Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:11, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476791708 of page Sodium_silicate for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 12:11, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476791102 of page Gamma-Aminobutyric_acid for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{chembox
| verifiedrevid = 464403969 | verifiedrevid = 443831714
| Name=''gamma''-Aminobutyric acid
| ImageFileL1 = Sodium-metasilicate-repeating-unit-2D.png
| ImageFile = Gamma-Aminobuttersäure - gamma-aminobutyric acid.svg
| ImageFileL1_Ref = {{chemboximage|correct|??}}
| ImageSizeL1 = 121 | ImageSize = 230
| ImageName = Simplified structural formula
| ImageNameL1 = Structural formula of polymeric sodium silicate
| ImageFileR1 = Sodium-metasilicate-chain-from-xtal-3D-balls.png | ImageFile1 = GABA-3D-balls.png
| ImageSize1 = 230
| ImageFileR1_Ref = {{chemboximage|correct|??}}
| ImageName1 = Ball-and-stick model
| ImageSizeR1 = 121
| IUPACName = 4-aminobutanoic acid
| ImageNameR1 = Ball and stick model of polymeric sodium silicate
| OtherNames=
| ImageFile2 = Křemičitan sodný.PNG
⚫ |Section1= {{Chembox Identifiers
| ImageFile2_Ref = {{chemboximage|correct|??}}
⚫ | UNII_Ref = {{fdacite|correct|FDA}}
| ImageSize2 = 244
| UNII = 2ACZ6IPC6I
| ImageName2 = Sample of sodium silicate in a vial
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| IUPACName = Sodium metasilicate
| ChEMBL = 96
| OtherNames = Liquid glass<br />
| KEGG_Ref = {{keggcite|correct|kegg}}
Waterglass
| KEGG = D00058
⚫ | Section1 = {{Chembox Identifiers
| InChI = 1/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)
| Abbreviations = E550
| InChIKey = BTCSSZJGUNDROE-UHFFFAOYAC
| CASNo = 6834-92-0
| CASNo_Ref = {{cascite|correct|CAS}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)
| PubChem = 23266
| PubChem_Ref = {{Pubchemcite|correct|pubchem}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫ | StdInChIKey = BTCSSZJGUNDROE-UHFFFAOYSA-N
⚫ | ChemSpiderID = 21758
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | CASNo_Ref = {{cascite|correct|CAS}}
| EINECS = 229-912-9 | CASNo=56-12-2
| UNNumber = 3253 | PubChem=119
| IUPHAR_ligand = 1067
| MeSHName = Sodium+metasilicate
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| RTECS = VV9275000
⚫ | ChemSpiderID = 116
⚫ | ChEBI_Ref = {{ebicite|correct|EBI}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫ | ChEBI = 60720
| DrugBank = DB02530
| SMILES = ..()=O
| ChEBI_Ref = {{ebicite|correct|EBI}}
| StdInChI=1S/2Na.O3Si/c;;1-4(2)3/q2*+1;-2
⚫ | ChEBI = 59888
⚫ | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| SMILES=C(CC(=O)O)CN
| InChI = 1/2Na.O3Si/c;;1-4(2)3/q2*+1;-2
| MeSHName=gamma-Aminobutyric+Acid
⚫ | StdInChIKey = NTHWMYGWWRZVTN-UHFFFAOYSA-N
⚫ }}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫ |Section2= {{Chembox Properties
| InChIKey = NTHWMYGWWRZVTN-UHFFFAOYAB
| Formula=C<sub>4</sub>H<sub>9</sub>NO<sub>2</sub>
⚫ }}
| MolarMass=103.12 g/mol
⚫ | Section2 = {{Chembox Properties
| Na = 2 | Appearance=
| O = 3 | Density=
| Si = 1 | MeltingPtC=203.7
| BoilingPt=
| ExactMass = 121.941209749 g mol<sup>-1</sup>
| pKa=4.23 (carboxyl), 10.43 (amino)<ref>Dawson, R.M.C., et al., ''Data for Biochemical Research'', Oxford, Clarendon Press, 1959.</ref>
| Appearance = White, opaque crystals
| Solubility=
| Density = 2.4 g cm<sup>-3</sup>
⚫ }}
| MeltingPtC = 1088
⚫ |Section3= {{Chembox Hazards
| RefractIndex = 1.52
| MainHazards=
⚫ }}
| FlashPt=
| Section3 = {{Chembox Thermochemistry
| Autoignition=
| DeltaHf = −1561.43 kJ mol<sup>-1</sup>
⚫ }}
| Entropy = 113.71 J K<sup>−1</sup> mol<sup>−1</sup>
⚫ }}
⚫ | Section4 = {{Chembox Hazards
| ExternalMSDS =
| EUIndex = 014-010-00-8
| EUClass = {{Hazchem C}}
| NFPA-H = 2
| NFPA-F = 0
| NFPA-R = 0
| RPhrases = {{R34}}, {{R37}}
| SPhrases = {{S1/2}}, {{S13}}, {{S24/25}}, {{S36/37/39}}, {{S45}}
}}
| Section8 = {{Chembox Related
| OtherAnions = ]
| OtherCations = ]
}}
}} }}

Revision as of 12:11, 15 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 476791102 of page Gamma-Aminobutyric_acid with values updated to verified values.
gamma-Aminobutyric acid
Simplified structural formula
Ball-and-stick model
Names
IUPAC name 4-aminobutanoic acid
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChEMBL
ChemSpider
DrugBank
IUPHAR/BPS
KEGG
MeSH gamma-Aminobutyric+Acid
PubChem CID
UNII
InChI
  • InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)Key: BTCSSZJGUNDROE-UHFFFAOYSA-N
  • InChI=1/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)Key: BTCSSZJGUNDROE-UHFFFAOYAC
SMILES
  • C(CC(=O)O)CN
Properties
Chemical formula C4H9NO2
Molar mass 103.12 g/mol
Melting point 203.7 °C (398.7 °F; 476.8 K)
Acidity (pKa) 4.23 (carboxyl), 10.43 (amino)
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
  1. Dawson, R.M.C., et al., Data for Biochemical Research, Oxford, Clarendon Press, 1959.