Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:38, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476320526 of page Boric_acid for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 12:38, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476256651 of page Sodium_chlorite for the Chem/Drugbox validation project (updated: 'KEGG').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{chembox
| Verifiedfields = changed
| verifiedrevid = 464184931 | verifiedrevid = 464400571
| ImageFileL1_Ref = {{chemboximage|correct|??}}
| Name = Sodium chlorite
| ImageFileL1 = Boric-acid-2D.png
| ImageSizeL1 = 100px | ImageFileL1 = Na+.svg
| ImageSizeL1 = 50px
| ImageNameL1 = Structural formula
| ImageFileR1 = Boric-acid-3D-vdW.png | ImageFileR1 = Chlorition.png
| ImageSizeR1 = 120px | ImageSizeR1 = 100px
| ImageNameR1 = Space-filling model | ImageFileL2 = Sodium-3D.png
| ImageFile2 = Boric acid.jpg | ImageNameL2 = The sodium cation
| ImageFileR2 = Chlorite-3D-vdW.png
| ImageSize2 = 150px
| ImageSizeR2 = 120px
| ImageName2 = Boric acid crystals
| ImageNameR2 = Space-filling model of the chlorite anion
| IUPACName = Boric acid<br />Trihydroxidoboron<!-- This second IUPAC name has not been validated -->
| ImageFile3 = Sodium chlorite 450g.jpg
| OtherNames = Orthoboric acid,<br/>Boracic acid,<br/>Sassolite,<br/>Optibor,<br/>Borofax
| Section1 = {{Chembox Identifiers | IUPACName = Sodium chlorite
| OtherNames = Chlorous acid, sodium salt<br />Textone
⚫ | Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 7346 | ChemSpiderID = 22860
| PubChem = 7628 | PubChem = 24452
⚫ | UNII_Ref = {{fdacite|correct|FDA}}
| SMILES1 = B(O)(O)O
⚫ | UNII = G538EBV4VF
| ChEMBL_Ref = {{ebicite|correct|EBI}}
⚫ | InChI = 1/ClHO2.Na/c2-1-3;/h(H,2,3);/q;+1/p-1
| ChEMBL = 42403
| InChIKey = UKLNMMHNWFDKNT-REWHXWOFAT
⚫ | SMILES = .Cl=O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/BH3O3/c2-1(3)4/h2-4H | StdInChI = 1S/ClHO2.Na/c2-1-3;/h(H,2,3);/q;+1/p-1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KGBXLFKZBHKPEV-UHFFFAOYSA-N | StdInChIKey = UKLNMMHNWFDKNT-UHFFFAOYSA-M
| CASNo = 10043-35-3 | CASNo = 7758-19-2
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| RTECS = VZ4800000
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 33118 | UNNumber = 1496
⚫ | KEGG_Ref = {{keggcite|changed|kegg}}
⚫ | SMILES = OB(O)O
| KEGG = <!-- blanked - oldvalue: C19523 -->
⚫ | UNII_Ref = {{fdacite|correct|FDA}}
⚫ }}
⚫ | UNII = R57ZHV85D4
| Section2 = {{Chembox Properties
⚫ | KEGG_Ref = {{keggcite|correct|kegg}}
| Formula = NaClO<sub>2</sub>
| KEGG = D01089
| MolarMass = 90.44 g/mol
⚫ | InChI=1/BH3O3/c2-1(3)4/h2-4H
⚫ | Appearance = white solid
| InChIKey = KGBXLFKZBHKPEV-UHFFFAOYAI
⚫ | Density = 2.5 g/cm<sup>3</sup>, solid
| EINECS = 233-139-2
| Solubility = 39 g/100 ml (17 °C)
⚫ }}
| MeltingPt = 180–200 °C ''decomp.''
⚫ | Section2 = {{Chembox Properties
| H = 3 | B = 1 | O = 3
⚫ | Appearance = White crystalline solid
⚫ | Density = 1.435 g/cm<sup>3</sup>
| Solubility = 2.52 g/100 mL (0&nbsp;°C) <br> 4.72 g/100 mL (20&nbsp;°C) <br> 5.7 g/100 mL (25&nbsp;°C) <br> 19.10 g/100 mL (80&nbsp;°C) <br> 27.53 g/100 mL (100&nbsp;°C)
| SolubleOther = Soluble in lower ]s <br> moderately soluble in ] <br> very slightly soluble in ]
| Solvent = other solvents
| MeltingPtC = 170.9
| BoilingPtC = 300
| pKa = 9.24 (''see text'')
}} }}
| Section3 = {{Chembox Structure | Section3 = {{Chembox Structure
| MolShape = Trigonal planar | Coordination =
| Dipole = Zero | CrystalStruct =
}} }}
| Section7 = {{Chembox Hazards | Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUClass = Harmful ('''Xn''')<br/>Repr. Cat. 2
| RPhrases = {{R60}} {{R61}} | EUIndex = Not listed
| SPhrases = {{S53}} {{S45}}
| NFPA-H = 1 | NFPA-H = 1
| NFPA-F = 0 | NFPA-F = 0
| NFPA-R = 0 | NFPA-R = 1
| FlashPt = Non-flammable. | NFPA-O = OX
| FlashPt = Non-flammable
| LD50 = 2660 mg/kg, oral (rat)
}} }}
| Section8 = {{Chembox Related | Section8 = {{Chembox Related
| OtherAnions = ]<br />]<br />]<br />]
⚫ | OtherCpds = ]<br/>]}}
| OtherCations = ]<br />]
⚫ | OtherCpds = ]<br />]
}}
}} }}

Revision as of 12:38, 15 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 476256651 of page Sodium_chlorite with values updated to verified values.
Sodium chlorite
The sodium cation
The sodium cation
Space-filling model of the chlorite anion
Space-filling model of the chlorite anion
Names
IUPAC name Sodium chlorite
Other names Chlorous acid, sodium salt
Textone
Identifiers
CAS Number
3D model (JSmol)
ChemSpider
PubChem CID
RTECS number
  • VZ4800000
UNII
UN number 1496
InChI
  • InChI=1S/ClHO2.Na/c2-1-3;/h(H,2,3);/q;+1/p-1Key: UKLNMMHNWFDKNT-UHFFFAOYSA-M
  • InChI=1/ClHO2.Na/c2-1-3;/h(H,2,3);/q;+1/p-1Key: UKLNMMHNWFDKNT-REWHXWOFAT
SMILES
  • .Cl=O
Properties
Chemical formula NaClO2
Molar mass 90.44 g/mol
Appearance white solid
Density 2.5 g/cm, solid
Melting point 180–200 °C decomp.
Solubility in water 39 g/100 ml (17 °C)
Hazards
NFPA 704 (fire diamond)
NFPA 704 four-colored diamondHealth 1: Exposure would cause irritation but only minor residual injury. E.g. turpentineFlammability 0: Will not burn. E.g. waterInstability 1: Normally stable, but can become unstable at elevated temperatures and pressures. E.g. calciumSpecial hazard OX: Oxidizer. E.g. potassium perchlorate
1 0 1OX
Flash point Non-flammable
Related compounds
Other anions Sodium chloride
Sodium hypochlorite
Sodium chlorate
Sodium perchlorate
Other cations Potassium chlorite
Barium chlorite
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒N verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound