Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 17:16, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444028803 of page 2-Chloroethanol for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 17:16, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444962246 of page 2-Chlorophenol for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| verifiedrevid = 443345388 | verifiedrevid = 444961058
| Name = 2-Chloroethanol | Name = 2-Chlorophenol
| Reference = <ref name="hand">
| ImageFile = 2-chloroethanol-skeletal-nu.png
{{Citation
<!-- | ImageSize = 150px -->
| last = Lide
| ImageFile1 = 2-chloroethanol-3D-balls.png
| first = David R.
<!-- | ImageSize1 = 150px -->
| author-link =
| IUPACName = 2-Chloroethanol
| last2 =
| OtherNames = 2-chloroethyl alcohol, ethylene chlorohydrin, glycol chlorohydrin, 2-chloro-1-ethanol, 2-monochloroethanol, 2-hydroxyethyl chloride, β-chloroethanol, β-hydroxyethyl chloride, chloroethanol, δ-chloroethanol, ethylchlorhydrin, ethylene chlorohydrin, glycol monochlorohydrin
| first2 =
| author2-link =
| publication-date =
| date =
| year = 1998
| title = Handbook of Chemistry and Physics
| edition = 87
| volume =
| series =
| publication-place = Boca Raton, FL
| place =
| publisher = CRC Press
| id =
| isbn = 0-8493-0594-2
| doi =
| oclc =
| pages = 3–120
| url =
| accessdate =
| postscript = <!--none-->
}}</ref><ref name="hand2">
{{Citation
| last = Lide
| first = David R.
| author-link =
| last2 =
| first2 =
| author2-link =
| publication-date =
| date =
| year = 1998
| title = Handbook of Chemistry and Physics
| edition = 87
| volume =
| series =
| publication-place = Boca Raton, FL
| place =
| publisher = CRC Press
| id =
| isbn = 0-8493-0594-2
| doi =
| oclc =
| pages = 1281
| url =
| accessdate =
| postscript = <!--none-->
}}</ref><ref name="hand3">
{{Citation
| last = Lide
| first = David R.
| author-link =
| last2 =
| first2 =
| author2-link =
| publication-date =
| date =
| year = 1998
| title = Handbook of Chemistry and Physics
| edition = 87
| volume =
| series =
| publication-place = Boca Raton, FL
| place =
| publisher = CRC Press
| id =
| isbn = 0-8493-0594-2
| doi =
| oclc =
| pages = 8–103
| url =
| accessdate =
| postscript = <!--none-->
}}</ref><ref name="hand4">
{{Citation
| last = Lide
| first = David R.
| author-link =
| last2 =
| first2 =
| author2-link =
| publication-date =
| date =
| year = 1998
| title = Handbook of Chemistry and Physics
| edition = 87
| volume =
| series =
| publication-place = Boca Raton, FL
| place =
| publisher = CRC Press
| id =
| isbn = 0-8493-0594-2
| doi =
| oclc =
| pages = 15–18
| url =
| accessdate =
| postscript = <!--none-->
}}</ref>
| ImageFileL1 = 2-Chlorphenol.svg
| ImageSizeL1 = 120px
| ImageNameL1 = 2-Chlorophenol
| ImageFileR1 = 2-chlorophenol.png
| ImageSizeR1 = 120px
| ImageNameR1 = 2-Chlorophenol
| IUPACName = 2-Chlorophenol
| OtherNames = 2-Hydroxychlorobenzene, ''o''-Chlorophenol
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 47083
| ChemSpiderID = 21106015
| KEGG_Ref = {{keggcite|correct|kegg}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| KEGG = C06753 | DrugBank = DB03110
| SMILES = Oc1ccccc1Cl
| InChI = 1/C2H5ClO/c3-1-2-4/h4H,1-2H2
| KEGG_Ref = {{keggcite|correct|kegg}}
| InChIKey = SZIFAVKTNFCBPC-UHFFFAOYAF
| KEGG = C14219
| InChI = 1/C6H5ClO/c7-5-3-1-2-4-6(5)8/h1-4,8H
| InChIKey = ISPYQTSUDJAMAB-UHFFFAOYAM
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 191244 | ChEMBL = 108877
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C2H5ClO/c3-1-2-4/h4H,1-2H2 | StdInChI = 1S/C6H5ClO/c7-5-3-1-2-4-6(5)8/h1-4,8H
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = SZIFAVKTNFCBPC-UHFFFAOYSA-N | StdInChIKey = ISPYQTSUDJAMAB-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 107-07-3 | CASNo = 95-57-8
| CASNo_valid = yes
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChEBI = 28200
| ChemSpiderID = 13837686
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 753N66IHAN
| SMILES = ClCCO
}} }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = C<sub>2</sub>H<sub>5</sub>ClO | Formula = C<sub>6</sub>H<sub>5</sub>ClO
| MolarMass = 80.52 g/mol | MolarMass = 128.56 g/mol
| Density = 1.197 g/cm³ | Appearance = Light amber, liquid
| MeltingPt = -67 °C | Density = 1.2634 g/cm<sup>3</sup> at 20 °C
| BoilingPt = 128-130 °C | Solubility = 20 g/L at 20 °C
| SolubleOther = soluble in ], ], ]
| MeltingPt = 9.4 °C
| BoilingPt = 174.9 °C
| pKa = 8.56
| VaporPressure = 0.308 kPa
}}
| Section4 = {{Chembox Thermochemistry
| DeltaHf =
| DeltaHc =
| Entropy =
| HeatCapacity = 1.468 J·g<sup>-1</sup>·K<sup>-1</sup>
}}
| Section7 = {{Chembox Hazards
| Autoignition = 550 °C
| ExternalMSDS =
| MainHazards = Corrosive - causes burns
| FlashPt = 64°C
}} }}
| Section8 = {{Chembox Related | Section8 = {{Chembox Related
| Function = ]
| OtherCpds = ]
| OtherFunctn = ]<br />]<br />]
}} }}
}} }}

Revision as of 17:16, 16 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 444962246 of page 2-Chlorophenol with values updated to verified values.
2-Chlorophenol
2-Chlorophenol
2-Chlorophenol
2-Chlorophenol
2-Chlorophenol
Names
IUPAC name 2-Chlorophenol
Other names 2-Hydroxychlorobenzene, o-Chlorophenol
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChEMBL
ChemSpider
DrugBank
KEGG
InChI
  • InChI=1S/C6H5ClO/c7-5-3-1-2-4-6(5)8/h1-4,8HKey: ISPYQTSUDJAMAB-UHFFFAOYSA-N
  • InChI=1/C6H5ClO/c7-5-3-1-2-4-6(5)8/h1-4,8HKey: ISPYQTSUDJAMAB-UHFFFAOYAM
SMILES
  • Oc1ccccc1Cl
Properties
Chemical formula C6H5ClO
Molar mass 128.56 g/mol
Appearance Light amber, liquid
Density 1.2634 g/cm at 20 °C
Melting point 9.4 °C
Boiling point 174.9 °C
Solubility in water 20 g/L at 20 °C
Solubility soluble in ethanol, diethyl ether, benzene
Vapor pressure 0.308 kPa
Acidity (pKa) 8.56
Thermochemistry
Heat capacity (C) 1.468 J·g·K
Hazards
Occupational safety and health (OHS/OSH):
Main hazards Corrosive - causes burns
Flash point 64°C
Related compounds
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
  1. Lide, David R. (1998), Handbook of Chemistry and Physics (87 ed.), Boca Raton, FL: CRC Press, pp. 3–120, ISBN 0-8493-0594-2
  2. Lide, David R. (1998), Handbook of Chemistry and Physics (87 ed.), Boca Raton, FL: CRC Press, p. 1281, ISBN 0-8493-0594-2
  3. Lide, David R. (1998), Handbook of Chemistry and Physics (87 ed.), Boca Raton, FL: CRC Press, pp. 8–103, ISBN 0-8493-0594-2
  4. Lide, David R. (1998), Handbook of Chemistry and Physics (87 ed.), Boca Raton, FL: CRC Press, pp. 15–18, ISBN 0-8493-0594-2