Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:38, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476256651 of page Sodium_chlorite for the Chem/Drugbox validation project (updated: 'KEGG').← Previous edit Revision as of 12:39, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 473571864 of page Meglumine_antimoniate for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 464400571 | verifiedrevid = 462102030
| IUPAC_name = Hydroxy-dioxostiborane; (2''R'',3''R'',4''R'',5''S'')-6-methylaminohexane-1,2,3,4,5-pentol
| Name = Sodium chlorite
| image = Meglumine antimoniate major component 3D.png
| ImageFileL1 = Na+.svg

| ImageSizeL1 = 50px
<!--Clinical data-->
| ImageFileR1 = Chlorition.png
| tradename =
| ImageSizeR1 = 100px
| Drugs.com = {{drugs.com|CONS|meglumine_antimoniate}}
| ImageFileL2 = Sodium-3D.png
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| ImageNameL2 = The sodium cation
| pregnancy_US = <!-- A / B / C / D / X -->
| ImageFileR2 = Chlorite-3D-vdW.png
| pregnancy_category =
| ImageSizeR2 = 120px
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| ImageNameR2 = Space-filling model of the chlorite anion
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| ImageFile3 = Sodium chlorite 450g.jpg
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| IUPACName = Sodium chlorite
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| OtherNames = Chlorous acid, sodium salt<br />Textone
| legal_status =
| Section1 = {{Chembox Identifiers
| routes_of_administration =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 22860
<!--Pharmacokinetic data-->
| PubChem = 24452
| bioavailability =
| UNII_Ref = {{fdacite|correct|FDA}}
| protein_bound =
| UNII = G538EBV4VF
| metabolism =
| InChI = 1/ClHO2.Na/c2-1-3;/h(H,2,3);/q;+1/p-1
| elimination_half-life =
| InChIKey = UKLNMMHNWFDKNT-REWHXWOFAT
| excretion =
| SMILES = .Cl=O

<!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = <!-- blanked - oldvalue: 133-51-7 -->
| ATC_prefix = P01
| ATC_suffix = CB01
| ATC_supplemental = {{ATCvet|P51|AB01}}
| PubChem = 64953
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 58479
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 239129
| NIAID_ChemDB = 008733

<!--Chemical data-->
| chemical_formula = Variable

| molecular_weight = Variable
| smiles = O=(=O)O.O((O)(O)(O)CNC)CO
| InChI = 1/C7H17NO5.H2O.2O.Sb/c1-8-2-4(10)6(12)7(13)5(11)3-9;;;;/h4-13H,2-3H2,1H3;1H2;;;/q;;;;+1/p-1/t4-,5+,6+,7+;;;;/m0..../s1/rC7H17NO5.HO3Sb/c1-8-2-4(10)6(12)7(13)5(11)3-9;1-4(2)3/h4-13H,2-3H2,1H3;(H,1,2,3)/t4-,5+,6+,7+;/m0./s1
| InChIKey = XOGYVDXPYVPAAQ-IZBHJHIBBT
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/ClHO2.Na/c2-1-3;/h(H,2,3);/q;+1/p-1 | StdInChI = 1S/C7H17NO5.H2O.2O.Sb/c1-8-2-4(10)6(12)7(13)5(11)3-9;;;;/h4-13H,2-3H2,1H3;1H2;;;/q;;;;+1/p-1/t4-,5+,6+,7+;;;;/m0..../s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UKLNMMHNWFDKNT-UHFFFAOYSA-M | StdInChIKey = XOGYVDXPYVPAAQ-SESJOKTNSA-M
| CASNo = 7758-19-2
| CASNo_Ref = {{cascite|correct|CAS}}
| RTECS = VZ4800000
| UNNumber = 1496
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = <!-- blanked - oldvalue: C19523 -->
}}
| Section2 = {{Chembox Properties
| Formula = NaClO<sub>2</sub>
| MolarMass = 90.44 g/mol
| Appearance = white solid
| Density = 2.5 g/cm<sup>3</sup>, solid
| Solubility = 39 g/100 ml (17 °C)
| MeltingPt = 180–200 °C ''decomp.''
}}
| Section3 = {{Chembox Structure
| Coordination =
| CrystalStruct =
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUIndex = Not listed
| NFPA-H = 1
| NFPA-F = 0
| NFPA-R = 1
| NFPA-O = OX
| FlashPt = Non-flammable
}}
| Section8 = {{Chembox Related
| OtherAnions = ]<br />]<br />]<br />]
| OtherCations = ]<br />]
| OtherCpds = ]<br />]
}}
}} }}

Revision as of 12:39, 15 February 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 473571864 of page Meglumine_antimoniate with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
AHFS/Drugs.comMicromedex Detailed Consumer Information
ATC code
Identifiers
IUPAC name
  • Hydroxy-dioxostiborane; (2R,3R,4R,5S)-6-methylaminohexane-1,2,3,4,5-pentol
PubChem CID
ChemSpider
ChEMBL
NIAID ChemDB
Chemical and physical data
FormulaVariable
Molar massVariable
3D model (JSmol)
SMILES
  • O=(=O)O.O((O)(O)(O)CNC)CO
InChI
  • InChI=1S/C7H17NO5.H2O.2O.Sb/c1-8-2-4(10)6(12)7(13)5(11)3-9;;;;/h4-13H,2-3H2,1H3;1H2;;;/q;;;;+1/p-1/t4-,5+,6+,7+;;;;/m0..../s1
  • Key:XOGYVDXPYVPAAQ-SESJOKTNSA-M
  (what is this?)  (verify)