Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:33, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 474053290 of page Potassium_tert-butoxide for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 12:34, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 473662764 of page Sodium_dichloroisocyanurate for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| verifiedrevid = 464212711 | verifiedrevid = 464400873
| ImageFile = Sodium dichloroisocyanurate structure.svg
| Name=Potassium ''tert''-butoxide
| ImageSize = 150px
| ImageFileL1 = Potassium tert-butoxide.png
| IUPACName = sodium 3,5-dichloro-2,4,6-trioxo-1,3,5-triazinan-1-ide
| ImageSizeL1 = 115px
| OtherNames = Sodium dichloroisocyanurate
| ImageNameL1 = Skeletal formula of potassium tert-butoxide
⚫ | Section1 = {{Chembox Identifiers
| ImageFileR1 = Potassium-tert-butoxide-3D-balls-ionic.png
| ImageSizeR1 = 125px | Abbreviations =
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ImageNameR1 = Ball-and-stick model of potassium tert-butoxide
⚫ | ChemSpiderID = 451165
|IUPACName=potassium 2-methylpropan-2-olate
| InChI = 1S/C3HCl2N3O3.Na/c4-7-1(9)6-2(10)8(5)3(7)11;/h(H,6,9,10);/q;+1/p-1
|OtherNames=
| InChIKey = MSFGZHUJTJBYFA-REWHXWOFAV
⚫ |Section1={{Chembox Identifiers
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 63266
| InChI = 1/C4H9O.K/c1-4(2,3)5;/h1-3H3;/q-1;+1
| InChIKey = LPNYRYFBWFDTMA-UHFFFAOYAU
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C4H9O.K/c1-4(2,3)5;/h1-3H3;/q-1;+1 | StdInChI = 1S/C3HCl2N3O3.Na/c4-7-1(9)6-2(10)8(5)3(7)11;/h(H,6,9,10);/q;+1/p-1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LPNYRYFBWFDTMA-UHFFFAOYSA-N | StdInChIKey = MSFGZHUJTJBYFA-UHFFFAOYSA-M
| InChIKey1 = MSFGZHUJTJBYFA-UHFFFAOYSA-M
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=865-47-4 | CASNo = 2893-78-9
| PubChem = 70077 | EINECS =
| PubChem =
| SMILES = .C(C)(C)C | SMILES = .ClN1C(=O)C(=O)N(Cl)C1=O
}}
| InChI =
⚫ |Section2={{Chembox Properties
| RTECS = XZ1900000
⚫ | Formula=C<sub>4</sub>H<sub>9</sub>KO
| MeSHName =
⚫ | MolarMass=112.21196
| ChEBI_Ref = {{ebicite|correct|EBI}}
| Appearance= solid
| Density= | ChEBI =
| KEGG_Ref = {{keggcite|correct|kegg}}
| MeltingPtC=256
| BoilingPtC= | KEGG =
| ATCCode_prefix =
⚫ | Solubility=
| ATCCode_suffix =
}}
| ATC_Supplemental =}}
⚫ |Section3={{Chembox Hazards
⚫ | Section2 = {{Chembox Properties
| ExternalMSDS =
⚫ | Formula = C<sub>3</sub>Cl<sub>2</sub>N<sub>3</sub>NaO<sub>3</sub>
| EUClass = Harmful (Xn), Corrosive (C)
⚫ | MolarMass = 219.95
⚫ | FlashPt=
| Appearance =
⚫ | Autoignition=
| Density = 0.7 g/cm³ (as granules)
}}
| MeltingPt = 225 °C
| Melting_notes =
| BoilingPt =
| Boiling_notes =
⚫ | Solubility = 25 g/100 ml
| SolubleOther =
| Solvent =
| pKa =
| pKb = }}
⚫ | Section7 = {{Chembox Hazards
| EUClass =
| EUIndex =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-O =
| RPhrases =
| SPhrases =
| RSPhrases =
⚫ | FlashPt =
⚫ | Autoignition =
| ExploLimits =
| PEL = }}
}} }}

Revision as of 12:34, 15 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 473662764 of page Sodium_dichloroisocyanurate with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
IUPAC name sodium 3,5-dichloro-2,4,6-trioxo-1,3,5-triazinan-1-ide
Other names Sodium dichloroisocyanurate
Identifiers
CAS Number
3D model (JSmol)
ChemSpider
RTECS number
  • XZ1900000
InChI
  • InChI=1S/C3HCl2N3O3.Na/c4-7-1(9)6-2(10)8(5)3(7)11;/h(H,6,9,10);/q;+1/p-1Key: MSFGZHUJTJBYFA-UHFFFAOYSA-M
  • Key: MSFGZHUJTJBYFA-REWHXWOFAV
  • Key: MSFGZHUJTJBYFA-UHFFFAOYSA-M
SMILES
  • .ClN1C(=O)C(=O)N(Cl)C1=O
Properties
Chemical formula C3Cl2N3NaO3
Molar mass 219.95
Density 0.7 g/cm³ (as granules)
Melting point 225 °C
Solubility in water 25 g/100 ml
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound