Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 13:49, 15 February 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476021513 of page Silicon_carbide for the Chem/Drugbox validation project (updated: '').← Previous edit		Revision as of 13:49, 15 February 2012 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 470790171 of page Acetone_peroxide for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~Chembox~~		{{chembox
		⚫	\| verifiedrevid = 453998664
	\| Watchedfields = changed
		⚫	\| ImageFile = acetone peroxide.png
⚫	\| verifiedrevid = ~~464363172~~
		⚫	\| ImageSize = 180px
⚫	\| ImageFile = ~~SiC~~ ~~p1390066~~.~~jpg~~
			\| ImageFileL2 = acetone-peroxide-trimer-3D-balls.png
⚫	\| ImageSize = ~~244~~
			\| ImageSizeL2 = 180px
	\| ImageName = Sample of silicon carbide as a boule
			\| ImageNameL2 = Acetone peroxide trimer
	\| PIN = Silicon carbide
			\| ImageFileR2 = acetone peroxide.jpg
	\| OtherNames = Carborundum <br />Moissanite
			\| ImageSizeR2 = 180px
			\| IUPACName = 3,3,6,6-Tetramethyl-1,2,4,5-tetraoxane<br>(dimer)<br>3,3,6,6,9,9-Hexamethyl-1,2,4,<br>5,7,8-hexaoxacyclononane<br>(trimer)
			\| OtherNames =
	\| Section1 = {{Chembox Identifiers		\| Section1 = {{Chembox Identifiers
		⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| CASNo = 409-21-2
		⚫	\| ChemSpiderID = 3582942
⚫	\| CASNo_Ref = {{cascite\|correct\|~~CAS~~}}
			\| InChI = 1/C9H18O6/c1-7(2)10-12-8(3,4)14-15-9(5,6)13-11-7/h1-6H3
	\| PubChem = 9863
			\| InChIKey = ZTLXICJMNFREPA-UHFFFAOYAS
	\| PubChem_Ref = {{Pubchemcite\|correct\|PubChem}}
			\| SMILES1 = CC1(OOC(OOC(OO1)(C)C)(C)C)C
⚫	\| ChemSpiderID = ~~9479~~
	\| ~~ChemSpiderID_Ref~~ = {{~~chemspidercite~~\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
			\| StdInChI = 1S/C9H18O6/c1-7(2)10-12-8(3,4)14-15-9(5,6)13-11-7/h1-6H3
	\| EINECS = 206-991-8
		⚫	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| MeSHName = Silicon+carbide
		⚫	\| StdInChIKey = ZTLXICJMNFREPA-UHFFFAOYSA-N
	\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
		⚫	\| CASNo_Ref = {{cascite\|correct\|??}}
	\| ChEBI = 29390
			\| CASNo = <!-- blanked - oldvalue: 17088-37-8 -->
	\| RTECS = VW0450000
	\| ~~SMILES~~ = #		\| PubChem = 536100
			\| SMILES = CC1(C)OOC(C)(C)OO1 (dimer)<br>CC1(C)OOC(C)(C)OOC(C)(C)OO1 (trimer)
⚫	\| ~~StdInChI_Ref~~ = {{~~stdinchicite~~\|correct\|chemspider}}
		⚫	}}
	\| StdInChI = 1S/CSi/c1-2
	\| InChI1 = 1/CSi/c1-2
⚫	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
⚫	\| StdInChIKey = ~~HBMJWWWQQXIZIP~~-UHFFFAOYSA-N
	\| InChIKey = HBMJWWWQQXIZIP-UHFFFAOYAF
	\| Gmelin = 13642
⚫	}}
	\| Section2 = {{Chembox Properties		\| Section2 = {{Chembox Properties
			\| Formula = C<sub>6</sub>H<sub>12</sub>O<sub>4</sub> (dimer)<br>C<sub>9</sub>H<sub>18</sub>O<sub>6</sub> (trimer)
	\| C = 1
			\| MolarMass = 148.157 g/mol (dimer)<br>222.24 g/mol (trimer)
	\| Si = 1
			\| Appearance = White crystalline solid
	\| ExactMass = {{val\|39.976926533}} g·mol<sup>−1</sup>
			\| Density =
	\| Appearance = Colorless crystals
		⚫	\| MeltingPtC = 91
	\| Density = 3.21 g·cm<sup>−3</sup> (all ])<ref>{{cite book\| author =Patnaik, P.\| title = Handbook of Inorganic Chemicals\| publisher =McGraw-Hill\| year =2002\| isbn =0070494398}}</ref>
			\| BoilingPt = 97–160 °C
⚫	\| MeltingPtC = ~~2730~~
			\| Solubility = insoluble
	\| Melting_notes = decomposes
		⚫	}}
	\| ElectronMobility = ~900 cm<sup>2</sup>/V·s (all polytypes)
		⚫	\| Section3 = {{Chembox Hazards
	\| RefractIndex = 2.55 (infrared; all polytypes)<ref name=ioffe/>
			\| MainHazards = Explosive
⚫	}}
			\| FlashPt =
⚫	\| ~~Section7~~ = {{Chembox Hazards
			\| Autoignition = }}
	\| EUClass = Not listed
			\| Section6 = {{Chembox Explosive
	\| NFPA-H = 1
			\| ShockSens = High / moderate when wet
	\| NFPA-F = 0
			\| FrictionSens = High / moderate when wet
	\| NFPA-R = 0
			\| ExplosiveV = 5300 ]<br>17,384 ft/s<br>3.29 miles per second
	}}
			\| REFactor = .83}}
	}}		}}

Revision as of 13:49, 15 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 470790171 of page Acetone_peroxide with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox

Names

IUPAC names 3,3,6,6-Tetramethyl-1,2,4,5-tetraoxane
(dimer)
3,3,6,6,9,9-Hexamethyl-1,2,4,
5,7,8-hexaoxacyclononane
(trimer)

Identifiers

3D model (JSmol)

ChemSpider

3582942

PubChem CID

536100

InChI

InChI=1S/C9H18O6/c1-7(2)10-12-8(3,4)14-15-9(5,6)13-11-7/h1-6H3Key: ZTLXICJMNFREPA-UHFFFAOYSA-N
InChI=1/C9H18O6/c1-7(2)10-12-8(3,4)14-15-9(5,6)13-11-7/h1-6H3Key: ZTLXICJMNFREPA-UHFFFAOYAS

SMILES