Revision as of 09:50, 20 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Saving copy of the {{chembox}} taken from revid 472979596 of page Sodium_bisulfite for the Chem/Drugbox validation project (updated: 'ChEBI', 'ChEMBL').← Previous edit |
Revision as of 09:53, 20 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Saving copy of the {{chembox}} taken from revid 477355212 of page Sodium_gluconate for the Chem/Drugbox validation project (updated: 'StdInChI', 'StdInChIKey', 'ChEMBL').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Chembox |
|
⚫ |
| ImageFile = sodium gluconate.svg |
|
| Verifiedfields = changed |
|
|
⚫ |
| ImageSize = 200px |
|
| verifiedrevid = 472263745 |
|
|
|
| IUPACName = Sodium (2''R'',3''S'',4''R'',5''R'')-2,3,4,5,6-pentahydroxyhexanoate |
⚫ |
| ImageFile = Sodium bisulfite.png |
|
|
|
| OtherNames = Sodium <small>D</small>-gluconate |
⚫ |
| ImageSize = 140px |
|
|
| ImageFile1 = Sodium-bisulfite-3D-balls.png |
|
|
| ImageSize1 = 160px |
|
|
| ImageName1 = Ball-and-stick model of a bisulfite anion (left) and a sodium cation (right) |
|
|
| IUPACName = Sodium hydrogen sulfite |
|
|
| OtherNames = E222 |
|
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| CASNo = 7631-90-5 |
|
| CASNo = 527-07-1 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| StdInChI = 1S/C6H12O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/q;+1/p-1/t2-,3-,4+,5-;/m1./s1 |
|
| ChEBI = 26709 |
|
|
⚫ |
| StdInChIKey = UPMFZISCCZSDND-JJKGCWMISA-M |
|
| PubChem = 656672 |
|
| PubChem = 84687 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 571016 |
|
| ChemSpiderID = 76397 |
|
⚫ |
| ChEMBL = <!-- blanked - oldvalue: 1200919 --> |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
⚫ |
| SMILES = .C(=O)(O)(O)(O)(O)CO |
⚫ |
| ChEMBL = <!-- blanked - oldvalue: 1689285 --> |
|
|
|
| InChI = InChI=1S/C6H12O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/q;+1/p-1/t2-,3-,4+,5-;/m1./s1 |
⚫ |
| SMILES = .S(=O)O |
|
|
| InChI = 1/Na.H2O3S/c;1-4(2)3/h;(H2,1,2,3)/q+1;/p-1 |
|
|
| InChIKey = DWAQJAXMDSEUJJ-REWHXWOFAL |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/Na.H2O3S/c;1-4(2)3/h;(H2,1,2,3)/q+1;/p-1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = DWAQJAXMDSEUJJ-UHFFFAOYSA-M |
|
|
| RTECS = VZ2000000 |
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| C=6|H=11|Na=1|O=7 |
|
| Formula = NaHSO<sub>3</sub> |
|
|
| MolarMass = 104.061 g/mol |
|
| Appearance = |
|
| Appearance = White solid |
|
| Density = |
|
|
| MeltingPt = |
|
| Density = 1.48 g/cm<sup>3</sup> |
|
|
| MeltingPtC = 150 |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = 42 g/100 mL |
|
|
}} |
|
}} |
|
| Section7 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| ExternalMSDS = |
|
| MainHazards = |
|
| EUIndex = 016-064-00-8 |
|
| FlashPt = |
|
|
| Autoignition = |
|
| EUClass = Harmful ('''Xn''') |
|
|
| RPhrases = {{R22}} {{R31}} |
|
|
| SPhrases = {{S2}}, {{S25}}, {{S46}} |
|
|
| NFPA-H = 2 |
|
|
| NFPA-F = 1 |
|
|
| NFPA-R = 2 |
|
|
| FlashPt = Non-flammable |
|
|
}} |
|
|
| Section8 = {{Chembox Related |
|
|
| OtherAnions = ]<br/>] |
|
|
| OtherCations = ] |
|
|
}} |
|
}} |
|
}} |
|
}} |