| Revision as of 20:14, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 472431979 of page Aflatoxin for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit |
Revision as of 20:14, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{drugbox}} taken from revid 473937827 of page Aflibercept for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 456484564 |
|
| verifiedrevid = 461741416 |
|
| ImageFile = (–)-Aflatoxin B1 Structural Formulae V.1.svg |
|
|
| ImageSize = |
|
| IUPAC_name = |
|
|
| image = |
|
| ImageFile2 = Aflatoxin b1 3d structure.png |
|
|
|
|
|
| ImageAlt = |
|
|
|
<!--Clinical data--> |
|
| ImageCaption = ] of (–)-Alflatoxin B<sub>1</sub> |
|
|
|
| tradename = Eylea |
|
| ImageCaption2 = 3D Structure of aflatoxin B<sub>1</sub> |
|
|
|
| licence_US = Aflibercept |
|
|IUPACName = |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| OtherNames = Aflatoxin B1 |
|
|
|
| pregnancy_US = C |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| pregnancy_category = |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| ⚫ |
| ChemSpiderID = 13758 |
|
|
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| StdInChI = 1S/C17H12O6/c1-20-10-6-11-14(8-4-5-21-17(8)22-11)15-13(10)7-2-3-9(18)12(7)16(19)23-15/h4-6,8,17H,2-3H2,1H3 |
|
|
|
| legal_US = Rx-only |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| legal_status = |
|
| StdInChIKey = OQIQSTLJSLGHID-UHFFFAOYSA-N |
|
|
|
| routes_of_administration = Injection |
| ⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
|
|
|
|
| CASNo = |
|
|
|
<!--Pharmacokinetic data--> |
| ⚫ |
| PubChem = 14403 |
|
|
|
| bioavailability = |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
|
| protein_bound = |
| ⚫ |
| ChEMBL = <!-- blanked - oldvalue: 1697694 --> |
|
|
|
| metabolism = |
|
| SMILES = O=C5C=4C(=O)Oc3c1c(OC2O\C=C/C12)cc(OC)c3C=4CC5 |
|
|
|
| elimination_half-life = |
|
}} |
|
|
|
| excretion = |
|
| Section2 = {{Chembox Properties |
|
|
|
|
|
| Formula = |
|
|
|
<!--Identifiers--> |
|
| MolarMass = |
|
|
⚫ |
| CAS_number_Ref = {{cascite|changed|??}} |
|
| Appearance = |
|
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 862111-32-8 --> |
|
| Density = |
|
|
| MeltingPt = |
|
| ATC_prefix = S01 |
|
| BoilingPt = |
|
| ATC_suffix = LA05 |
|
| Solubility = }} |
|
| ATC_supplemental = |
|
⚫ |
| PubChem = |
|
| Section3 = {{Chembox Hazards |
|
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| MainHazards = |
|
|
| FlashPt = |
|
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| Autoignition = }} |
|
|
|
| UNII = 15C2VL427D |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D09574 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = NA |
|
|
|
|
|
<!--Chemical data--> |
|
|
| chemical_formula = |
|
|
| C=4318 | H=6788 | N=1164 | O=1304 | S=32 |
|
|
| molecular_weight = 96.90 ] |
|
}} |
|
}} |
