Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 15:44, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 471731941 of page 1-Naphthaleneacetic_acid for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 15:44, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 457643844 of page 1-Ethyl-3-methylimidazolium_chloride for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{Chembox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 457306408 | verifiedrevid = 457642749
| ImageFile = 1-ethyl-3-methylimidazolium chloride.png
| Name = 1-Naphthaleneacetic acid
| ImageSize = 150px
| ImageFile = Kwas_naftylooctowy.svg
| ImageSize = 200px | ImageAlt =
| IUPACName = 3-Ethyl-1-methyl-3''H''-imidazol-1-ium chloride
| ImageName = 1-Naphthaleneacetic acid
| OtherNames = Cl
| IUPACName = 2-(1-Naphthyl)acetic acid
| OtherNames = 1-Naphthaleneacetic acid<br/>α-Naphthaleneacetic acid<br />Naphthylacetic acid<br />NAA
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChEBI_Ref = {{ebicite|correct|EBI}}
| DrugBank = DB01750
⚫ | ChEBI = 61326
| SMILES = O=C(O)Cc2cccc1ccccc12
⚫ | ChemSpiderID = 151883
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| InChI = 1/C6H11N2/c1-3-8-5-4-7(2)6-8/h4-6H,3H2,1-2H3/q+1
⚫ | ChEBI_Ref = {{ebicite|changed|EBI}}
| InChIKey = NJMWOUFKYKNWDW-UHFFFAOYAA
⚫ | ChEBI = 32918
| SMILES1 = CCn1cc(c1)C
⚫ | ChemSpiderID = 6601
| KEGG_Ref = {{keggcite|correct|kegg}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C6H11N2/c1-3-8-5-4-7(2)6-8/h4-6H,3H2,1-2H3/q+1
| KEGG = D01558
⚫ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChI = 1/C12H10O2/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H,13,14)
⚫ | StdInChIKey = NJMWOUFKYKNWDW-UHFFFAOYSA-N
| InChIKey = PRPINYUDVPFIRX-UHFFFAOYAF
| ChEMBL_Ref = {{ebicite|changed|EBI}} | CASNo_Ref = {{cascite|changed|??}}
| CASNo = <!-- blanked - oldvalue: 65039-09-0 -->
| ChEMBL = 428495
⚫ | PubChem =
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| SMILES = CCN1C=C(C)=C1.}}
| StdInChI = 1S/C12H10O2/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H,13,14)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
⚫ | StdInChIKey = PRPINYUDVPFIRX-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
⚫ | PubChem = 6862
| CASNo = 86-87-3
| References = <ref></ref>
| RTECS =
}}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| C=6 | H=11 | N=2 | Cl=1
| Formula = C<sub>12</sub>H<sub>10</sub>O<sub>2</sub>
| Appearance =
| MolarMass = 186.2066 g/mol
| Appearance = White powder | Density =
| Density = | MeltingPt = 77-79 °C
⚫ | BoilingPt =
| Solubility = 0.38 g/L (17 °C)
| MeltingPt = 135 °C | Solubility = }}
⚫ | Section3 = {{Chembox Hazards
⚫ | BoilingPt =
⚫ | MainHazards =
| pKa = 4.24 (25 °C)<ref>''J. Chem. Soc.'' (1954) 4102</ref>
| Viscosity = | FlashPt =
| Autoignition = }}
}}
| Section3 = {{Chembox Structure
| MolShape =
| Dipole =
}}
⚫ | Section7 = {{Chembox Hazards
| ExternalMSDS =
⚫ | MainHazards =
| FlashPt =
| RPhrases =
| SPhrases =
}}
| Section8 = {{Chembox Related
| OtherAnions =
| OtherCations =
| Function = ]s
| OtherFunctn = ]
| OtherCpds =
}}
}} }}

Revision as of 15:44, 16 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 457643844 of page 1-Ethyl-3-methylimidazolium_chloride with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
IUPAC name 3-Ethyl-1-methyl-3H-imidazol-1-ium chloride
Other names Cl
Identifiers
3D model (JSmol)
ChEBI
ChemSpider
InChI
  • InChI=1S/C6H11N2/c1-3-8-5-4-7(2)6-8/h4-6H,3H2,1-2H3/q+1Key: NJMWOUFKYKNWDW-UHFFFAOYSA-N
  • InChI=1/C6H11N2/c1-3-8-5-4-7(2)6-8/h4-6H,3H2,1-2H3/q+1Key: NJMWOUFKYKNWDW-UHFFFAOYAA
SMILES
  • CCN1C=C(C)=C1.
  • CCn1cc(c1)C
Properties
Chemical formula C6H11ClN2
Molar mass 146.62 g·mol
Melting point 77-79 °C
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒N verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound