| Revision as of 10:51, 20 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444228533 of page Thymidine_diphosphate_glucose for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').← Previous edit |
Revision as of 10:57, 20 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 475187839 of page Tobramycin/dexamethasone for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL', 'ChEBI', 'KEGG', 'CAS_number', ...Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Drugbox |
|
| verifiedrevid = 444227537 |
|
| verifiedrevid = 448047811 |
|
|
|
|
| ImageFile = Thymidine diphosphate glucose.png |
|
|
|
<!--Combo data--> |
|
| ImageSize = 200px |
|
|
|
| type = combo |
|
| IUPACName = <nowiki>methoxy-oxidophosphoryl] hydrogen phosphate |
|
|
|
| component1 = Tobramycin |
|
| OtherNames = TDP-glucose; dTDP-glucose |
|
|
|
| class1 = ] |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| component2 = Dexamethasone |
|
| CASNo = <!-- blanked - oldvalue: 2196-62-5 --> |
|
|
|
| class2 = ] |
|
| ChEMBL = 412989 |
|
|
|
|
| ⚫ |
| PubChem = 25202390 |
|
|
|
<!--Clinical data--> |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 15700 |
|
| tradename = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| SMILES = CC1=CN(C(=O)NC1=O)2C((O2)COP(=O)(O)OP(=O)(O)O3((((O3)CO)O)O)O)O |
|
|
| ChEMBL = 412989 |
|
| pregnancy_US = C |
|
|
| pregnancy_category = |
|
| PubChem = 443210 |
|
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ChemSpiderID = 391476 |
|
|
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 15700 |
|
| legal_US = Rx-only |
|
|
| legal_status = |
|
| SMILES = O=C1\C(=C/N(C(=O)N1)2O((O)C2)COP(=O)(O)OP(=O)(O)O3O((O)(O)3O)CO)C |
|
|
|
| routes_of_administration = ] |
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
|
|
| StdInChI=1S/C16H26N2O16P2/c1-6-3-18(16(25)17-14(6)24)10-2-7(20)9(31-10)5-30-35(26,27)34-36(28,29)33-15-13(23)12(22)11(21)8(4-19)32-15/h3,7-13,15,19-23H,2,4-5H2,1H3,(H,26,27)(H,28,29)(H,17,24,25)/t7-,8+,9+,10+,11+,12-,13+,15+/m0/s1 |
|
|
|
<!--Identifiers--> |
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| CAS_number = 32986-56-4 |
| ⚫ |
| StdInChIKey = YSYKRGRSMLTJNL-URARBOGNSA-N |
|
|
|
| ATCvet = |
|
}} |
|
|
|
| ATC_prefix = S01 |
|
| Section2 = {{Chembox Properties |
|
|
|
| ATC_suffix = CA01 |
|
| C=16|H=26|N=2|O=16|P=2 |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| Appearance = |
|
|
| Density = |
|
| ChemSpiderID = 33377 |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| MeltingPt = |
|
|
|
| StdInChI = 1S/C18H37N5O9/c19-3-9-8(25)2-7(22)17(29-9)31-15-5(20)1-6(21)16(14(15)28)32-18-13(27)11(23)12(26)10(4-24)30-18/h5-18,24-28H,1-4,19-23H2/t5-,6+,7+,8-,9+,10+,11-,12+,13+,14-,15+,16-,17+,18+/m0/s1 |
|
| BoilingPt = |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| Solubility = }} |
|
|
⚫ |
| StdInChIKey = NLVFBUXFDBBNBW-PBSUHMDJSA-N |
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
| ChEMBL = 1747 |
|
| FlashPt = |
|
| ChEBI = 28864 |
|
| Autoignition = }} |
|
| KEGG = D00063 |
|
⚫ |
| PubChem = |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00684 |
|
}} |
|
}} |
