| Revision as of 10:39, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 477049904 of page 7-Hydroxymitragynine for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 10:40, 17 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464810689 of page 7-Methylguanosine for the Chem/Drugbox validation project (updated: 'ChEBI', 'CASNo').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Chembox |
|
⚫ |
| ImageFile = 7-Methylguanosine.svg |
|
| Verifiedfields = changed |
|
|
|
| ImageSize = 180px |
|
| Watchedfields = changed |
|
|
|
| IUPACName = 7-Methylguanosine |
|
| verifiedrevid = 452532183 |
|
|
|
| OtherNames = N7-Methylguanosine; 2-Amino-1,6-dihydro-7-methyl-6-oxo-9-β-<small>D</small>-ribofuranosylpurinium |
| ⚫ |
| ImageFile = 7-Hydroxymitragynine.svg |
|
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
| ImageName = Stereo, Kekulé, skeletal formula of 7-hydroxymitragynine with an explicit hydrogen added |
|
|
| IUPACName = (α''E'',2''S'',3''S'',7a''S'',12b''S'')-3-Ethyl-1,2,3,4,6,7,7a,12b-octahydro-7a-hydroxy-8-methoxy-α-(methoxymethylene)indoloquinolizine-2-acetic acid methyl ester{{Citation needed|date = November 2011}} |
|
|
| OtherNames = 7α-Hydroxy-7''H''-mitragynine;<ref name=CAS>]: Columbus, OH, 2004; RN 174418-82-7 (accessed via SciFinder Scholar, version 2007.3; November 30, 2011)</ref> |
|
|
9-Methoxycorynantheidine hydroxyindolenine<ref name=CAS/> |
|
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| Abbreviations = m7G; m<sup>7</sup>G |
|
| CASNo = <!-- blanked - oldvalue: 174418-82-7 --> |
|
| CASNo = <!-- blanked - oldvalue: 20244-86-4 --> |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|}} |
| ⚫ |
| PubChem = 44301524 |
|
|
|
| ChEBI = 20794 |
|
| PubChem_Ref = {{Pubchemcite|correct|Pubchem}} |
|
|
⚫ |
| PubChem = 445404 |
|
| ChemSpiderID = 23152144 |
|
| ChemSpiderID = 393054 |
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
|
| SMILES = O=C3/N=C(/N)Nc1c3n(c12O((O)2O)CO)C |
|
| ChEMBL = 61630 |
|
|
|
| InChI = 1/C11H15N5O5/c1-15-3-16(8-5(15)9(20)14-11(12)13-8)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2-,12,13,14,20)/p+1/t4-,6-,7-,10-/m1/s1 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
|
| InChIKey = OGHAROSJZRTIOK-UJMNIJGGBX |
|
| SMILES = CC1CN2CC3(O)C(=Nc4cccc(OC)c34)2C1\C(=C/OC)C(=O)OC |
|
|
|
| StdInChI = 1S/C11H15N5O5/c1-15-3-16(8-5(15)9(20)14-11(12)13-8)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2-,12,13,14,20)/p+1/t4-,6-,7-,10-/m1/s1 |
|
| SMILES1 = CC1CN2CC3(O)C(=NC4=CC=CC(OC)=C34)2C1\C(=C/OC)C(=O)OC |
|
|
⚫ |
| StdInChIKey = OGHAROSJZRTIOK-KQYNXXCUSA-O |
|
| StdInChI = 1S/C23H30N2O5/c1-5-14-12-25-10-9-23(27)20-17(7-6-8-19(20)29-3)24-21(23)18(25)11-15(14)16(13-28-2)22(26)30-4/h6-8,13-15,18,27H,5,9-12H2,1-4H3/b16-13+/t14-,15+,18+,23+/m1/s1 |
|
|
⚫ |
}} |
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| ⚫ |
| StdInChIKey = RYENLSMHLCNXJT-CYXFISRXSA-N |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| ⚫ |
}} |
|
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| C=23|N=2|H=30|O=5 |
|
| C=11|H=16|N=5|O=5 |
|
|
| Appearance = |
|
| ExactMass = 414.215472080 g mol<sup>−1</sup> |
|
|
| LogP = 1.266 |
|
| Density = |
|
| pKa = 12.203 |
|
| MeltingPt = |
|
| pKb = 1.794 |
|
| BoilingPt = |
|
|
| Solubility = |
|
}} |
|
}} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |
