Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 15:40, 16 February 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 465714095 of page 2,3-Dihydroxybenzoic_acid for the Chem/Drugbox validation project (updated: '').← Previous edit		Revision as of 15:40, 16 February 2012 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 477191045 of page Ethyl_oleate for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{chembox		{{chembox
	\| Watchedfields = changed		\| Watchedfields = changed
	\| verifiedrevid = ~~443646723~~		\| verifiedrevid = 443800502
	\| ImageFile = ~~2,3-Dihydroxybenzoesäure~~.~~svg\|150px~~		\| ImageFile = Ethyl oleate.png
	\| ImageSize = ~~150px~~		\| ImageSize = 250px
	\| IUPACName = ~~2,3-Dihydroxybenzoic~~ ~~acid~~		\| IUPACName = Ethyl (''Z'')-octadec-9-enoate
	\| OtherNames = ~~2,3-DHBA<br>2,3-DHB<br>2-pyrocatechuic~~ acid~~<br>o-pyrocatechuic~~ ~~acid~~		\| OtherNames = Oleic acid ethyl ester
	\| Section1 = {{Chembox Identifiers		\| Section1 = {{Chembox Identifiers
⚫	\| ChemSpiderID = 18
⚫	\| PubChem = 19
⚫	\| KEGG_Ref = {{keggcite\|correct\|kegg}}
⚫	\| KEGG = ~~C00196~~
	\| InChI = 1/C7H6O4/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,8-9H,(H,10,11)
	\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
	\| DrugBank = DB01672
⚫	\| SMILES = O=C(O)~~c1cccc(O)c1O~~
	\| InChIKey = GLDQAMYCGOIJDV-UHFFFAOYAE
	\| SMILES1 = c1cc(c(c(c1)O)O)C(=O)O
⚫	\| ~~ChEMBL_Ref~~ = {{~~ebicite~~\|correct\|~~EBI~~}}
	\| ChEMBL = 1432
⚫	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/C7H6O4/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,8-9H,(H,10,11)
⚫	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
⚫	\| StdInChIKey = ~~GLDQAMYCGOIJDV~~-~~UHFFFAOYSA~~-N
⚫	\| CASNo_Ref = {{cascite\|correct\|CAS}}
⚫	\| CASNo = ~~303~~-38-~~8 }}~~
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}		\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
		⚫	\| ChemSpiderID = 4515636
	\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
		⚫	\| UNII_Ref = {{fdacite\|correct\|FDA}}
	\| ChEBI = 18026
			\| UNII = Z2Z439864Y
		⚫	\| KEGG_Ref = {{keggcite\|correct\|kegg}}
		⚫	\| KEGG = D04090
			\| InChI = 1/C20H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h11-12H,3-10,13-19H2,1-2H3/b12-11-
			\| InChIKey = LVGKNOAMLMIIKO-QXMHVHEDBH
		⚫	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
			\| StdInChI = 1S/C20H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h11-12H,3-10,13-19H2,1-2H3/b12-11-
		⚫	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
		⚫	\| StdInChIKey = LVGKNOAMLMIIKO-QXMHVHEDSA-N
		⚫	\| CASNo_Ref = {{cascite\|correct\|CAS}}
		⚫	\| CASNo = 111-62-6
		⚫	\| PubChem = 5363269
		⚫	\| SMILES = O=C(OCC)CCCCCCC\C=C/CCCCCCCC
			}}
	\| Section2 = {{Chembox Properties		\| Section2 = {{Chembox Properties
	\| C=7 \| H=6 \| O=4		\| C=20\|H=38\|O=2
	\| ~~ExactMass~~ = ~~154~~.~~026609~~ u		\| MolarMass = 310.51 g/mol
	\| Appearance = Colorless ~~solid~~		\| Appearance = Colorless to light yellow liquid
	\| ~~MeltingPt~~ = ~~204–206 °C~~		\| Density = 0.87 g/cm³
	\| ~~BoilingPt~~ =		\| MeltingPtC = -32
	\| ~~Solubility~~ = ~~low~~		\| BoilingPtC = 210
			\| Solubility = Insoluble
	}}		}}
	\| ~~Section7~~ = {{Chembox Hazards		\| Section3 = {{Chembox Hazards
	\| ~~NFPA-H~~ =		\| MainHazards =
	\| NFPA-F =
	\| NFPA-R =
	\| NFPA-O =
	\| FlashPt =		\| FlashPt =
			\| Autoignition =
	}}		}}
	}}		}}

Revision as of 15:40, 16 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 477191045 of page Ethyl_oleate with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names

IUPAC name Ethyl (Z)-octadec-9-enoate
Other names Oleic acid ethyl ester
Identifiers
CAS Number	111-62-6
3D model (JSmol)	Interactive image
ChemSpider	4515636
KEGG	D04090
PubChem CID	5363269
UNII	Z2Z439864Y
InChI InChI=1S/C20H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h11-12H,3-10,13-19H2,1-2H3/b12-11-Key: LVGKNOAMLMIIKO-QXMHVHEDSA-N InChI=1/C20H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h11-12H,3-10,13-19H2,1-2H3/b12-11-Key: LVGKNOAMLMIIKO-QXMHVHEDBH
SMILES O=C(OCC)CCCCCCC\C=C/CCCCCCCC
Properties
Chemical formula	C₂₀H₃₈O₂
Molar mass	310.51 g/mol
Appearance	Colorless to light yellow liquid
Density	0.87 g/cm³
Melting point	−32 °C (−26 °F; 241 K)
Boiling point	210 °C (410 °F; 483 K)
Solubility in water	Insoluble
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Y verify (what is ?) Infobox references

Tracking categories (test):

SizeSet

Chemical compound