Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 19:47, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 466518519 of page Acenaphthoquinone for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 19:47, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 466404541 of page Acenaphthylene for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| verifiedrevid = 413290805 | verifiedrevid = 443364366
| Name = Acenaphthylene
| ImageFile_Ref = {{chemboximage|correct|??}} | ImageFileL1_Ref = {{chemboximage|correct|??}}
| ImageFile = Acenaphthoquinone.png
| ImageFileL1 = Acenaphthylene.svg
| ImageSize = 140px
| ImageSizeL1 = 120px
| ImageAlt = Skeletal formula | ImageAltL1 = Skeletal formula
| ImageFile1 = Acenaphthoquinone-3D-balls.png
| ImageFileR1 = Acenaphthylene-3D-spacefill.png
| ImageSize1 = 160
| ImageSizeR1 = 120px
| ImageAlt1 = Ball-and-stick model
| ImageAltR1 = Space-filling model
| IUPACName = Acenaphthoquinone | IUPACName = acenaphthylene
| OtherNames = Acenaphthenequinone, 1,2-Acenaphthenequinone, Acenaphthenedione, 1,2-Acenaphthylenedione, Acenaphthene-1,2-dione, 1,2-Diketoacenaphthene
| OtherNames = Cycopenta(de)naphthalene, Acenaphthalene
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 33081
| SMILES = c3cc1cccc2\C=C/c(c12)c3
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 6468 | ChemSpiderID = 8807
| UNII_Ref = {{fdacite|correct|FDA}}
| InChIKey = AFPRJLBZLPBTPZ-UHFFFAOYAC
| UNII = 1Z25C36811
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| InChI = 1/C12H8/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-8H
| ChEMBL = 395653
| InChIKey = HXGDTGSAIMULJN-UHFFFAOYAQ
| SMILES1 = c1cc2cccc3c2c(c1)C=C3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H6O2/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(11)14/h1-6H | StdInChI = 1S/C12H8/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-8H
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = AFPRJLBZLPBTPZ-UHFFFAOYSA-N | StdInChIKey = HXGDTGSAIMULJN-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 82-86-0 | CASNo = 208-96-8
| EINECS = 201-441-3 | PubChem = 9161
| PubChem = 6724 | RTECS =
| SMILES = O=C3c2cccc1cccc(c12)C3=O
| InChI = 1/C12H6O2/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(11)14/h1-6H
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 15342
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C02807
}} }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
|C=12|H=6|O=2 |C=12|H=8
| Appearance = Purple-yellow crystals to brown powder | Appearance = Yellow crystalline powder
| Density = | Density = 0.8987 g cm<sup>-3</sup>
| Solubility = Insoluble
| MeltingPt = 257 – 261 °C (530 – 534 K)
| Solubility1 = very soluble
| BoilingPt =
| Solvent1 = ethanol
| Solubility = Insoluble (90.1 mg/l)
| Solubility2 = very soluble
| Solvent2 = diethyl ether
| Solubility3 = very soluble
| Solvent3 = benzene
| Solubility4 = soluble
| Solvent4 = chloroform
| MeltingPtC = 91.8
| BoilingPtC = 280
}}
| Section3 = {{Chembox Structure
| CrystalStruct =
| Dipole =
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| MainHazards =
| FlashPt = ?°C
| RPhrases = {{R22}} {{R36}} {{R37}} {{R38}}
| SPhrases = {{S26}} {{S36}} {{S37}} {{S39}}
}} }}
| Section3 = {{Chembox Hazards | Section8 = {{Chembox Related
| MainHazards = Irritating | OtherCpds = ]
| FlashPt =
| Autoignition =
| NFPA-H = 2
| NFPA-F = 0
| NFPA-R = 0
| NFPA-O =
| RPhrases = {{R36/37/38}}
| SPhrases = {{S26}}, {{S37/39}}
}} }}
}} }}

Revision as of 19:47, 16 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 466404541 of page Acenaphthylene with values updated to verified values.
Acenaphthylene
Skeletal formula
Space-filling model
Names
IUPAC name acenaphthylene
Other names Cycopenta(de)naphthalene, Acenaphthalene
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChemSpider
PubChem CID
UNII
InChI
  • InChI=1S/C12H8/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-8HKey: HXGDTGSAIMULJN-UHFFFAOYSA-N
  • InChI=1/C12H8/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-8HKey: HXGDTGSAIMULJN-UHFFFAOYAQ
SMILES
  • c3cc1cccc2\C=C/c(c12)c3
  • c1cc2cccc3c2c(c1)C=C3
Properties
Chemical formula C12H8
Molar mass 152.196 g·mol
Appearance Yellow crystalline powder
Density 0.8987 g cm
Melting point 91.8 °C (197.2 °F; 364.9 K)
Boiling point 280 °C (536 °F; 553 K)
Solubility in water Insoluble
Solubility in ethanol very soluble
Solubility in diethyl ether very soluble
Solubility in benzene very soluble
Solubility in chloroform soluble
Hazards
Flash point ?°C
Related compounds
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkverify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic