Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 16:14, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455795909 of page Xanthone for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 16:15, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 452028278 of page Xanthopterin for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
⚫ | verifiedrevid = 452026764
| Verifiedfields = changed
⚫ | ImageFile = Xanthopterin.svg
⚫ | verifiedrevid = 419140516
| Name = Xanthone | ImageSize = 100px
| IUPACName = Xanthopterin
| ImageFile_Ref = {{chemboximage|correct|??}}
| OtherNames =
⚫ | ImageFile = Xanthone.svg
| ImageSize = 200px
| ImageName = Xanthone
| IUPACName = ''9H''-xanthen-9-one
| OtherNames = 9-oxo-]<br />diphenyline ketone oxide
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| CASNo = <!-- blanked - oldvalue: 119-44-8 -->
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 37647 | PubChem = 8397
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| SMILES = O=C1c3c(Oc2c1cccc2)cccc3
⚫ | ChemSpiderID = 8091
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | UNII_Ref = {{fdacite|correct|FDA}}
⚫ | ChemSpiderID = 6753
| PubChem = 7020 | UNII = V66551EU1R
| InChI = 1/C13H8O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H
| InChIKey = JNELGWHKGNBSMD-UHFFFAOYAA
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 186784
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H8O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H | StdInChI = 1S/C6H5N5O2/c7-6-10-4-3(5(13)11-6)9-2(12)1-8-4/h1H,(H,9,12)(H3,7,8,10,11,13)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JNELGWHKGNBSMD-UHFFFAOYSA-N | StdInChIKey = VURKRJGMSKJIQX-UHFFFAOYSA-N
| SMILES = O=C1/N=C(\NC=2/N=C\C(=O)NC1=2)N
⚫ | CASNo_Ref = {{cascite|correct|CAS}}
| InChI = InChI=1S/C6H5N5O2/c7-6-10-4-3(5(13)11-6)9-2(12)1-8-4/h1H,(H,9,12)(H3,7,8,10,11,13)}}
| CASNo = 90-47-1
⚫ | RTECS =
}}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = C<sub>13</sub>H<sub>8</sub>O<sub>2</sub> | Formula = C<sub>6</sub>H<sub>5</sub>N<sub>5</sub>O<sub>2</sub>
| MolarMass = 196.19 g/mol | MolarMass =
| Appearance = off-white solid | Appearance =
| Density = | Density =
| MeltingPt =
| Solubility = sl. sol. in hot water
| MeltingPtC = 174 | BoilingPt =
| BoilingPtC = 351 | Solubility = }}
⚫ | Section3 = {{Chembox Hazards
}}
| MainHazards =
⚫ | Section7 = {{Chembox Hazards
⚫ | FlashPt =
| ExternalMSDS =
| MainHazards = | Autoignition = }}
| FlashPt =
| RPhrases = {{R36/37/38}}
| SPhrases = {{S26}} {{S37}}<ref name="Alpha">] from AlphaAesar]</ref>
}}
| Section8 = {{Chembox Related
| OtherCpds = ]
}}
}} }}

Revision as of 16:15, 10 January 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 452028278 of page Xanthopterin with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
IUPAC name Xanthopterin
Identifiers
3D model (JSmol)
ChemSpider
PubChem CID
UNII
InChI
  • InChI=1S/C6H5N5O2/c7-6-10-4-3(5(13)11-6)9-2(12)1-8-4/h1H,(H,9,12)(H3,7,8,10,11,13)Key: VURKRJGMSKJIQX-UHFFFAOYSA-N
  • InChI=1S/C6H5N5O2/c7-6-10-4-3(5(13)11-6)9-2(12)1-8-4/h1H,(H,9,12)(H3,7,8,10,11,13)
SMILES
  • O=C1/N=C(\NC=2/N=C\C(=O)NC1=2)N
Properties
Chemical formula C6H5N5O2
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound