| Revision as of 13:50, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476333817 of page Ammonium_chloride for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit |
Revision as of 13:50, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 470767849 of page Ethacridine_lactate for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 464362661 |
|
|
|
| verifiedrevid = 461096190 |
|
| ImageFile = Ammonium chloride.jpg |
|
|
|
| IUPAC_name = 7-ethoxyacridine-3,9-diamine; 2-hydroxypropanoic acid |
|
| ImageFile1 = NH4Cl.png |
|
|
|
| image = Ethacridinlactat.svg |
|
| ImageSize = |
|
|
|
| alt = |
|
| IUPACName = Ammonium chloride |
|
|
|
|
|
| OtherNames = Sal ammoniac, salmiac, nushadir salt, sal armagnac, salt armoniack |
|
|
|
<!--Clinical data--> |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| tradename = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| Drugs.com = {{drugs.com|international|ethacridine-lactate}} |
|
| UNII = 01Q9PC255D |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
|
| CAS_number = <!-- blanked - oldvalue: 1837-57-6 --> |
|
|
| ATCvet = |
|
|
| ATC_prefix = B05 |
|
|
| ATC_suffix = CA08 |
|
|
| ATC_supplemental = {{ATC|D08|AA01}} |
|
|
| PubChem = 15789 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 15012 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D01139 |
|
| KEGG = D01248 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1200939 --> |
|
| ChEMBL = 582355 |
|
|
|
|
| InChI = 1/ClH.H3N/h1H;1H3 |
|
|
|
<!--Chemical data--> |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
|
| C=18 | H=21 | N=3 | O=4 |
|
| ChEBI = 31206 |
|
|
|
| molecular_weight = 343.37 |
|
| SMILES = . |
|
|
|
| smiles = O=C(O)C(O)C.O(c2ccc1nc3c(c(c1c2)N)ccc(c3)N)CC |
|
| InChIKey = NLXLAEXVIDQMFP-UHFFFAOYAI |
|
|
|
| InChI = 1/C15H15N3O.C3H6O3/c1-2-19-10-4-6-13-12(8-10)15(17)11-5-3-9(16)7-14(11)18-13;1-2(4)3(5)6/h3-8H,2,16H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6) |
|
|
| InChIKey = IYLLULUTZPKQBW-UHFFFAOYAM |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C15H15N3O.C3H6O3/c1-2-19-10-4-6-13-12(8-10)15(17)11-5-3-9(16)7-14(11)18-13;1-2(4)3(5)6/h3-8H,2,16H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6) |
|
| StdInChI = 1S/ClH.H3N/h1H;1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = NLXLAEXVIDQMFP-UHFFFAOYSA-N |
|
| StdInChIKey = IYLLULUTZPKQBW-UHFFFAOYSA-N |
|
| CASNo = 12125-02-9 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| PubChem = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID=23807 |
|
|
| RTECS = BP4550000 |
|
|
| EINECS = 235-186-4 |
|
|
| ATCCode_prefix = B05 |
|
|
| ATCCode_suffix = XA04 |
|
|
| ATC_Supplemental = {{ATC|G04|BA01}} |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = NH<sub>4</sub>Cl |
|
|
| MolarMass = 53.491 g/mol |
|
|
| Appearance = White solid <br> ] |
|
|
| Odor = odorless |
|
|
| Density = 1.5274 g/cm<sup>3</sup> |
|
|
| MeltingPt = 338 °C (decomposes) |
|
|
| Solubility = 297 g/L (0 °C) <br> 372 g/L (20 °C) <br> 773 g/L (100 °C) |
|
|
| SolubleOther = 6 g/L (19 °C) |
|
|
| Solvent = alcohol |
|
|
| RefractIndex = 1.642 |
|
|
| pKa = 9.245 |
|
|
}} |
|
|
| Section3 = {{Chembox Thermochemistry |
|
|
| DeltaHf = −314.55 kJ/mol<ref name="NIST">Solid state data from {{nist|name=Ammonium chloride |id=C12125029 |accessdate=2008-10-22 |mask=1F |units=SI}}</ref> |
|
|
| Entropy = 94.85 J K<sup>−1</sup> mol<sup>−1</sup> <ref name="NIST" /> |
|
|
}} |
|
|
| Section4 = {{Chembox Hazards |
|
|
| GHSPictograms = {{GHSp|GHS07}}<ref name="sigma">{{SigmaLink |
|
|
| Productgroup = Fluka |
|
|
| Productcode = 09718 |
|
|
| Accessdate = June 16, 2011 |
|
|
}}</ref> |
|
|
| HPhrases = {{H-phrases|302|319}}<ref name="sigma" /> |
|
|
| PPhrases = {{P-phrases|305+351+338}}<ref name="sigma" /> |
|
|
| ExternalMSDS = |
|
|
| EUClass = Harmful ('''Xn''')<br/>Irritant ('''Xi''') |
|
|
| EUIndex = 017-014-00-8 |
|
|
| RPhrases = {{R22}}, {{R36}} |
|
|
| SPhrases = {{S2}}, {{S22}} |
|
|
| NFPA-H = 1 |
|
|
| NFPA-F = 0 |
|
|
| NFPA-R = 0 |
|
|
| NFPA-O = |
|
|
| FlashPt = Non-flammable |
|
|
| LD50 = 1650 mg/kg, oral (rat) |
|
|
}} |
|
|
| Section8 = {{Chembox Related |
|
|
| OtherAnions = ]<br/>]<br/>] |
|
|
| OtherCations = ]<br/>]<br/>] |
|
|
}} |
|
|
}} |
|
}} |
