Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 16:17, 16 February 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 469476188 of page 1,2-Ethanedithiol for the Chem/Drugbox validation project (updated: '').← Previous edit		Revision as of 16:18, 16 February 2012 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 475787999 of page 1,2-Naphthoquinone for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{chembox		{{chembox
			\| Verifiedfields = changed
	\| verifiedrevid = ~~443340448~~		\| verifiedrevid = 456362167
	\| Name = 1,2-Ethanedithiol
	\| ~~ImageFile~~ = ~~Ethanedithiol.png~~		\| Name = 1,2-Naphthoquinone
			\| ImageFile = 1,2-naphthoquinone.svg
	\| ImageSize = 150px
	\| ~~ImageName~~ = ~~1,2-Ethanedithiol~~		\| ImageSize = 200px
	\| ~~ImageFile1~~ = ~~Ethane-~~1,2-~~dithiol-3D-balls.png~~		\| ImageName = 1,2-Naphthoquinone
			\| OtherNames = ''o''-Naphthoquinone,<br /> β-naphthoquinone
	\| ImageSize1 = 150px
	\| ImageName1 = Ball-and-stick model of ethane-1,2-dithiol
	\| ImageFile2 = Ethane-1,2-dithiol-3D-vdW.png
	\| ImageSize2 = 150px
	\| ImageName2 = Space-filling model of ethane-1,2-dithiol
	\| IUPACName = Ethane-1,2-dithiol
	\| OtherNames = Dimercaptoethane<br />1,2-Ethanedithiol
	\| Section1 = {{Chembox Identifiers		\| Section1 = {{Chembox Identifiers
			\| SMILES = O=C1c2ccccc2\C=C/C1=O
⚫	\| ~~UNII_Ref~~ = {{~~fdacite~~\|correct\|~~FDA~~}}
			\| ChemSpider = 10217
	\| UNII = 92T634FLAR
	\| SMILES = SCCS
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}		\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ChemSpiderID = ~~13865015~~		\| ChemSpiderID = 10217
			\| PubChem = 10667
	\| InChI = 1/C2H6S2/c3-1-2-4/h3-4H,1-2H2
		⚫	\| KEGG_Ref = {{keggcite\|correct\|kegg}}
	\| InChIKey = VYMPLPIFKRHAAC-UHFFFAOYAA
			\| KEGG = C14783
			\| InChI = 1/C10H6O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H
			\| InChIKey = KETQAJRQOHHATG-UHFFFAOYAZ
			\| ChEMBL_Ref = {{ebicite\|changed\|EBI}}
			\| ChEMBL = 52347
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/~~C2H6S2~~/c3-1-2-4~~/h3~~-~~4H,1~~-~~2H2~~		\| StdInChI = 1S/C10H6O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~VYMPLPIFKRHAAC~~-UHFFFAOYSA-N		\| StdInChIKey = KETQAJRQOHHATG-UHFFFAOYSA-N
	\| CASNo_Ref = {{cascite\|correct\|CAS}}		\| CASNo_Ref = {{cascite\|correct\|CAS}}
	\| CASNo = ~~540~~-63-6		\| CASNo = 524-42-5
	\| RTECS = ~~KI3325000~~		\| RTECS =
	}}		}}
	\| Section2 = {{Chembox Properties		\| Section2 = {{Chembox Properties
			\| Formula = C<sub>10</sub>H<sub>6</sub>O<sub>2</sub>
	\| C=2\|H=6\|S=2
	\| Appearance = Colorless liquid
	\| Density = 1.123 g/cm³
	\| Solubility = Slightly sol
	\| Solvent = other solvents
	\| SolubleOther = Good solubility in<br />most organic solvents
	\| MeltingPtC = -41
	\| BoilingPtC = 146
	\| Boiling_notes = 46 mmHg
	\| pKa = ~11
	\| pKb =
	\| Viscosity =
	\| RefractIndex = 1.5589 (D-line, 25 °C)
	}}
	\| Section3 = {{Chembox Structure
	\| Dipole =
	}}
	\| Section7 = {{Chembox Hazards
	\| ExternalMSDS =
	\| EUClass = Toxic ('''T''')
	\| NFPA-H = 2
	\| NFPA-F = 2
	\| NFPA-R =
	\| FlashPt = 50 °C
	\| RPhrases = {{R10}} {{R22}}
	\| SPhrases = {{S16}}
	}}
	\| Section8 = {{Chembox Related
	\| Function = ]s
	\| OtherFunctn = ]; ]; ]; ]
	}}		}}
	}}		}}

Revision as of 16:18, 16 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 475787999 of page 1,2-Naphthoquinone with values updated to verified values.

1,2-Naphthoquinone
Names

Other names o-Naphthoquinone, β-naphthoquinone
Identifiers
CAS Number	524-42-5
3D model (JSmol)	Interactive image
ChEMBL	ChEMBL52347
ChemSpider	10217
KEGG	C14783
PubChem CID	10667
InChI InChI=1S/C10H6O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6HKey: KETQAJRQOHHATG-UHFFFAOYSA-N InChI=1/C10H6O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6HKey: KETQAJRQOHHATG-UHFFFAOYAZ
SMILES O=C1c2ccccc2\C=C/C1=O
Properties
Chemical formula	C₁₀H₆O₂
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references

Tracking categories (test):

SizeSet

Chemical compound