Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 20:02, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 475180606 of page Acriflavinium_chloride for the Chem/Drugbox validation project (updated: 'UNII', 'ChEMBL', 'ChEBI', 'StdInChI', 'StdInChIKey', '...← Previous edit Revision as of 20:02, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 464942404 of page Acrisorcin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| image = Acrisorcin.png
| verifiedrevid = 457803314 | verifiedrevid = 457803415
| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = <!-- blanked - oldvalue: 1S73VW819C -->
<!--Combo data-->
| ImageFile = Acriflavine.png
| type = combo
| ImageName = Wireframe of acriflavine
| component1 = 9-Aminoacridine
| IUPACName = 3,6-Diamino-10-methylacridin-10-ium chloride
| class1 =
| Section1 = {{Chembox Identifiers
| component2 = 4-Hexylresorcinol
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| class2 = ]
| ChEMBL = <!-- blanked - oldvalue: 354349 -->

| StdInChI1 = 1/C14H13N3.C13H11N3.ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10;/h2-8H,1H3,(H3,15,16);1-7H,14-15H2;1H
<!--Clinical data-->
| StdInChIKey1 = PEJLNXHANOHNSU-UHFFFAOYAC
| tradename =
| SMILES1 = .n1c3c(cc2c1cc(N)cc2)ccc(c3)N.Nc3cc2(c1cc(N)ccc1cc2cc3)C
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| InChI = 1S/C14H13N3.C13H11N3.ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10;/h2-8H,1H3,(H3,15,16);1-7H,14-15H2;1H
| pregnancy_US = <!-- A / B / C / D / X -->
| InChIKey = PEJLNXHANOHNSU-UHFFFAOYSA-N
| pregnancy_category =
| InChI1 = 1S/C14H13N3.C13H11N3.ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10;/h2-8H,1H3,(H3,15,16);1-7H,14-15H2;1H
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| InChIKey1 = PEJLNXHANOHNSU-UHFFFAOYSA-N
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = <!-- blanked - oldvalue: 86-40-8 --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| CASNo1 = 10597-46-3
| legal_status =
| CASNo1_Comment = (hydrochloride)
| routes_of_administration =
| PubChem = 443101

| PubChem_Ref = {{Pubchemcite}}
<!--Identifiers-->
| PubChem1 = 15558347
| CAS_number_Ref = {{cascite|changed|??}}
| PubChem1_Comment = (hydrochloride)
| CAS_number = <!-- blanked - oldvalue: 7527-91-5 -->
| PubChem1_Ref = {{Pubchemcite}}
| ChemSpiderID = 391386 | ATC_prefix = none
| ATC_suffix =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| PubChem = 24144
| ChemSpiderID1 = 21018
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| ChemSpiderID1_Comment = (hydrochloride)
| DrugBank =
| ChemSpiderID1_Ref = {{Chemspidercite}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| EINECS = 201-668-8
| ChemSpiderID = 22568
| ChEBI_Ref = {{ebicite|changed|EBI}}
| UNII_Ref = {{fdacite|correct|FDA}}
| ChEBI = <!-- blanked - oldvalue: 383703 -->
| UNII = 2U918O4BEV
| ATCCode_prefix = R02
| KEGG_Ref = {{keggcite|correct|kegg}}
| ATCCode_suffix = AA13
| KEGG = D02759
| ATC_Supplemental = QG01AC90
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| SMILES = .C1=C2C=C(N)C=CC2=CC2=C1C=C(N)C=C2
| ChEMBL = <!-- blanked - oldvalue: 1201038 -->
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| smiles = Oc1cc(O)c(cc1)CCCCCC.n1c3c(c(c2c1cccc2)N)cccc3
| StdInChI = 1S/C14H13N3.C13H11N3.ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10;/h2-8H,1H3,(H3,15,16);1-7H,14-15H2;1H
| InChI = 1/C13H10N2.C12H18O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h1-8H,(H2,14,15);7-9,13-14H,2-6H2,1H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| InChIKey = YZODJQFXMFEJRM-UHFFFAOYAT
| StdInChIKey = PEJLNXHANOHNSU-UHFFFAOYSA-N
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
}}
| StdInChI = 1S/C13H10N2.C12H18O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h1-8H,(H2,14,15);7-9,13-14H,2-6H2,1H3
| Section2 = {{Chembox Properties
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| C = 14
| StdInChIKey = YZODJQFXMFEJRM-UHFFFAOYSA-N
| H = 14
| Cl = 1
| N = 3}}
}} }}

Revision as of 20:02, 16 February 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 464942404 of page Acrisorcin with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Combination of
4-HexylresorcinolAntiseptic
Clinical data
ATC code
  • none
Identifiers
PubChem CID
ChemSpider
UNII
KEGG
Chemical and physical data
3D model (JSmol)
SMILES
  • Oc1cc(O)c(cc1)CCCCCC.n1c3c(c(c2c1cccc2)N)cccc3
InChI
  • InChI=1S/C13H10N2.C12H18O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h1-8H,(H2,14,15);7-9,13-14H,2-6H2,1H3
  • Key:YZODJQFXMFEJRM-UHFFFAOYSA-N
  (what is this?)  (verify)
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic