Misplaced Pages

Methyl isopropyl ketone: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively← Previous editContent deleted Content addedVisualWikitext
Revision as of 17:13, 19 September 2022 editBeland (talk | contribs)Autopatrolled, Administrators237,091 editsm MOS:UNITSYMBOLS (via WP:JWB)← Previous edit Latest revision as of 11:51, 18 May 2023 edit undoM97uzivatel (talk | contribs)Extended confirmed users6,582 editsNo edit summary 
Line 1: Line 1:
{{chembox {{chembox
| Verifiedfields = changed |Verifiedfields = changed
| Watchedfields = changed |Watchedfields = changed
| verifiedrevid = 384074900 |verifiedrevid = 384074900
| Name = Methyl isopropyl ketone |Name = Methyl isopropyl ketone
| ImageFile = Methyl isopropyl ketone-Structural Formula V.1.svg |ImageFile = Methyl isopropyl ketone-Structural Formula V.1.svg
| ImageSize = 150px |ImageSize = 150px
| ImageAlt = Structural formula of methyl isopropyl ketone |ImageAlt = Structural formula of methyl isopropyl ketone
| ImageFile1 = Methyl isopropyl ketone molecule ball.png |ImageFile1 = Methyl isopropyl ketone molecule ball.png
| ImageSize1 = 160 |ImageSize1 = 160
| ImageAlt1 = Ball-and-stick model of the methyl isopropyl ketone molecule |ImageAlt1 = Ball-and-stick model of the methyl isopropyl ketone molecule
| PIN = 3-Methylbutan-2-one |PIN = 3-Methylbutan-2-one
| OtherNames = Isopropyl methyl ketone, MIPK, 2-Acetyl propane 3-Methyl-2-butanone |OtherNames = Isopropyl methyl ketone, MIPK, 2-Acetyl propane 3-Methyl-2-butanone
|Section1={{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}} |CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 563-80-4 |CASNo = 563-80-4
| UNII_Ref = {{fdacite|correct|FDA}} |UNII_Ref = {{fdacite|correct|FDA}}
| UNII = V8DP6THY5O |UNII = V8DP6THY5O
| SMILES = CC(C)C(=O)C |SMILES = CC(C)C(=O)C
| EINECS = 209-264-3 |EINECS = 209-264-3
| PubChem = 11251 |PubChem = 11251
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 10777 |ChemSpiderID = 10777
| InChI = 1/C5H10O/c1-4(2)5(3)6/h4H,1-3H3 |InChI = 1/C5H10O/c1-4(2)5(3)6/h4H,1-3H3
| InChIKey = SYBYTAAJFKOIEJ-UHFFFAOYAE |InChIKey = SYBYTAAJFKOIEJ-UHFFFAOYAE
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C5H10O/c1-4(2)5(3)6/h4H,1-3H3 |StdInChI = 1S/C5H10O/c1-4(2)5(3)6/h4H,1-3H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = SYBYTAAJFKOIEJ-UHFFFAOYSA-N |StdInChIKey = SYBYTAAJFKOIEJ-UHFFFAOYSA-N
}} }}
|Section2={{Chembox Properties |Section2={{Chembox Properties
| Formula = C<sub>5</sub>H<sub>10</sub>O |Formula = C<sub>5</sub>H<sub>10</sub>O
| MolarMass = 86.13 g/mol |MolarMass = 86.13 g/mol
| Density = 0.803 g/cm<sup>3</sup> (20&nbsp;°C) |Density = 0.803 g/cm<sup>3</sup> (20&nbsp;°C)
| RefractIndex = 1.389 (20&nbsp;°C) |RefractIndex = 1.389 (20&nbsp;°C)
| Viscosity = 0.48 mPa·s (20&nbsp;°C) |Viscosity = 0.48 mPa·s (20&nbsp;°C)
| VaporPressure = 8.6 kPa (20&nbsp;°C) |VaporPressure = 8.6 kPa (20&nbsp;°C)
| Appearance = Colorless liquid |Appearance = Colorless liquid
| Odor = Acetone-like |Odor = Acetone-like
| MeltingPtC = −92 |MeltingPtC = −92
| BoilingPtC = 92 |BoilingPtC = 92
| Solubility = 6-8.2 g/L (20&nbsp;°C) |Solubility = 6-8.2 g/L (20&nbsp;°C)
| MagSus = -58.45·10<sup>−6</sup> cm<sup>3</sup>/mol |MagSus = -58.45·10<sup>−6</sup> cm<sup>3</sup>/mol
}} }}
|Section7={{Chembox Hazards |Section3={{Chembox Hazards
| FlashPt = {{convert|5|C|F}} |FlashPt = {{convert|5|C|F}}
| AutoignitionPtC = 475 |AutoignitionPtC = 475
| PEL = none<ref name=PGCH>{{PGCH|0424}}</ref> |PEL = none<ref name=PGCH>{{PGCH|0424}}</ref>
| IDLH = N.D.<ref name=PGCH/> |IDLH = N.D.<ref name=PGCH/>
| REL = TWA 200 ppm (705 mg/m<sup>3</sup>)<ref name=PGCH/> |REL = TWA 200 ppm (705 mg/m<sup>3</sup>)<ref name=PGCH/>
}} }}
}} }}

Latest revision as of 11:51, 18 May 2023

Methyl isopropyl ketone
Structural formula of methyl isopropyl ketone
Ball-and-stick model of the methyl isopropyl ketone molecule
Names
Preferred IUPAC name 3-Methylbutan-2-one
Other names Isopropyl methyl ketone, MIPK, 2-Acetyl propane 3-Methyl-2-butanone
Identifiers
CAS Number
3D model (JSmol)
ChemSpider
ECHA InfoCard 100.008.423 Edit this at Wikidata
EC Number
  • 209-264-3
PubChem CID
UNII
CompTox Dashboard (EPA)
InChI
  • InChI=1S/C5H10O/c1-4(2)5(3)6/h4H,1-3H3Key: SYBYTAAJFKOIEJ-UHFFFAOYSA-N
  • InChI=1/C5H10O/c1-4(2)5(3)6/h4H,1-3H3Key: SYBYTAAJFKOIEJ-UHFFFAOYAE
SMILES
  • CC(C)C(=O)C
Properties
Chemical formula C5H10O
Molar mass 86.13 g/mol
Appearance Colorless liquid
Odor Acetone-like
Density 0.803 g/cm (20 °C)
Melting point −92 °C (−134 °F; 181 K)
Boiling point 92 °C (198 °F; 365 K)
Solubility in water 6-8.2 g/L (20 °C)
Vapor pressure 8.6 kPa (20 °C)
Magnetic susceptibility (χ) -58.45·10 cm/mol
Refractive index (nD) 1.389 (20 °C)
Viscosity 0.48 mPa·s (20 °C)
Hazards
Flash point 5 °C (41 °F)
Autoignition
temperature 		475 °C (887 °F; 748 K)
NIOSH (US health exposure limits):
PEL (Permissible) none
REL (Recommended) TWA 200 ppm (705 mg/m)
IDLH (Immediate danger) N.D.
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒N verify (what is  ?) Infobox references
Chemical compound

3-Methyl-2-butanone (methyl isopropyl ketone, MIPK) is a ketone and solvent of minor importance. It is comparable to MEK (Methyl ethyl ketone), but has a lower solvency and is more expensive.

References

  1. ^ NIOSH Pocket Guide to Chemical Hazards. "#0424". National Institute for Occupational Safety and Health (NIOSH).
  2. Dieter Stoye (2007), "Solvents", Ullmann's Encyclopedia of Industrial Chemistry (7th ed.), Wiley, pp. 55–56
Categories: