| Revision as of 20:57, 20 December 2022 editAnomieBOT (talk | contribs)Bots6,590,343 editsm Dating maintenance tags: {{Cn}}← Previous edit | Latest revision as of 15:06, 16 March 2023 edit undoOzzie10aaaa (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers214,302 editsm Cleaned up using AutoEd | ||
| Line 6: | Line 6: | ||
| <!--Clinical data--> | <!--Clinical data--> | ||
| | tradename = |
| tradename = | ||
| | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | ||
| | pregnancy_US = <!-- A / B / C / D / X --> | | pregnancy_US = <!-- A / B / C / D / X --> | ||
| | pregnancy_category = |
| pregnancy_category = | ||
| | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | ||
| | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | ||
| | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | ||
| | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | ||
| | legal_status = |
| legal_status = | ||
| | routes_of_administration = |
| routes_of_administration = | ||
| <!--Pharmacokinetic data--> | <!--Pharmacokinetic data--> | ||
| | bioavailability = |
| bioavailability = | ||
| | protein_bound = |
| protein_bound = | ||
| | metabolism = |
| metabolism = | ||
| | elimination_half-life = |
| elimination_half-life = | ||
| | excretion = |
| excretion = | ||
| <!--Identifiers--> | <!--Identifiers--> | ||
| Line 28: | Line 28: | ||
| | CAS_number = 187949-02-6 | | CAS_number = 187949-02-6 | ||
| | ATC_prefix = none | | ATC_prefix = none | ||
| | ATC_suffix = |
| ATC_suffix = | ||
| | ATC_supplemental = |
| ATC_supplemental = | ||
| | PubChem = 208952 | | PubChem = 208952 | ||
| | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ||
| | DrugBank = |
| DrugBank = | ||
| | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
| | ChemSpiderID = 181045 | | ChemSpiderID = 181045 | ||
| Line 43: | Line 43: | ||
| <!--Chemical data--> | <!--Chemical data--> | ||
| | chemical_formula = |
| chemical_formula = | ||
| | C=20 | H=16 | Cl=1 | F=2 | N=5 | O=2 | | C=20 | H=16 | Cl=1 | F=2 | N=5 | O=2 | ||
| | smiles = Fc1ccc(c(F)c1)(O)((N3\C=N/c2cc(Cl)ccc2C3=O)C)Cn4ncnc4 | | smiles = Fc1ccc(c(F)c1)(O)((N3\C=N/c2cc(Cl)ccc2C3=O)C)Cn4ncnc4 | ||
Latest revision as of 15:06, 16 March 2023
Chemical compound Pharmaceutical compound | |
| Clinical data | |
|---|---|
| ATC code |
|
| Identifiers | |
IUPAC name
| |
| CAS Number | |
| PubChem CID | |
| ChemSpider | |
| UNII | |
| KEGG | |
| ChEMBL | |
| CompTox Dashboard (EPA) | |
| ECHA InfoCard | 100.170.829  |
| Chemical and physical data | |
| Formula | C20H16ClF2N5O2 |
| Molar mass | 431.83 g·mol |
| 3D model (JSmol) | |
SMILES
| |
InChI
| |
| (verify) | |
Albaconazole (development code UR-9825) is an experimental triazole antifungal. It has potential broad-spectrum activity. The drug blocks a number of CYP450 liver enzymes.
It has also been studied as an antiprotozoal agent.
References
- "Albaconazole". Adis Insight. Springer Nature Switzerland AG.
- Guedes PM, Urbina JA, de Lana M, Afonso LC, Veloso VM, Tafuri WL, et al. (November 2004). "Activity of the new triazole derivative albaconazole against Trypanosoma (Schizotrypanum) cruzi in dog hosts". Antimicrobial Agents and Chemotherapy. 48 (11): 4286–92. doi:10.1128/AAC.48.11.4286-4292.2004. PMC 525424. PMID 15504854.
 | This antiinfective drug article is a stub. You can help Misplaced Pages by expanding it. |