Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 19:50, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456778200 of page Acetarsol for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').← Previous edit Revision as of 19:50, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 476249756 of page Acetazolamide for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
⚫ {{Drugbox| Verifiedfields = changed
{{Chembox
⚫ | verifiedrevid = 443364328
⚫ | Verifiedfields = changed
| IUPAC_name = ''N''-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide
| Watchedfields = changed
| image = Acetazolamide skeletal.svg
⚫ | verifiedrevid = 399304535
| image2 = Acetazolamide 3D.png
| ImageFile = Acetarsol.svg

⚫ | ImageFile_Ref = {{chemboximage|correct|??}}
<!--Clinical data-->
| ImageSize = 244
| tradename = Diamox
| ImageName = Kekulé, skeletal formula of acetarsol
| Drugs.com = {{drugs.com|monograph|acetazolamide}}
| PIN = Acetarsone{{Citation needed|date = June 2011}}
| pregnancy_AU = B3
| SystematicName = (3-Acetamido-4-hydroxyphenyl)arsonic acid<ref>{{Cite web|url = http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1985|title = acetarsol - PubChem Public Chemical Database|work = The PubChem Project|location = USA|publisher = National Center for Biotechnology Information}}</ref>
| pregnancy_US = C
| OtherNames = 3-Acetamido-4-hydroxyphenylarsonic acid{{Citation needed|date = June 2011}}
| legal_UK = POM
| Section1 = {{Chembox Identifiers
| legal_US = Rx-only
⚫ | CASNo_Ref = {{cascite|correct|??}}
| routes_of_administration = Oral, ]
| CASNo = <!-- blanked - oldvalue: 97-44-9 -->

⚫ | ChEMBL_Ref = {{ebicite|changed|EBI}}
<!--Pharmacokinetic data-->
| ChEMBL = <!-- blanked - oldvalue: 1330792 -->
| PubChem = 1985 | bioavailability =
| metabolism = None
| PubChem_Ref = {{Pubchemcite|correct|pubchem}}
| elimination_half-life = 3 to 9 hours
⚫ | ChemSpiderID = 1908
| excretion = ]
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

⚫ | UNII = 806529YU1N
<!--Identifiers-->
⚫ | UNII_Ref = {{fdacite|correct|FDA}}
⚫ | CASNo_Ref = {{cascite|correct|CAS}}
| EINECS = 202-582-3
⚫ | CAS_number_Ref = {{cascite|correct|??}}
| UNNumber = 3465
| CAS_number = 59-66-5
⚫ | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07110 | ATC_prefix = S01
| MeSHName = Acetarsol | ATC_suffix = EC01
| ATCCode_prefix = A07 | PubChem = 1986
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| ATCCode_suffix = AX02
| DrugBank = DB00819
| ATC_Supplemental = {{ATC|G01|AB01}}, {{ATC|P01|CD02}}, {{ATC|P51|AD05}}
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| SMILES = CC(=O)Nc1cc(ccc1O)(O)(O)=O
⚫ | ChemSpiderID = 1909
| SMILES1 = CC(=O)NC1=CC(=CC=C1O)(O)(O)=O
⚫ | UNII_Ref = {{fdacite|correct|FDA}}
⚫ | StdInChI = 1S/C8H10AsNO5/c1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12/h2-4,12H,1H3,(H,10,11)(H2,13,14,15)
⚫ | UNII = O3FX965V0I
⚫ | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
⚫ | KEGG_Ref = {{keggcite|correct|kegg}}
| InChI = 1/C8H10AsNO5/c1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12/h2-4,12H,1H3,(H,10,11)(H2,13,14,15)
| KEGG = D00218
⚫ | StdInChIKey = ODFJOVXVLFUVNQ-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 27690
| InChIKey = ODFJOVXVLFUVNQ-UHFFFAOYAX}}
⚫ | ChEMBL_Ref = {{ebicite|correct|EBI}}
| Section2 = {{Chembox Properties
| ChEMBL = 20
| Formula = {{Chem|C|8|AsNH|10|O|5}}

| MolarMass = 275.0903 g mol<sup>-1</sup>
<!--Chemical data-->
| ExactMass = 274.977493852 g mol<sup>-1</sup>
| C=4 | H=6 | N=4 | O=3 | S=2
}}
| molecular_weight = 222.245 g/mol
| Section3 = {{Chembox Hazards
| smiles = O=S(=O)(c1nnc(s1)NC(=O)C)N
| GHSPictograms = {{GHS skull and crossbones}} {{GHS environment}}
| InChI = 1/C4H6N4O3S2/c1-2(9)6-3-7-8-4(12-3)13(5,10)11/h1H3,(H2,5,10,11)(H,6,7,9)
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|301|331|410}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
⚫ | StdInChI = 1S/C4H6N4O3S2/c1-2(9)6-3-7-8-4(12-3)13(5,10)11/h1H3,(H2,5,10,11)(H,6,7,9)
| PPhrases = {{P-phrases|261|273|301+310|311|501}}
⚫ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| EUClass = {{Hazchem T}} {{Hazchem N}}
⚫ | StdInChIKey = BZKPWHYZMXOIDC-UHFFFAOYSA-N
| RPhrases = {{R23/25}}, {{R50/53}}
| SPhrases = {{S20/21}}, {{S28}}, {{S45}}, {{S60}}, {{S61}}
}}
}} }}

Revision as of 19:50, 16 February 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 476249756 of page Acetazolamide with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Trade namesDiamox
AHFS/Drugs.comMonograph
Pregnancy
category
  • AU: B3
Routes of
administration		Oral, IV
ATC code
Legal status
Legal status
Pharmacokinetic data
MetabolismNone
Elimination half-life3 to 9 hours
ExcretionRenal
Identifiers
IUPAC name
  • N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
Chemical and physical data
FormulaC4H6N4O3S2
Molar mass222.245 g/mol g·mol
3D model (JSmol)
SMILES
  • O=S(=O)(c1nnc(s1)NC(=O)C)N
InChI
  • InChI=1S/C4H6N4O3S2/c1-2(9)6-3-7-8-4(12-3)13(5,10)11/h1H3,(H2,5,10,11)(H,6,7,9)
  • Key:BZKPWHYZMXOIDC-UHFFFAOYSA-N
  (what is this?)  (verify)