| Revision as of 13:31, 18 April 2011 edit58.111.66.244 (talk)No edit summary← Previous edit | Revision as of 13:42, 18 April 2011 edit undoCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (Next edit → | ||
| Line 1: | Line 1: | ||
| {{Drugbox | {{Drugbox | ||
| | verifiedrevid = 396294114 | |||
| | type = combo | | type = combo | ||
| | image = Amlodipine.png | | image = Amlodipine.png | ||
| Line 7: | Line 8: | ||
| | component2 = Atorvastatin | | component2 = Atorvastatin | ||
| | class2 = ] | | class2 = ] | ||
| | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| | ChemSpiderID = 7987512 | | ChemSpiderID = 7987512 | ||
| | InChI = 1/C33H35FN2O5.C20H25ClN2O5/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40;1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40);5-8,17,23H,4,9-11,22H2,1-3H3/t26-,27-;/m1./s1 | | InChI = 1/C33H35FN2O5.C20H25ClN2O5/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40;1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40);5-8,17,23H,4,9-11,22H2,1-3H3/t26-,27-;/m1./s1 | ||
| | smiles = Clc1ccccc1C2C(\C(=O)OC)=C(/N\C(=C2\C(=O)OCC)COCCN)C.O=C(O)C(O)C(O)CCn2c(c(c(c2c1ccc(F)cc1)c3ccccc3)C(=O)Nc4ccccc4)C(C)C | | smiles = Clc1ccccc1C2C(\C(=O)OC)=C(/N\C(=C2\C(=O)OCC)COCCN)C.O=C(O)C(O)C(O)CCn2c(c(c(c2c1ccc(F)cc1)c3ccccc3)C(=O)Nc4ccccc4)C(C)C | ||
| | InChIKey = PEAJXAZCGDWDGS-CNZCJKERBU | | InChIKey = PEAJXAZCGDWDGS-CNZCJKERBU | ||
| | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| | StdInChI = 1S/C33H35FN2O5.C20H25ClN2O5/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40;1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40);5-8,17,23H,4,9-11,22H2,1-3H3/t26-,27-;/m1./s1 | | StdInChI = 1S/C33H35FN2O5.C20H25ClN2O5/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40;1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40);5-8,17,23H,4,9-11,22H2,1-3H3/t26-,27-;/m1./s1 | ||
| | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| | StdInChIKey = PEAJXAZCGDWDGS-CNZCJKERSA-N | | StdInChIKey = PEAJXAZCGDWDGS-CNZCJKERSA-N | ||
| | CAS_number = | | CAS_number = | ||
Revision as of 13:42, 18 April 2011
Pharmaceutical compound | |
 | |
| Combination of | |
|---|---|
| Amlodipine | Calcium channel blocker |
| Atorvastatin | Statin |
| Clinical data | |
| Routes of administration | Oral |
| ATC code | |
| Legal status | |
| Legal status |
|
| Identifiers | |
| PubChem CID | |
| ChemSpider | |
| CompTox Dashboard (EPA) | |
| Chemical and physical data | |
| 3D model (JSmol) | |
SMILES
| |
InChI
| |
| (verify) | |
The drug combination atorvastatin/amlodipine (trade names Caduet in the US and Australia, and Envacar elsewhere) is a medication approved by the Food and Drug Administration (FDA) for the treatment of high cholesterol and high blood pressure. It is a fixed dose combination drug containing the calcium channel blocker amlodipine and the statin atorvastatin. It is being marketed by the pharmaceutical company Pfizer.
References
- "CADUET (amlodipine besylate/atorvastatin calcium) Tablets" (PDF). NDA 21-540/S-009. United States Food and Drug Administration. 2010. Retrieved 2010-09-25.
{{cite web}}: Unknown parameter|month=ignored (help)
External links
- Manufacturer's site (caduet.com)
 | This drug article relating to the cardiovascular system is a stub. You can help Misplaced Pages by expanding it. |