Revision as of 12:38, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476256651 of page Sodium_chlorite for the Chem/Drugbox validation project (updated: 'KEGG').← Previous edit |
Revision as of 12:39, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 473571864 of page Meglumine_antimoniate for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 464400571 |
|
| verifiedrevid = 462102030 |
|
|
| IUPAC_name = Hydroxy-dioxostiborane; (2''R'',3''R'',4''R'',5''S'')-6-methylaminohexane-1,2,3,4,5-pentol |
|
| Name = Sodium chlorite |
|
|
|
| image = Meglumine antimoniate major component 3D.png |
|
| ImageFileL1 = Na+.svg |
|
|
|
|
|
| ImageSizeL1 = 50px |
|
|
|
<!--Clinical data--> |
|
| ImageFileR1 = Chlorition.png |
|
|
|
| tradename = |
|
| ImageSizeR1 = 100px |
|
|
|
| Drugs.com = {{drugs.com|CONS|meglumine_antimoniate}} |
|
| ImageFileL2 = Sodium-3D.png |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ImageNameL2 = The sodium cation |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ImageFileR2 = Chlorite-3D-vdW.png |
|
|
|
| pregnancy_category = |
|
| ImageSizeR2 = 120px |
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ImageNameR2 = Space-filling model of the chlorite anion |
|
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ImageFile3 = Sodium chlorite 450g.jpg |
|
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| IUPACName = Sodium chlorite |
|
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| OtherNames = Chlorous acid, sodium salt<br />Textone |
|
|
|
| legal_status = |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| routes_of_administration = |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
|
⚫ |
| ChemSpiderID = 22860 |
|
|
|
<!--Pharmacokinetic data--> |
⚫ |
| PubChem = 24452 |
|
|
|
| bioavailability = |
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| protein_bound = |
|
| UNII = G538EBV4VF |
|
|
|
| metabolism = |
|
| InChI = 1/ClHO2.Na/c2-1-3;/h(H,2,3);/q;+1/p-1 |
|
|
|
| elimination_half-life = |
|
| InChIKey = UKLNMMHNWFDKNT-REWHXWOFAT |
|
|
|
| excretion = |
|
| SMILES = .Cl=O |
|
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number_Ref = {{cascite|changed|??}} |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 133-51-7 --> |
|
|
| ATC_prefix = P01 |
|
|
| ATC_suffix = CB01 |
|
|
| ATC_supplemental = {{ATCvet|P51|AB01}} |
|
⚫ |
| PubChem = 64953 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 58479 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 239129 |
|
|
| NIAID_ChemDB = 008733 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| chemical_formula = Variable |
|
|
|
|
|
| molecular_weight = Variable |
|
|
| smiles = O=(=O)O.O((O)(O)(O)CNC)CO |
|
|
| InChI = 1/C7H17NO5.H2O.2O.Sb/c1-8-2-4(10)6(12)7(13)5(11)3-9;;;;/h4-13H,2-3H2,1H3;1H2;;;/q;;;;+1/p-1/t4-,5+,6+,7+;;;;/m0..../s1/rC7H17NO5.HO3Sb/c1-8-2-4(10)6(12)7(13)5(11)3-9;1-4(2)3/h4-13H,2-3H2,1H3;(H,1,2,3)/t4-,5+,6+,7+;/m0./s1 |
|
|
| InChIKey = XOGYVDXPYVPAAQ-IZBHJHIBBT |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/ClHO2.Na/c2-1-3;/h(H,2,3);/q;+1/p-1 |
|
| StdInChI = 1S/C7H17NO5.H2O.2O.Sb/c1-8-2-4(10)6(12)7(13)5(11)3-9;;;;/h4-13H,2-3H2,1H3;1H2;;;/q;;;;+1/p-1/t4-,5+,6+,7+;;;;/m0..../s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = UKLNMMHNWFDKNT-UHFFFAOYSA-M |
|
| StdInChIKey = XOGYVDXPYVPAAQ-SESJOKTNSA-M |
|
| CASNo = 7758-19-2 |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| RTECS = VZ4800000 |
|
|
| UNNumber = 1496 |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
⚫ |
| KEGG = <!-- blanked - oldvalue: C19523 --> |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = NaClO<sub>2</sub> |
|
|
| MolarMass = 90.44 g/mol |
|
|
| Appearance = white solid |
|
|
| Density = 2.5 g/cm<sup>3</sup>, solid |
|
|
| Solubility = 39 g/100 ml (17 °C) |
|
|
| MeltingPt = 180–200 °C ''decomp.'' |
|
|
}} |
|
|
| Section3 = {{Chembox Structure |
|
|
| Coordination = |
|
|
| CrystalStruct = |
|
|
}} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| ExternalMSDS = |
|
|
| EUIndex = Not listed |
|
|
| NFPA-H = 1 |
|
|
| NFPA-F = 0 |
|
|
| NFPA-R = 1 |
|
|
| NFPA-O = OX |
|
|
| FlashPt = Non-flammable |
|
|
}} |
|
|
| Section8 = {{Chembox Related |
|
|
| OtherAnions = ]<br />]<br />]<br />] |
|
|
| OtherCations = ]<br />] |
|
|
| OtherCpds = ]<br />] |
|
|
}} |
|
|
}} |
|
}} |