Revision as of 05:22, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 448081843 of page Allylnorpethidine for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 05:22, 17 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457187272 of page Allylprodine for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 421226707 |
|
| verifiedrevid = 448490826 |
|
| IUPAC_name = ethyl 4-phenyl-1-prop-2-enylpiperidine-4-carboxylate |
|
| IUPAC_name = (1-methyl-4-phenyl-3-prop-2-enylpiperidin-4-yl) propanoate |
|
| image = WIN-7681.svg |
|
| image = Allylprodine.svg |
|
| width = 160 |
|
| width = 200px |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
Line 13: |
Line 13: |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- Schedule I --> |
|
| legal_CA = <!-- Schedule I --> |
|
| legal_UK = |
|
| legal_UK = Class A |
|
| legal_US = |
|
| legal_US = Schedule I |
|
|
| routes_of_administration = |
|
| legal_status = |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
Line 25: |
Line 25: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 2372-70-5 --> |
|
| CAS_number = <!-- blanked - oldvalue: 25384-17-2 --> |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 16915 |
|
| PubChem = 32938 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = DB01542 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 16026 |
|
| ChemSpiderID = 30495 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 4343OEZ18O |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=17 | H=23 | N=1 | O=2 |
|
| C=18 | H=25 | N=1 | O=2 |
|
| molecular_weight = 273.37 g/mol |
|
| molecular_weight = 287.397 g/mol |
|
| smiles = O=C(OCC)C2(c1ccccc1)CCN(C\C=C)CC2 |
|
| smiles = O=C(OC2(c1ccccc1)CCN(C)CC2C/C=C)CC |
|
| InChI = 1/C17H23NO2/c1-3-12-18-13-10-17(11-14-18,16(19)20-4-2)15-8-6-5-7-9-15/h3,5-9H,1,4,10-14H2,2H3 |
|
| InChI = 1/C18H25NO2/c1-4-9-16-14-19(3)13-12-18(16,21-17(20)5-2)15-10-7-6-8-11-15/h4,6-8,10-11,16H,1,5,9,12-14H2,2-3H3 |
|
| InChIKey = YUNKDDDGCRLMAF-UHFFFAOYAA |
|
| InChIKey = KGYFOSCXVAXULR-UHFFFAOYAP |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C17H23NO2/c1-3-12-18-13-10-17(11-14-18,16(19)20-4-2)15-8-6-5-7-9-15/h3,5-9H,1,4,10-14H2,2H3 |
|
| StdInChI = 1S/C18H25NO2/c1-4-9-16-14-19(3)13-12-18(16,21-17(20)5-2)15-10-7-6-8-11-15/h4,6-8,10-11,16H,1,5,9,12-14H2,2-3H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = YUNKDDDGCRLMAF-UHFFFAOYSA-N |
|
| StdInChIKey = KGYFOSCXVAXULR-UHFFFAOYSA-N |
|
| synonyms = Allylnorpethidine, WIN-7681 |
|
| synonyms = Allylprodine |
|
}} |
|
}} |