Revision as of 04:46, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,083 edits Saving copy of the {{chembox}} taken from revid 445026678 of page Allopumiliotoxin_267A for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 04:47, 17 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,083 edits Saving copy of the {{chembox}} taken from revid 457807104 of page Allantoic_acid for the Chem/Drugbox validation project (updated: 'ChEBI', 'KEGG', 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 399494955 |
|
| verifiedrevid = 457805951 |
|
|ImageFile=Allopumiliotoxin267A.png |
|
|
|
| ImageFile = Allantoic acid.png |
|
|ImageSize=240 |
|
| ImageSize = 180px |
|
|IUPACName=(7''R'',8''R'',8a''S'')-8-Methyl-6--1,2,3,5,7,8a-hexahydroindolizine-7,8-diol |
|
|
|
| PIN = 2,2-Diureidoacetic acid |
|
|OtherNames= |
|
|
|
| SystematicName = 2,2-Bis(carbamoylamino)acetic acid |
⚫ |
|Section1={{Chembox Identifiers |
|
|
|
| OtherNames = 2,2-Diacetic acid<br /> |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
Diureidoacetate |
⚫ |
| ChemSpiderID = 4580699 |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
| InChI = 1/C16H29NO2/c1-4-5-7-12(2)10-13-11-17-9-6-8-14(17)16(3,19)15(13)18/h10,12,14-15,18-19H,4-9,11H2,1-3H3/b13-10+/t12-,14+,15-,16-/m1/s1 |
|
|
|
| InChI1 = 1/C4H8N4O4/c5-3(11)7-1(2(9)10)8-4(6)12/h1H,(H,9,10)(H3,5,7,11)(H3,6,8,12) |
|
| InChIKey = LWXKAVPXEDNHLL-VRUXTKGDBX |
|
|
|
| InChIKey1 = NUCLJNSWZCHRKL-UHFFFAOYAF |
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| SMILES1 = O=C(NC(C(=O)O)NC(=O)N)N |
|
| StdInChI = 1S/C16H29NO2/c1-4-5-7-12(2)10-13-11-17-9-6-8-14(17)16(3,19)15(13)18/h10,12,14-15,18-19H,4-9,11H2,1-3H3/b13-10+/t12-,14+,15-,16-/m1/s1 |
|
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
⚫ |
| CASNo = <!-- blanked - oldvalue: 99-16-1 --> |
|
⚫ |
| PubChem = 203 |
|
|
| PubChem_Ref = {{pubchemcite|correct|??}} |
|
⚫ |
| ChemSpiderID = 198 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| EINECS = 202-735-4 |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = <!-- blanked - oldvalue: C00499 --> |
|
|
| MeSHName = Allantoic+acid |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 30837 |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C4H8N4O4/c5-3(11)7-1(2(9)10)8-4(6)12/h1H,(H,9,10)(H3,5,7,11)(H3,6,8,12) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = LWXKAVPXEDNHLL-VRUXTKGDSA-N |
|
| StdInChIKey = NUCLJNSWZCHRKL-UHFFFAOYSA-N |
|
|
| SMILES = NC(=O)NC(NC(N)=O)C(O)=O |
⚫ |
| CASNo = <!-- blanked - oldvalue: 73376-38-2 --> |
|
|
|
| InChI = 1S/C4H8N4O4/c5-3(11)7-1(2(9)10)8-4(6)12/h1H,(H,9,10)(H3,5,7,11)(H3,6,8,12) |
⚫ |
| PubChem = 5470308 |
|
|
|
| InChIKey = NUCLJNSWZCHRKL-UHFFFAOYSA-N |
|
| SMILES = O1C(=C\(C)CCCC)\CN2(1(O)C)CCC2 |
|
|
|
| Beilstein = 1790227 |
|
}} |
|
|
|
| 3DMet = B01270}} |
|
|Section2={{Chembox Properties |
|
|Section2= {{Chembox Properties |
|
| C=16 | H=29 | N=1 | O=2 |
|
|
|
| Formula=C<sub>4</sub>H<sub>8</sub>N<sub>4</sub>O<sub>4</sub> |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= 1.618 g/cm<sup>3</sup> |
|
| MeltingPt= |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3= {{Chembox Hazards |
|
⚫ |
| FlashPt=219.4 °C |
|
| MainHazards=Highly toxic |
|
⚫ |
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |