Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:39, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 475367158 of page Bromothymol_blue for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 12:39, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 475756380 of page Poly(methyl_methacrylate) for the Chem/Drugbox validation project (updated: 'KEGG').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| Verifiedfields = changed
| verifiedrevid = 450532577
| verifiedrevid = 458268585
|ImageFile=Bromothymol-blue-2D-skeletal.png
| ImageFile = PMMA repeating unit.svg
|ImageFile1=Bromothymol-blue-3D-balls.png
| ImageSize = 100px
|IUPACName=4,4'-(1,1-dioxido-3''H''-2,1-benzoxathiole-3,3-diyl)bis(2-bromo-6-isopropyl-3-methylphenol)
| IUPACName = Poly(methyl 2-methylpropenoate)
|OtherNames=
| SystematicName =
|Section1={{Chembox Identifiers
| OtherNames = Poly(methyl methacrylate) (PMMA)<br>methyl methacrylate resin
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| Section1 = {{Chembox Identifiers
| ChemSpiderID = 6208
| Abbreviations =
| UNII_Ref = {{fdacite|correct|FDA}}
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII = VGU4LM0H96
| CASNo = 9011-14-7
| InChI = 1/C27H28Br2O5S/c1-13(2)17-11-20(15(5)23(28)25(17)30)27(19-9-7-8-10-22(19)35(32,33)34-27)21-12-18(14(3)4)26(31)24(29)16(21)6/h7-14,30-31H,1-6H3
| EINECS =
| InChIKey = NUHCTOLBWMJMLX-UHFFFAOYAD
| EINECSCASNO =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| PubChem =
| StdInChI = 1S/C27H28Br2O5S/c1-13(2)17-11-20(15(5)23(28)25(17)30)27(19-9-7-8-10-22(19)35(32,33)34-27)21-12-18(14(3)4)26(31)24(29)16(21)6/h7-14,30-31H,1-6H3
| SMILES = C(C)C(=O)OC
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| StdInChIKey = NUHCTOLBWMJMLX-UHFFFAOYSA-N
| ChemSpiderID = NA
| CASNo=76-59-5
| InChI =
| CASNo_Ref = {{cascite|correct|CAS}}
| RTECS =
| PubChem=6450
| MeSHName =
| SMILES = Brc1c(O)c(cc(c1C)C3(OS(=O)(=O)c2ccccc23)c4cc(c(O)c(Br)c4C)C(C)C)C(C)C
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI =
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = <!-- blanked - oldvalue: C19504 -->
| ATCCode_prefix =
| ATCCode_suffix =
| ATC_Supplemental =}}
| Section2 = {{Chembox Properties
| Formula = (]<sub>5</sub>]<sub>2</sub>]<sub>8</sub>)<sub>''n''</sub>
| MolarMass = varies
| Appearance =
| Density = 1.18 g/cm<sup>3</sup><ref name=p1/>
| MeltingPt = {{convert|160|C|abbr=on}}<ref>{{harvnb|Smith|Hashemi|2006|p=509}}.</ref>
| Tg = {{convert|105|C|abbr=on}}
| Melting_notes =
| BoilingPt = {{convert|200.0|C|abbr=on}}{{Citation needed|date=February 2010}}
| Boiling_notes =
| Solubility =
| SolubleOther =
| Solvent = Chloroform (poor)
| LogP =
| VaporPressure =
| HenryConstant =
| Young's Modulus = 1.8–3.1 GPa
| AtmosphericOHRateConstant =
| pKa =
| pKb =
| RefractIndex = 1.4914 at 587.6 nm.<ref name=refr/>
}}
| Section4 = {{Chembox Thermochemistry
| DeltaHf =
| DeltaHc =
| Entropy =
| HeatCapacity =}}
| Section5 = {{Chembox Pharmacology
| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| PregCat =
| PregCat_AU =
| PregCat_US =
}}
| Section6 = {{Chembox Explosive
| ShockSens =
| FrictionSens =
| ExplosiveV =
| REFactor =
}}
| Section7 = {{Chembox Hazards
| EUClass =
| EUIndex =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-O =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt =
| Autoignition =
| ExploLimits =
| PEL =
}}
| Section8 = {{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunctn =
| Function =
| OtherCpds =
}} }}
|Section2={{Chembox Properties
|C=27|H=28|Br=2|O=5|S=1
| Appearance=
| Density=1.25 g/cm<sup>3</sup>
| MeltingPtC=202
| BoilingPt=
| Solubility=
| pKa = 7.10
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
}}
}} }}

Revision as of 12:39, 15 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 475756380 of page Poly(methyl_methacrylate) with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
IUPAC name Poly(methyl 2-methylpropenoate)
Other names Poly(methyl methacrylate) (PMMA)
methyl methacrylate resin
Identifiers
CAS Number
3D model (JSmol)
ChemSpider
SMILES
  • C(C)C(=O)OC
Properties
Chemical formula (C5O2H8)n
Molar mass varies
Density 1.18 g/cm
Melting point 160 °C (320 °F)
Boiling point 200.0 °C (392.0 °F)
Refractive index (nD) 1.4914 at 587.6 nm.
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒N verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
  1. Cite error: The named reference p1 was invoked but never defined (see the help page).
  2. Smith & Hashemi 2006, p. 509 harvnb error: no target: CITEREFSmithHashemi2006 (help).
  3. Cite error: The named reference refr was invoked but never defined (see the help page).