| Revision as of 19:33, 8 January 2007 editStepa (talk | contribs)1,402 editsm +pl:← Previous edit | Revision as of 13:27, 22 May 2007 edit undoEdgar181 (talk | contribs)Extended confirmed users196,325 edits chembox and data addedNext edit → | ||
| Line 1: | Line 1: | ||
| {{Chembox new | |||
| ⚫ | '''Methazole''' (C<sub>9</sub>H<sub>6</sub>Cl<sub>2</sub>N<sub>2</sub>O<sub>3</sub>) is a ]. | ||
| | ImageFile = Methazole.png | |||
| ==Names== | |||
| | ImageSize = 200px | |||
| *Oxydiazol | |||
| | IUPACName = 2-(3,4-Dichlorophenyl)-4-methyl-1,2,4-oxadiazolidine-3,5-dione | |||
| *VCS 438 | |||
| | OtherNames = Metazole<br>Oxydiazol<br>VCS 438<br>Paxilon<br>Probe | |||
| *Paxilon | |||
| | Section1 = {{Chembox Identifiers | |||
| *Probe | |||
| | CASNo = 20354-26-1 | |||
| | PubChem = 4690 | |||
| | SMILES = CN1C(=O)N(OC1=O)C2=CC(=C(C=C2)Cl)Cl | |||
| }} | |||
| | Section2 = {{Chembox Properties | |||
| | Formula = C<sub>9</sub>H<sub>6</sub>Cl<sub>2</sub>N<sub>2</sub>O<sub>3</sub> | |||
| | MolarMass = 261.061 g/mol | |||
| | Appearance = | |||
| | Density = | |||
| | MeltingPt = | |||
| | BoilingPt = | |||
| | Solubility = | |||
| }} | |||
| | Section3 = {{Chembox Hazards | |||
| | MainHazards = | |||
| | FlashPt = | |||
| | Autoignition = | |||
| }} | |||
| }} | |||
| ⚫ | '''Methazole''' (C<sub>9</sub>H<sub>6</sub>Cl<sub>2</sub>N<sub>2</sub>O<sub>3</sub>) is a ] in the family of herbicides known as oxadiazolones. | ||
| ==External links== | ==External links== | ||
| {{ChemicalSources}} | {{ChemicalSources}} | ||
| ] | ] | ||
| ] | |||
| ] | |||
| {{heterocyclic-stub}} | |||
| {{organic-compound-stub}} | |||
| ] | ] | ||
Revision as of 13:27, 22 May 2007
Methazole (C9H6Cl2N2O3) is a herbicide in the family of herbicides known as oxadiazolones.
External links
 | This article about a heterocyclic compound is a stub. You can help Misplaced Pages by expanding it. |