538 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 137213 | UNII_Ref = | UNII = 7HE0JQL703 | KEGG_Ref = | KEGG = D06328 | ChEMBL_Ref = | ChEMBL = 75753

| C=16 | H=25 | N=3 | O=5 | molecular_weight = 339.387 g/mol | smiles = O=C(NCCNCC(O)COc1ccc(O)cc1)N2CCOCC2 | InChI = 1/C16H25N3O5/c20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19/h1-4,14,17,20-21H,5-12H2,(H,18,22) | InChIKey = DXPOSRCHIDYWHW-UHFFFAOYAQ | StdInChI_Ref = | StdInChI = 1S/C16H25N3O5/c20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19/h1-4,14,17,20-21H,5-12H2,(H,18,22) | StdInChIKey_Ref = | StdInChIKey = DXPOSRCHIDYWHW-UHFFFAOYSA-N }}