Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:29, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{chembox}} taken from revid 475232701 of page Tartaric_acid for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 12:29, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{chembox}} taken from revid 475634461 of page 2,4-Dichlorobenzyl_alcohol for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
⚫ | verifiedrevid = 443312808
| Watchedfields = changed
| ImageFile = dichlorobenzyl alcohol.png
⚫ | verifiedrevid = 470481910
⚫ | ImageSize = 120px
| ImageFile_Ref = {{chemboximage|correct|??}}
| IUPACName = (2,4-Dichlorophenyl)methanol
| ImageFile = Tartaric acid.svg
| OtherNames = Dybenal<br>Rapidosept<br>Myacide SP
| ImageFile1 = Tartaric-acid-3D-balls.png
⚫ | ImageSize =
| IUPACName = 2,3-dihydroxybutanedioic acid
| OtherNames = 2,3-dihydroxysuccinic acid<br>threaric acid<br>racemic acid<br>uvic acid<br>paratartaric acid
| Reference = <ref>, ].</ref>
|-
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| Abbreviations =
⚫ | KEGG_Ref = {{keggcite|correct|kegg}}
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | KEGG = C00898
⚫ | ChemSpiderID = 14918
| InChI = 1/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)
| InChI = 1/C7H6Cl2O/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4H2
| InChIKey = FEWJPZIEWOKRBE-UHFFFAOYAZ
| InChIKey = DBHODFSFBXJZNY-UHFFFAOYAI
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| SMILES1 = Clc1cc(Cl)ccc1CO
| ChEMBL = 333714
| ChEMBL2 = 1200861
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10) | StdInChI = 1S/C7H6Cl2O/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FEWJPZIEWOKRBE-UHFFFAOYSA-N | StdInChIKey = DBHODFSFBXJZNY-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|??}}
| CASNo = 526-83-0 | CASNo = <!-- blanked - oldvalue: 1777-82-8 -->
| PubChem = 875 | EINECS =
| PubChem = 15684
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | SMILES = C1=CC(=C(C=C1Cl)Cl)CO
⚫ | ChemSpiderID = 852
| InChI =
⚫ | MeSHName = tartaric+acid
| RTECS =
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫ | MeSHName =
| DrugBank = DB01694
| ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 15674 | ChEBI = 48220
⚫ | KEGG_Ref = {{keggcite|correct|kegg}}
⚫ | SMILES = O=C(O)C(O)C(O)C(=O)O
⚫ | KEGG =
}}
| ATCCode_prefix =
| ATCCode_suffix =
| ATC_Supplemental =}}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = C<sub>4</sub>H<sub>6</sub>O<sub>6</sub><small> (Basic formula)</small><br>HO<sub>2</sub>CCH(OH)CH(OH)CO<sub>2</sub>H <small>(Structural formula)</small> | Formula = C<sub>7</sub>H<sub>6</sub>Cl<sub>2</sub>O
| MolarMass = 150.087 g/mol | MolarMass = 177.03 g/mol
| Appearance = white powder | Appearance =
| Density = 1.79 g/mL (H<sub>2</sub>O) | Density =
| MeltingPt = 57-60 °C
| MeltingPt = 171–174&nbsp;°C (''L or D''-tartaric; pure)<br>206&nbsp;°C (''DL'', racemic)<br> 165-166°C ("meso-anhyrdous") <br> 146–148&nbsp;°C (''meso-hydrous'')<ref>{{RubberBible86th}}</ref> <br>
| BoilingPt = | Melting_notes =
| Solubility = 133 g/100ml (20&nbsp;°C) | BoilingPt = 150 °C
| Boiling_notes = 25 mmHg
| pKa = L(+) 25&nbsp;°C :<br>pK<sub>a1</sub>= 2.95 pK<sub>a2</sub>= 4.25<br>meso 25&nbsp;°C:<br>pK<sub>a1</sub>= 3.22 pK<sub>a2</sub>= 4.85
| Solubility =
}}
| SolubleOther =
⚫ | Section3 = {{Chembox Hazards
| MainHazards = | Solvent =
| pKa =
|EUClass=Irritant('''Xi''')
|RPhrases={{R36}} | pKb = }}
⚫ | Section7 = {{Chembox Hazards
⚫ | Autoignition =
| EUClass =
}}
| EUIndex =
| Section4 = {{Chembox Related
| MainHazards =
| OtherCations = ]<br />]<br />]<br />]
| NFPA-H =
| Function = ]s
| NFPA-F =
| OtherFunctn = ]<br />]<br />]<br />]<br />]
| NFPA-R =
| OtherCpds = ]<br />]
| NFPA-O =
}}
| RPhrases =

| SPhrases =
| RSPhrases =
| FlashPt =
⚫ | Autoignition =
| ExploLimits =
| PEL = }}
}} }}

Revision as of 12:29, 15 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 475634461 of page 2,4-Dichlorobenzyl_alcohol with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
IUPAC name (2,4-Dichlorophenyl)methanol
Other names Dybenal
Rapidosept
Myacide SP
Identifiers
3D model (JSmol)
ChEBI
ChemSpider
PubChem CID
InChI
  • InChI=1S/C7H6Cl2O/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4H2Key: DBHODFSFBXJZNY-UHFFFAOYSA-N
  • Key: DBHODFSFBXJZNY-UHFFFAOYAI
SMILES
  • C1=CC(=C(C=C1Cl)Cl)CO
  • Clc1cc(Cl)ccc1CO
Properties
Chemical formula C7H6Cl2O
Molar mass 177.03 g/mol
Melting point 57-60 °C
Boiling point 150 °C
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound