| Revision as of 12:20, 18 October 2009 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'CASNo_Ref') per Chem/Drugbox validation (report errors or [[user talk← Previous edit | Revision as of 19:46, 25 October 2009 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Script assisted update of chemical identifiers from ChemSpider for the Chem/Drugbox validation project.Next edit → | ||
| Line 6: | Line 6: | ||
| | width = 140 | | width = 140 | ||
| | CASNo_Ref = {{cascite}} | | CASNo_Ref = {{cascite}} | ||
| | InChI = 1/C23H30N2O/c1-3-23(26)25(21-12-8-5-9-13-21)22-14-16-24(17-15-22)18-19(2)20-10-6-4-7-11-20/h4-13,19,22H,3,14-18H2,1-2H3 | |||
| | InChIKey = UXIGUKSHASXDNI-UHFFFAOYAM | |||
| | CAS_number = | | CAS_number = | ||
| | synonyms = β-Methylfentanyl | | synonyms = β-Methylfentanyl | ||
| Line 15: | Line 17: | ||
| | C = 23 | H = 30 | N = 2 | O = 1 | | C = 23 | H = 30 | N = 2 | O = 1 | ||
| | molecular_weight = 350.497 g/mol | | molecular_weight = 350.497 g/mol | ||
| | smiles = |
| smiles = O=C(N(c1ccccc1)C3CCN(CC(c2ccccc2)C)CC3)CC | ||
| | bioavailability = | | bioavailability = | ||
| | protein_bound = | | protein_bound = | ||
Revision as of 19:46, 25 October 2009
Pharmaceutical compound | |
| Clinical data | |
|---|---|
| Other names | β-Methylfentanyl |
| ATC code |
|
| Identifiers | |
IUPAC name
| |
| PubChem CID | |
| ChemSpider | |
| CompTox Dashboard (EPA) | |
| Chemical and physical data | |
| Formula | C23H30N2O |
| Molar mass | 350.497 g/mol g·mol |
| 3D model (JSmol) | |
SMILES
| |
| (verify) | |
β-Methylfentanyl is an opioid analgesic that is an analogue of fentanyl.
β-Methylfentanyl was sold briefly on the black market in the early 1980s, before the introduction of the Federal Analog Act which for the first time attempted to control entire families of drugs based on their structural similarity rather than scheduling each drug individually as they appeared.
β-Methylfentanyl has similar effects to fentanyl. Side effects of fentanyl analogues are similar to those of fentanyl itself, which include itching, nausea, and respiratory depression, which can be serious and even life-threatening.
References
- Henderson GL. Designer Drugs: Past History and Future Prospects. Journal of Forensic Sciences 1988; 33(2):569-575