| Revision as of 17:06, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 470106376 of page 2,5-Dimethoxy-4-chloroamphetamine for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 17:07, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447757439 of page 2,5-Dimethoxy-4-ethoxyamphetamine for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 407451900 |
|
| verifiedrevid = 417166069 |
|
| IUPAC_name = 1-(4-chloro-2,5-dimethoxy-phenyl)propan-2-amine |
|
| IUPAC_name = 1-propan-2-amine |
|
| image = 4-chloro-2,5-dimethoxyamphetamine.svg |
|
| image = MEM.png |
|
| width = 230px |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
|
| pregnancy_category = |
|
| legal_AU = Unscheduled |
|
|
| legal_CA = Schedule III |
|
| legal_status = |
|
|
| routes_of_administration = |
|
| legal_UK = Class A |
|
|
|
|
|
| legal_US = Unscheduled |
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 16128-88-4 --> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
|
| ATC_prefix = |
| ⚫ |
| CAS_number = <!-- blanked - oldvalue: 123431-31-2 --> |
|
|
| PubChem = 542036 |
|
| ATC_suffix = |
|
|
| PubChem = 542053 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 472008 |
|
| ChemSpiderID = 472023 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 8100 |
|
| ChEMBL = 8225 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
|
| chemical_formula = C<sub>13</sub>H<sub>21</sub>NO<sub>3</sub> |
|
| C=11 | H=16 | Cl=1 | N=1 | O=2 |
|
|
|
|
|
| molecular_weight = 229.70 g/mol |
|
| molecular_weight = 239.31 g/mol |
|
| smiles = Clc1cc(OC)c(cc1OC)CC(N)C |
|
| smiles = O(c1cc(OC)c(cc1OC)CC(N)C)CC |
|
| InChI = 1/C11H16ClNO2/c1-7(13)4-8-5-11(15-3)9(12)6-10(8)14-2/h5-7H,4,13H2,1-3H3 |
|
| InChI = 1/C13H21NO3/c1-5-17-13-8-11(15-3)10(6-9(2)14)7-12(13)16-4/h7-9H,5-6,14H2,1-4H3 |
|
| InChIKey = ACRITBNCBMTINK-UHFFFAOYAQ |
|
|
|
| InChIKey = ITZLAXJQDMGDEO-UHFFFAOYAC |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C11H16ClNO2/c1-7(13)4-8-5-11(15-3)9(12)6-10(8)14-2/h5-7H,4,13H2,1-3H3 |
|
| StdInChI = 1S/C13H21NO3/c1-5-17-13-8-11(15-3)10(6-9(2)14)7-12(13)16-4/h7-9H,5-6,14H2,1-4H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ACRITBNCBMTINK-UHFFFAOYSA-N |
|
| StdInChIKey = ITZLAXJQDMGDEO-UHFFFAOYSA-N |
|
| synonyms = 2,5-dimethoxy-4-chloroamphetamine |
|
|
}} |
|
}} |
